Added export_allowed file to make repository visible in cgit

36 files changed, 8517 insertions, 0 deletions

diff --git a/node_modules/sshpk/.npmignore b/node_modules/sshpk/.npmignore
new file mode 100644
index 0000000..8000b59
--- /dev/null
+++ b/node_modules/sshpk/.npmignore
@@ -0,0 +1,9 @@
+.gitmodules
+deps
+docs
+Makefile
+node_modules
+test
+tools
+coverage
+man/src
diff --git a/node_modules/sshpk/.travis.yml b/node_modules/sshpk/.travis.yml
new file mode 100644
index 0000000..c3394c2
--- /dev/null
+++ b/node_modules/sshpk/.travis.yml
@@ -0,0 +1,11 @@
+language: node_js
+node_js:
+  - "5.10"
+  - "4.4"
+  - "4.1"
+  - "0.12"
+  - "0.10"
+before_install:
+  - "make check"
+after_success:
+  - '[ "${TRAVIS_NODE_VERSION}" = "4.4" ] && make codecovio'
diff --git a/node_modules/sshpk/LICENSE b/node_modules/sshpk/LICENSE
new file mode 100644
index 0000000..f6d947d
--- /dev/null
+++ b/node_modules/sshpk/LICENSE
@@ -0,0 +1,18 @@
+Copyright Joyent, Inc. All rights reserved.
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to
+deal in the Software without restriction, including without limitation the
+rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+sell copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS
+IN THE SOFTWARE.
diff --git a/node_modules/sshpk/README.md b/node_modules/sshpk/README.md
new file mode 100644
index 0000000..5740f74
--- /dev/null
+++ b/node_modules/sshpk/README.md
@@ -0,0 +1,804 @@
+sshpk
+=========
+
+Parse, convert, fingerprint and use SSH keys (both public and private) in pure
+node -- no `ssh-keygen` or other external dependencies.
+
+Supports RSA, DSA, ECDSA (nistp-\*) and ED25519 key types, in PEM (PKCS#1, 
+PKCS#8) and OpenSSH formats.
+
+This library has been extracted from
+[`node-http-signature`](https://github.com/joyent/node-http-signature)
+(work by [Mark Cavage](https://github.com/mcavage) and
+[Dave Eddy](https://github.com/bahamas10)) and
+[`node-ssh-fingerprint`](https://github.com/bahamas10/node-ssh-fingerprint)
+(work by Dave Eddy), with additions (including ECDSA support) by
+[Alex Wilson](https://github.com/arekinath).
+
+Install
+-------
+
+```
+npm install sshpk
+```
+
+Examples
+--------
+
+```js
+var sshpk = require('sshpk');
+
+var fs = require('fs');
+
+/* Read in an OpenSSH-format public key */
+var keyPub = fs.readFileSync('id_rsa.pub');
+var key = sshpk.parseKey(keyPub, 'ssh');
+
+/* Get metadata about the key */
+console.log('type => %s', key.type);
+console.log('size => %d bits', key.size);
+console.log('comment => %s', key.comment);
+
+/* Compute key fingerprints, in new OpenSSH (>6.7) format, and old MD5 */
+console.log('fingerprint => %s', key.fingerprint().toString());
+console.log('old-style fingerprint => %s', key.fingerprint('md5').toString());
+```
+
+Example output:
+
+```
+type => rsa
+size => 2048 bits
+comment => foo@foo.com
+fingerprint => SHA256:PYC9kPVC6J873CSIbfp0LwYeczP/W4ffObNCuDJ1u5w
+old-style fingerprint => a0:c8:ad:6c:32:9a:32:fa:59:cc:a9:8c:0a:0d:6e:bd
+```
+
+More examples: converting between formats:
+
+```js
+/* Read in a PEM public key */
+var keyPem = fs.readFileSync('id_rsa.pem');
+var key = sshpk.parseKey(keyPem, 'pem');
+
+/* Convert to PEM PKCS#8 public key format */
+var pemBuf = key.toBuffer('pkcs8');
+
+/* Convert to SSH public key format (and return as a string) */
+var sshKey = key.toString('ssh');
+```
+
+Signing and verifying:
+
+```js
+/* Read in an OpenSSH/PEM *private* key */
+var keyPriv = fs.readFileSync('id_ecdsa');
+var key = sshpk.parsePrivateKey(keyPriv, 'pem');
+
+var data = 'some data';
+
+/* Sign some data with the key */
+var s = key.createSign('sha1');
+s.update(data);
+var signature = s.sign();
+
+/* Now load the public key (could also use just key.toPublic()) */
+var keyPub = fs.readFileSync('id_ecdsa.pub');
+key = sshpk.parseKey(keyPub, 'ssh');
+
+/* Make a crypto.Verifier with this key */
+var v = key.createVerify('sha1');
+v.update(data);
+var valid = v.verify(signature);
+/* => true! */
+```
+
+Matching fingerprints with keys:
+
+```js
+var fp = sshpk.parseFingerprint('SHA256:PYC9kPVC6J873CSIbfp0LwYeczP/W4ffObNCuDJ1u5w');
+
+var keys = [sshpk.parseKey(...), sshpk.parseKey(...), ...];
+
+keys.forEach(function (key) {
+	if (fp.matches(key))
+		console.log('found it!');
+});
+```
+
+Usage
+-----
+
+## Public keys
+
+### `parseKey(data[, format = 'auto'[, options]])`
+
+Parses a key from a given data format and returns a new `Key` object.
+
+Parameters
+
+- `data` -- Either a Buffer or String, containing the key
+- `format` -- String name of format to use, valid options are:
+  - `auto`: choose automatically from all below
+  - `pem`: supports both PKCS#1 and PKCS#8
+  - `ssh`: standard OpenSSH format,
+  - `pkcs1`, `pkcs8`: variants of `pem`
+  - `rfc4253`: raw OpenSSH wire format
+  - `openssh`: new post-OpenSSH 6.5 internal format, produced by 
+               `ssh-keygen -o`
+  - `dnssec`: `.key` file format output by `dnssec-keygen` etc
+  - `putty`: the PuTTY `.ppk` file format (supports truncated variant without
+             all the lines from `Private-Lines:` onwards)
+- `options` -- Optional Object, extra options, with keys:
+  - `filename` -- Optional String, name for the key being parsed 
+                  (eg. the filename that was opened). Used to generate
+                  Error messages
+  - `passphrase` -- Optional String, encryption passphrase used to decrypt an
+                    encrypted PEM file
+
+### `Key.isKey(obj)`
+
+Returns `true` if the given object is a valid `Key` object created by a version
+of `sshpk` compatible with this one.
+
+Parameters
+
+- `obj` -- Object to identify
+
+### `Key#type`
+
+String, the type of key. Valid options are `rsa`, `dsa`, `ecdsa`.
+
+### `Key#size`
+
+Integer, "size" of the key in bits. For RSA/DSA this is the size of the modulus;
+for ECDSA this is the bit size of the curve in use.
+
+### `Key#comment`
+
+Optional string, a key comment used by some formats (eg the `ssh` format).
+
+### `Key#curve`
+
+Only present if `this.type === 'ecdsa'`, string containing the name of the
+named curve used with this key. Possible values include `nistp256`, `nistp384`
+and `nistp521`.
+
+### `Key#toBuffer([format = 'ssh'])`
+
+Convert the key into a given data format and return the serialized key as
+a Buffer.
+
+Parameters
+
+- `format` -- String name of format to use, for valid options see `parseKey()`
+
+### `Key#toString([format = 'ssh])`
+
+Same as `this.toBuffer(format).toString()`.
+
+### `Key#fingerprint([algorithm = 'sha256'[, hashType = 'ssh']])`
+
+Creates a new `Fingerprint` object representing this Key's fingerprint.
+
+Parameters
+
+- `algorithm` -- String name of hash algorithm to use, valid options are `md5`,
+                 `sha1`, `sha256`, `sha384`, `sha512`
+- `hashType` -- String name of fingerprint hash type to use, valid options are
+                `ssh` (the type of fingerprint used by OpenSSH, e.g. in
+                `ssh-keygen`), `spki` (used by HPKP, some OpenSSL applications)
+
+### `Key#createVerify([hashAlgorithm])`
+
+Creates a `crypto.Verifier` specialized to use this Key (and the correct public
+key algorithm to match it). The returned Verifier has the same API as a regular
+one, except that the `verify()` function takes only the target signature as an
+argument.
+
+Parameters
+
+- `hashAlgorithm` -- optional String name of hash algorithm to use, any
+                     supported by OpenSSL are valid, usually including
+                     `sha1`, `sha256`.
+
+`v.verify(signature[, format])` Parameters
+
+- `signature` -- either a Signature object, or a Buffer or String
+- `format` -- optional String, name of format to interpret given String with.
+              Not valid if `signature` is a Signature or Buffer.
+
+### `Key#createDiffieHellman()`
+### `Key#createDH()`
+
+Creates a Diffie-Hellman key exchange object initialized with this key and all
+necessary parameters. This has the same API as a `crypto.DiffieHellman`
+instance, except that functions take `Key` and `PrivateKey` objects as
+arguments, and return them where indicated for.
+
+This is only valid for keys belonging to a cryptosystem that supports DHE
+or a close analogue (i.e. `dsa`, `ecdsa` and `curve25519` keys). An attempt
+to call this function on other keys will yield an `Error`.
+
+## Private keys
+
+### `parsePrivateKey(data[, format = 'auto'[, options]])`
+
+Parses a private key from a given data format and returns a new
+`PrivateKey` object.
+
+Parameters
+
+- `data` -- Either a Buffer or String, containing the key
+- `format` -- String name of format to use, valid options are:
+  - `auto`: choose automatically from all below
+  - `pem`: supports both PKCS#1 and PKCS#8
+  - `ssh`, `openssh`: new post-OpenSSH 6.5 internal format, produced by
+                      `ssh-keygen -o`
+  - `pkcs1`, `pkcs8`: variants of `pem`
+  - `rfc4253`: raw OpenSSH wire format
+  - `dnssec`: `.private` format output by `dnssec-keygen` etc.
+- `options` -- Optional Object, extra options, with keys:
+  - `filename` -- Optional String, name for the key being parsed
+                  (eg. the filename that was opened). Used to generate
+                  Error messages
+  - `passphrase` -- Optional String, encryption passphrase used to decrypt an
+                    encrypted PEM file
+
+### `generatePrivateKey(type[, options])`
+
+Generates a new private key of a certain key type, from random data.
+
+Parameters
+
+- `type` -- String, type of key to generate. Currently supported are `'ecdsa'`
+            and `'ed25519'`
+- `options` -- optional Object, with keys:
+  - `curve` -- optional String, for `'ecdsa'` keys, specifies the curve to use.
+               If ECDSA is specified and this option is not given, defaults to
+               using `'nistp256'`.
+
+### `PrivateKey.isPrivateKey(obj)`
+
+Returns `true` if the given object is a valid `PrivateKey` object created by a
+version of `sshpk` compatible with this one.
+
+Parameters
+
+- `obj` -- Object to identify
+
+### `PrivateKey#type`
+
+String, the type of key. Valid options are `rsa`, `dsa`, `ecdsa`.
+
+### `PrivateKey#size`
+
+Integer, "size" of the key in bits. For RSA/DSA this is the size of the modulus;
+for ECDSA this is the bit size of the curve in use.
+
+### `PrivateKey#curve`
+
+Only present if `this.type === 'ecdsa'`, string containing the name of the
+named curve used with this key. Possible values include `nistp256`, `nistp384`
+and `nistp521`.
+
+### `PrivateKey#toBuffer([format = 'pkcs1'])`
+
+Convert the key into a given data format and return the serialized key as
+a Buffer.
+
+Parameters
+
+- `format` -- String name of format to use, valid options are listed under 
+              `parsePrivateKey`. Note that ED25519 keys default to `openssh`
+              format instead (as they have no `pkcs1` representation).
+
+### `PrivateKey#toString([format = 'pkcs1'])`
+
+Same as `this.toBuffer(format).toString()`.
+
+### `PrivateKey#toPublic()`
+
+Extract just the public part of this private key, and return it as a `Key`
+object.
+
+### `PrivateKey#fingerprint([algorithm = 'sha256'])`
+
+Same as `this.toPublic().fingerprint()`.
+
+### `PrivateKey#createVerify([hashAlgorithm])`
+
+Same as `this.toPublic().createVerify()`.
+
+### `PrivateKey#createSign([hashAlgorithm])`
+
+Creates a `crypto.Sign` specialized to use this PrivateKey (and the correct
+key algorithm to match it). The returned Signer has the same API as a regular
+one, except that the `sign()` function takes no arguments, and returns a
+`Signature` object.
+
+Parameters
+
+- `hashAlgorithm` -- optional String name of hash algorithm to use, any
+                     supported by OpenSSL are valid, usually including
+                     `sha1`, `sha256`.
+
+`v.sign()` Parameters
+
+- none
+
+### `PrivateKey#derive(newType)`
+
+Derives a related key of type `newType` from this key. Currently this is
+only supported to change between `ed25519` and `curve25519` keys which are
+stored with the same private key (but usually distinct public keys in order
+to avoid degenerate keys that lead to a weak Diffie-Hellman exchange).
+
+Parameters
+
+- `newType` -- String, type of key to derive, either `ed25519` or `curve25519`
+
+## Fingerprints
+
+### `parseFingerprint(fingerprint[, options])`
+
+Pre-parses a fingerprint, creating a `Fingerprint` object that can be used to
+quickly locate a key by using the `Fingerprint#matches` function.
+
+Parameters
+
+- `fingerprint` -- String, the fingerprint value, in any supported format
+- `options` -- Optional Object, with properties:
+  - `algorithms` -- Array of strings, names of hash algorithms to limit
+                support to. If `fingerprint` uses a hash algorithm not on
+                this list, throws `InvalidAlgorithmError`.
+  - `hashType` -- String, the type of hash the fingerprint uses, either `ssh`
+                  or `spki` (normally auto-detected based on the format, but
+                  can be overridden)
+  - `type` -- String, the entity this fingerprint identifies, either `key` or
+              `certificate`
+
+### `Fingerprint.isFingerprint(obj)`
+
+Returns `true` if the given object is a valid `Fingerprint` object created by a
+version of `sshpk` compatible with this one.
+
+Parameters
+
+- `obj` -- Object to identify
+
+### `Fingerprint#toString([format])`
+
+Returns a fingerprint as a string, in the given format.
+
+Parameters
+
+- `format` -- Optional String, format to use, valid options are `hex` and
+              `base64`. If this `Fingerprint` uses the `md5` algorithm, the
+              default format is `hex`. Otherwise, the default is `base64`.
+
+### `Fingerprint#matches(keyOrCertificate)`
+
+Verifies whether or not this `Fingerprint` matches a given `Key` or
+`Certificate`. This function uses double-hashing to avoid leaking timing
+information. Returns a boolean.
+
+Note that a `Key`-type Fingerprint will always return `false` if asked to match
+a `Certificate` and vice versa.
+
+Parameters
+
+- `keyOrCertificate` -- a `Key` object or `Certificate` object, the entity to
+                        match this fingerprint against
+
+## Signatures
+
+### `parseSignature(signature, algorithm, format)`
+
+Parses a signature in a given format, creating a `Signature` object. Useful
+for converting between the SSH and ASN.1 (PKCS/OpenSSL) signature formats, and
+also returned as output from `PrivateKey#createSign().sign()`.
+
+A Signature object can also be passed to a verifier produced by
+`Key#createVerify()` and it will automatically be converted internally into the
+correct format for verification.
+
+Parameters
+
+- `signature` -- a Buffer (binary) or String (base64), data of the actual
+                 signature in the given format
+- `algorithm` -- a String, name of the algorithm to be used, possible values
+                 are `rsa`, `dsa`, `ecdsa`
+- `format` -- a String, either `asn1` or `ssh`
+
+### `Signature.isSignature(obj)`
+
+Returns `true` if the given object is a valid `Signature` object created by a
+version of `sshpk` compatible with this one.
+
+Parameters
+
+- `obj` -- Object to identify
+
+### `Signature#toBuffer([format = 'asn1'])`
+
+Converts a Signature to the given format and returns it as a Buffer.
+
+Parameters
+
+- `format` -- a String, either `asn1` or `ssh`
+
+### `Signature#toString([format = 'asn1'])`
+
+Same as `this.toBuffer(format).toString('base64')`.
+
+## Certificates
+
+`sshpk` includes basic support for parsing certificates in X.509 (PEM) format
+and the OpenSSH certificate format. This feature is intended to be used mainly
+to access basic metadata about certificates, extract public keys from them, and
+also to generate simple self-signed certificates from an existing key.
+
+Notably, there is no implementation of CA chain-of-trust verification, and only
+very minimal support for key usage restrictions. Please do the security world
+a favour, and DO NOT use this code for certificate verification in the
+traditional X.509 CA chain style.
+
+### `parseCertificate(data, format)`
+
+Parameters
+
+ - `data` -- a Buffer or String
+ - `format` -- a String, format to use, one of `'openssh'`, `'pem'` (X.509 in a
+               PEM wrapper), or `'x509'` (raw DER encoded)
+
+### `createSelfSignedCertificate(subject, privateKey[, options])`
+
+Parameters
+
+ - `subject` -- an Identity, the subject of the certificate
+ - `privateKey` -- a PrivateKey, the key of the subject: will be used both to be
+                   placed in the certificate and also to sign it (since this is
+                   a self-signed certificate)
+ - `options` -- optional Object, with keys:
+   - `lifetime` -- optional Number, lifetime of the certificate from now in
+                   seconds
+   - `validFrom`, `validUntil` -- optional Dates, beginning and end of
+                                  certificate validity period. If given
+                                  `lifetime` will be ignored
+   - `serial` -- optional Buffer, the serial number of the certificate
+   - `purposes` -- optional Array of String, X.509 key usage restrictions
+
+### `createCertificate(subject, key, issuer, issuerKey[, options])`
+
+Parameters
+
+ - `subject` -- an Identity, the subject of the certificate
+ - `key` -- a Key, the public key of the subject
+ - `issuer` -- an Identity, the issuer of the certificate who will sign it
+ - `issuerKey` -- a PrivateKey, the issuer's private key for signing
+ - `options` -- optional Object, with keys:
+   - `lifetime` -- optional Number, lifetime of the certificate from now in
+                   seconds
+   - `validFrom`, `validUntil` -- optional Dates, beginning and end of
+                                  certificate validity period. If given
+                                  `lifetime` will be ignored
+   - `serial` -- optional Buffer, the serial number of the certificate
+   - `purposes` -- optional Array of String, X.509 key usage restrictions
+
+### `Certificate#subjects`
+
+Array of `Identity` instances describing the subject of this certificate.
+
+### `Certificate#issuer`
+
+The `Identity` of the Certificate's issuer (signer).
+
+### `Certificate#subjectKey`
+
+The public key of the subject of the certificate, as a `Key` instance.
+
+### `Certificate#issuerKey`
+
+The public key of the signing issuer of this certificate, as a `Key` instance.
+May be `undefined` if the issuer's key is unknown (e.g. on an X509 certificate).
+
+### `Certificate#serial`
+
+The serial number of the certificate. As this is normally a 64-bit or wider
+integer, it is returned as a Buffer.
+
+### `Certificate#purposes`
+
+Array of Strings indicating the X.509 key usage purposes that this certificate
+is valid for. The possible strings at the moment are:
+
+ * `'signature'` -- key can be used for digital signatures
+ * `'identity'` -- key can be used to attest about the identity of the signer
+                   (X.509 calls this `nonRepudiation`)
+ * `'codeSigning'` -- key can be used to sign executable code
+ * `'keyEncryption'` -- key can be used to encrypt other keys
+ * `'encryption'` -- key can be used to encrypt data (only applies for RSA)
+ * `'keyAgreement'` -- key can be used for key exchange protocols such as
+                       Diffie-Hellman
+ * `'ca'` -- key can be used to sign other certificates (is a Certificate
+             Authority)
+ * `'crl'` -- key can be used to sign Certificate Revocation Lists (CRLs)
+
+### `Certificate#getExtension(nameOrOid)`
+
+Retrieves information about a certificate extension, if present, or returns
+`undefined` if not. The string argument `nameOrOid` should be either the OID
+(for X509 extensions) or the name (for OpenSSH extensions) of the extension
+to retrieve.
+
+The object returned will have the following properties:
+
+ * `format` -- String, set to either `'x509'` or `'openssh'`
+ * `name` or `oid` -- String, only one set based on value of `format`
+ * `data` -- Buffer, the raw data inside the extension
+
+### `Certificate#getExtensions()`
+
+Returns an Array of all present certificate extensions, in the same manner and
+format as `getExtension()`.
+
+### `Certificate#isExpired([when])`
+
+Tests whether the Certificate is currently expired (i.e. the `validFrom` and
+`validUntil` dates specify a range of time that does not include the current
+time).
+
+Parameters
+
+ - `when` -- optional Date, if specified, tests whether the Certificate was or
+             will be expired at the specified time instead of now
+
+Returns a Boolean.
+
+### `Certificate#isSignedByKey(key)`
+
+Tests whether the Certificate was validly signed by the given (public) Key.
+
+Parameters
+
+ - `key` -- a Key instance
+
+Returns a Boolean.
+
+### `Certificate#isSignedBy(certificate)`
+
+Tests whether this Certificate was validly signed by the subject of the given
+certificate. Also tests that the issuer Identity of this Certificate and the
+subject Identity of the other Certificate are equivalent.
+
+Parameters
+
+ - `certificate` -- another Certificate instance
+
+Returns a Boolean.
+
+### `Certificate#fingerprint([hashAlgo])`
+
+Returns the X509-style fingerprint of the entire certificate (as a Fingerprint
+instance). This matches what a web-browser or similar would display as the
+certificate fingerprint and should not be confused with the fingerprint of the
+subject's public key.
+
+Parameters
+
+ - `hashAlgo` -- an optional String, any hash function name
+
+### `Certificate#toBuffer([format])`
+
+Serializes the Certificate to a Buffer and returns it.
+
+Parameters
+
+ - `format` -- an optional String, output format, one of `'openssh'`, `'pem'` or
+               `'x509'`. Defaults to `'x509'`.
+
+Returns a Buffer.
+
+### `Certificate#toString([format])`
+
+ - `format` -- an optional String, output format, one of `'openssh'`, `'pem'` or
+               `'x509'`. Defaults to `'pem'`.
+
+Returns a String.
+
+## Certificate identities
+
+### `identityForHost(hostname)`
+
+Constructs a host-type Identity for a given hostname.
+
+Parameters
+
+ - `hostname` -- the fully qualified DNS name of the host
+
+Returns an Identity instance.
+
+### `identityForUser(uid)`
+
+Constructs a user-type Identity for a given UID.
+
+Parameters
+
+ - `uid` -- a String, user identifier (login name)
+
+Returns an Identity instance.
+
+### `identityForEmail(email)`
+
+Constructs an email-type Identity for a given email address.
+
+Parameters
+
+ - `email` -- a String, email address
+
+Returns an Identity instance.
+
+### `identityFromDN(dn)`
+
+Parses an LDAP-style DN string (e.g. `'CN=foo, C=US'`) and turns it into an
+Identity instance.
+
+Parameters
+
+ - `dn` -- a String
+
+Returns an Identity instance.
+
+### `identityFromArray(arr)`
+
+Constructs an Identity from an array of DN components (see `Identity#toArray()`
+for the format).
+
+Parameters
+
+ - `arr` -- an Array of Objects, DN components with `name` and `value`
+
+Returns an Identity instance.
+
+
+Supported attributes in DNs:
+
+| Attribute name | OID |
+| -------------- | --- |
+| `cn` | `2.5.4.3` |
+| `o` | `2.5.4.10` |
+| `ou` | `2.5.4.11` |
+| `l` | `2.5.4.7` |
+| `s` | `2.5.4.8` |
+| `c` | `2.5.4.6` |
+| `sn` | `2.5.4.4` |
+| `postalCode` | `2.5.4.17` |
+| `serialNumber` | `2.5.4.5` |
+| `street` | `2.5.4.9` |
+| `x500UniqueIdentifier` | `2.5.4.45` |
+| `role` | `2.5.4.72` |
+| `telephoneNumber` | `2.5.4.20` |
+| `description` | `2.5.4.13` |
+| `dc` | `0.9.2342.19200300.100.1.25` |
+| `uid` | `0.9.2342.19200300.100.1.1` |
+| `mail` | `0.9.2342.19200300.100.1.3` |
+| `title` | `2.5.4.12` |
+| `gn` | `2.5.4.42` |
+| `initials` | `2.5.4.43` |
+| `pseudonym` | `2.5.4.65` |
+
+### `Identity#toString()`
+
+Returns the identity as an LDAP-style DN string.
+e.g. `'CN=foo, O=bar corp, C=us'`
+
+### `Identity#type`
+
+The type of identity. One of `'host'`, `'user'`, `'email'` or `'unknown'`
+
+### `Identity#hostname`
+### `Identity#uid`
+### `Identity#email`
+
+Set when `type` is `'host'`, `'user'`, or `'email'`, respectively. Strings.
+
+### `Identity#cn`
+
+The value of the first `CN=` in the DN, if any. It's probably better to use
+the `#get()` method instead of this property.
+
+### `Identity#get(name[, asArray])`
+
+Returns the value of a named attribute in the Identity DN. If there is no
+attribute of the given name, returns `undefined`. If multiple components
+of the DN contain an attribute of this name, an exception is thrown unless
+the `asArray` argument is given as `true` -- then they will be returned as
+an Array in the same order they appear in the DN.
+
+Parameters
+
+ - `name` -- a String
+ - `asArray` -- an optional Boolean
+
+### `Identity#toArray()`
+
+Returns the Identity as an Array of DN component objects. This looks like:
+
+```js
+[ {
+  "name": "cn",
+  "value": "Joe Bloggs"
+},
+{
+  "name": "o",
+  "value": "Organisation Ltd"
+} ]
+```
+
+Each object has a `name` and a `value` property. The returned objects may be
+safely modified.
+
+Errors
+------
+
+### `InvalidAlgorithmError`
+
+The specified algorithm is not valid, either because it is not supported, or
+because it was not included on a list of allowed algorithms.
+
+Thrown by `Fingerprint.parse`, `Key#fingerprint`.
+
+Properties
+
+- `algorithm` -- the algorithm that could not be validated
+
+### `FingerprintFormatError`
+
+The fingerprint string given could not be parsed as a supported fingerprint
+format, or the specified fingerprint format is invalid.
+
+Thrown by `Fingerprint.parse`, `Fingerprint#toString`.
+
+Properties
+
+- `fingerprint` -- if caused by a fingerprint, the string value given
+- `format` -- if caused by an invalid format specification, the string value given
+
+### `KeyParseError`
+
+The key data given could not be parsed as a valid key.
+
+Properties
+
+- `keyName` -- `filename` that was given to `parseKey`
+- `format` -- the `format` that was trying to parse the key (see `parseKey`)
+- `innerErr` -- the inner Error thrown by the format parser
+
+### `KeyEncryptedError`
+
+The key is encrypted with a symmetric key (ie, it is password protected). The
+parsing operation would succeed if it was given the `passphrase` option.
+
+Properties
+
+- `keyName` -- `filename` that was given to `parseKey`
+- `format` -- the `format` that was trying to parse the key (currently can only
+              be `"pem"`)
+
+### `CertificateParseError`
+
+The certificate data given could not be parsed as a valid certificate.
+
+Properties
+
+- `certName` -- `filename` that was given to `parseCertificate`
+- `format` -- the `format` that was trying to parse the key
+              (see `parseCertificate`)
+- `innerErr` -- the inner Error thrown by the format parser
+
+Friends of sshpk
+----------------
+
+ * [`sshpk-agent`](https://github.com/arekinath/node-sshpk-agent) is a library
+   for speaking the `ssh-agent` protocol from node.js, which uses `sshpk`
diff --git a/node_modules/sshpk/bin/sshpk-conv b/node_modules/sshpk/bin/sshpk-conv
new file mode 100755
index 0000000..e839ede
--- /dev/null
+++ b/node_modules/sshpk/bin/sshpk-conv
@@ -0,0 +1,243 @@
+#!/usr/bin/env node
+// -*- mode: js -*-
+// vim: set filetype=javascript :
+// Copyright 2018 Joyent, Inc.	All rights reserved.
+
+var dashdash = require('dashdash');
+var sshpk = require('../lib/index');
+var fs = require('fs');
+var path = require('path');
+var tty = require('tty');
+var readline = require('readline');
+var getPassword = require('getpass').getPass;
+
+var options = [
+	{
+		names: ['outformat', 't'],
+		type: 'string',
+		help: 'Output format'
+	},
+	{
+		names: ['informat', 'T'],
+		type: 'string',
+		help: 'Input format'
+	},
+	{
+		names: ['file', 'f'],
+		type: 'string',
+		help: 'Input file name (default stdin)'
+	},
+	{
+		names: ['out', 'o'],
+		type: 'string',
+		help: 'Output file name (default stdout)'
+	},
+	{
+		names: ['private', 'p'],
+		type: 'bool',
+		help: 'Produce a private key as output'
+	},
+	{
+		names: ['derive', 'd'],
+		type: 'string',
+		help: 'Output a new key derived from this one, with given algo'
+	},
+	{
+		names: ['identify', 'i'],
+		type: 'bool',
+		help: 'Print key metadata instead of converting'
+	},
+	{
+		names: ['fingerprint', 'F'],
+		type: 'bool',
+		help: 'Output key fingerprint'
+	},
+	{
+		names: ['hash', 'H'],
+		type: 'string',
+		help: 'Hash function to use for key fingeprint with -F'
+	},
+	{
+		names: ['spki', 's'],
+		type: 'bool',
+		help: 'With -F, generates an SPKI fingerprint instead of SSH'
+	},
+	{
+		names: ['comment', 'c'],
+		type: 'string',
+		help: 'Set key comment, if output format supports'
+	},
+	{
+		names: ['help', 'h'],
+		type: 'bool',
+		help: 'Shows this help text'
+	}
+];
+
+if (require.main === module) {
+	var parser = dashdash.createParser({
+		options: options
+	});
+
+	try {
+		var opts = parser.parse(process.argv);
+	} catch (e) {
+		console.error('sshpk-conv: error: %s', e.message);
+		process.exit(1);
+	}
+
+	if (opts.help || opts._args.length > 1) {
+		var help = parser.help({}).trimRight();
+		console.error('sshpk-conv: converts between SSH key formats\n');
+		console.error(help);
+		console.error('\navailable key formats:');
+		console.error('	 - pem, pkcs1	  eg id_rsa');
+		console.error('	 - ssh		  eg id_rsa.pub');
+		console.error('	 - pkcs8	  format you want for openssl');
+		console.error('	 - openssh	  like output of ssh-keygen -o');
+		console.error('	 - rfc4253	  raw OpenSSH wire format');
+		console.error('	 - dnssec	  dnssec-keygen format');
+		console.error('  - putty          PuTTY ppk format');
+		console.error('\navailable fingerprint formats:');
+		console.error('  - hex            colon-separated hex for SSH');
+		console.error('                   straight hex for SPKI');
+		console.error('  - base64         SHA256:* format from OpenSSH');
+		process.exit(1);
+	}
+
+	/*
+	 * Key derivation can only be done on private keys, so use of the -d
+	 * option necessarily implies -p.
+	 */
+	if (opts.derive)
+		opts.private = true;
+
+	var inFile = process.stdin;
+	var inFileName = 'stdin';
+
+	var inFilePath;
+	if (opts.file) {
+		inFilePath = opts.file;
+	} else if (opts._args.length === 1) {
+		inFilePath = opts._args[0];
+	}
+
+	if (inFilePath)
+		inFileName = path.basename(inFilePath);
+
+	try {
+		if (inFilePath) {
+			fs.accessSync(inFilePath, fs.R_OK);
+			inFile = fs.createReadStream(inFilePath);
+		}
+	} catch (e) {
+		ifError(e, 'error opening input file');
+	}
+
+	var outFile = process.stdout;
+
+	try {
+		if (opts.out && !opts.identify) {
+			fs.accessSync(path.dirname(opts.out), fs.W_OK);
+			outFile = fs.createWriteStream(opts.out);
+		}
+	} catch (e) {
+		ifError(e, 'error opening output file');
+	}
+
+	var bufs = [];
+	inFile.on('readable', function () {
+		var data;
+		while ((data = inFile.read()))
+			bufs.push(data);
+	});
+	var parseOpts = {};
+	parseOpts.filename = inFileName;
+	inFile.on('end', function processKey() {
+		var buf = Buffer.concat(bufs);
+		var fmt = 'auto';
+		if (opts.informat)
+			fmt = opts.informat;
+		var f = sshpk.parseKey;
+		if (opts.private)
+			f = sshpk.parsePrivateKey;
+		try {
+			var key = f(buf, fmt, parseOpts);
+		} catch (e) {
+			if (e.name === 'KeyEncryptedError') {
+				getPassword(function (err, pw) {
+					if (err)
+						ifError(err);
+					parseOpts.passphrase = pw;
+					processKey();
+				});
+				return;
+			}
+			ifError(e);
+		}
+
+		if (opts.derive)
+			key = key.derive(opts.derive);
+
+		if (opts.comment)
+			key.comment = opts.comment;
+
+		if (opts.identify) {
+			var kind = 'public';
+			if (sshpk.PrivateKey.isPrivateKey(key))
+				kind = 'private';
+			console.log('%s: a %d bit %s %s key', inFileName,
+			    key.size, key.type.toUpperCase(), kind);
+			if (key.type === 'ecdsa')
+				console.log('ECDSA curve: %s', key.curve);
+			if (key.comment)
+				console.log('Comment: %s', key.comment);
+			console.log('SHA256 fingerprint: ' +
+			    key.fingerprint('sha256').toString());
+			console.log('MD5 fingerprint: ' +
+			    key.fingerprint('md5').toString());
+			console.log('SPKI-SHA256 fingerprint: ' +
+			    key.fingerprint('sha256', 'spki').toString());
+			process.exit(0);
+			return;
+		}
+
+		if (opts.fingerprint) {
+			var hash = opts.hash;
+			var type = opts.spki ? 'spki' : 'ssh';
+			var format = opts.outformat;
+			var fp = key.fingerprint(hash, type).toString(format);
+			outFile.write(fp);
+			outFile.write('\n');
+			outFile.once('drain', function () {
+				process.exit(0);
+			});
+			return;
+		}
+
+		fmt = undefined;
+		if (opts.outformat)
+			fmt = opts.outformat;
+		outFile.write(key.toBuffer(fmt));
+		if (fmt === 'ssh' ||
+		    (!opts.private && fmt === undefined))
+			outFile.write('\n');
+		outFile.once('drain', function () {
+			process.exit(0);
+		});
+	});
+}
+
+function ifError(e, txt) {
+	if (txt)
+		txt = txt + ': ';
+	else
+		txt = '';
+	console.error('sshpk-conv: ' + txt + e.name + ': ' + e.message);
+	if (process.env['DEBUG'] || process.env['V']) {
+		console.error(e.stack);
+		if (e.innerErr)
+			console.error(e.innerErr.stack);
+	}
+	process.exit(1);
+}
diff --git a/node_modules/sshpk/bin/sshpk-sign b/node_modules/sshpk/bin/sshpk-sign
new file mode 100755
index 0000000..673fc98
--- /dev/null
+++ b/node_modules/sshpk/bin/sshpk-sign
@@ -0,0 +1,191 @@
+#!/usr/bin/env node
+// -*- mode: js -*-
+// vim: set filetype=javascript :
+// Copyright 2015 Joyent, Inc.  All rights reserved.
+
+var dashdash = require('dashdash');
+var sshpk = require('../lib/index');
+var fs = require('fs');
+var path = require('path');
+var getPassword = require('getpass').getPass;
+
+var options = [
+	{
+		names: ['hash', 'H'],
+		type: 'string',
+		help: 'Hash algorithm (sha1, sha256, sha384, sha512)'
+	},
+	{
+		names: ['verbose', 'v'],
+		type: 'bool',
+		help: 'Display verbose info about key and hash used'
+	},
+	{
+		names: ['identity', 'i'],
+		type: 'string',
+		help: 'Path to key to use'
+	},
+	{
+		names: ['file', 'f'],
+		type: 'string',
+		help: 'Input filename'
+	},
+	{
+		names: ['out', 'o'],
+		type: 'string',
+		help: 'Output filename'
+	},
+	{
+		names: ['format', 't'],
+		type: 'string',
+		help: 'Signature format (asn1, ssh, raw)'
+	},
+	{
+		names: ['binary', 'b'],
+		type: 'bool',
+		help: 'Output raw binary instead of base64'
+	},
+	{
+		names: ['help', 'h'],
+		type: 'bool',
+		help: 'Shows this help text'
+	}
+];
+
+var parseOpts = {};
+
+if (require.main === module) {
+	var parser = dashdash.createParser({
+		options: options
+	});
+
+	try {
+		var opts = parser.parse(process.argv);
+	} catch (e) {
+		console.error('sshpk-sign: error: %s', e.message);
+		process.exit(1);
+	}
+
+	if (opts.help || opts._args.length > 1) {
+		var help = parser.help({}).trimRight();
+		console.error('sshpk-sign: sign data using an SSH key\n');
+		console.error(help);
+		process.exit(1);
+	}
+
+	if (!opts.identity) {
+		var help = parser.help({}).trimRight();
+		console.error('sshpk-sign: the -i or --identity option ' +
+		    'is required\n');
+		console.error(help);
+		process.exit(1);
+	}
+
+	var keyData = fs.readFileSync(opts.identity);
+	parseOpts.filename = opts.identity;
+
+	run();
+}
+
+function run() {
+	var key;
+	try {
+		key = sshpk.parsePrivateKey(keyData, 'auto', parseOpts);
+	} catch (e) {
+		if (e.name === 'KeyEncryptedError') {
+			getPassword(function (err, pw) {
+				parseOpts.passphrase = pw;
+				run();
+			});
+			return;
+		}
+		console.error('sshpk-sign: error loading private key "' +
+		    opts.identity + '": ' + e.name + ': ' + e.message);
+		process.exit(1);
+	}
+
+	var hash = opts.hash || key.defaultHashAlgorithm();
+
+	var signer;
+	try {
+		signer = key.createSign(hash);
+	} catch (e) {
+		console.error('sshpk-sign: error creating signer: ' +
+		    e.name + ': ' + e.message);
+		process.exit(1);
+	}
+
+	if (opts.verbose) {
+		console.error('sshpk-sign: using %s-%s with a %d bit key',
+		    key.type, hash, key.size);
+	}
+
+	var inFile = process.stdin;
+	var inFileName = 'stdin';
+
+	var inFilePath;
+	if (opts.file) {
+		inFilePath = opts.file;
+	} else if (opts._args.length === 1) {
+		inFilePath = opts._args[0];
+	}
+
+	if (inFilePath)
+		inFileName = path.basename(inFilePath);
+
+	try {
+		if (inFilePath) {
+			fs.accessSync(inFilePath, fs.R_OK);
+			inFile = fs.createReadStream(inFilePath);
+		}
+	} catch (e) {
+		console.error('sshpk-sign: error opening input file' +
+		     ': ' + e.name + ': ' + e.message);
+		process.exit(1);
+	}
+
+	var outFile = process.stdout;
+
+	try {
+		if (opts.out && !opts.identify) {
+			fs.accessSync(path.dirname(opts.out), fs.W_OK);
+			outFile = fs.createWriteStream(opts.out);
+		}
+	} catch (e) {
+		console.error('sshpk-sign: error opening output file' +
+		    ': ' + e.name + ': ' + e.message);
+		process.exit(1);
+	}
+
+	inFile.pipe(signer);
+	inFile.on('end', function () {
+		var sig;
+		try {
+			sig = signer.sign();
+		} catch (e) {
+			console.error('sshpk-sign: error signing data: ' +
+			    e.name + ': ' + e.message);
+			process.exit(1);
+		}
+
+		var fmt = opts.format || 'asn1';
+		var output;
+		try {
+			output = sig.toBuffer(fmt);
+			if (!opts.binary)
+				output = output.toString('base64');
+		} catch (e) {
+			console.error('sshpk-sign: error converting signature' +
+			    ' to ' + fmt + ' format: ' + e.name + ': ' +
+			    e.message);
+			process.exit(1);
+		}
+
+		outFile.write(output);
+		if (!opts.binary)
+			outFile.write('\n');
+		outFile.once('drain', function () {
+			process.exit(0);
+		});
+	});
+}
diff --git a/node_modules/sshpk/bin/sshpk-verify b/node_modules/sshpk/bin/sshpk-verify
new file mode 100755
index 0000000..fc71a82
--- /dev/null
+++ b/node_modules/sshpk/bin/sshpk-verify
@@ -0,0 +1,167 @@
+#!/usr/bin/env node
+// -*- mode: js -*-
+// vim: set filetype=javascript :
+// Copyright 2015 Joyent, Inc.  All rights reserved.
+
+var dashdash = require('dashdash');
+var sshpk = require('../lib/index');
+var fs = require('fs');
+var path = require('path');
+var Buffer = require('safer-buffer').Buffer;
+
+var options = [
+	{
+		names: ['hash', 'H'],
+		type: 'string',
+		help: 'Hash algorithm (sha1, sha256, sha384, sha512)'
+	},
+	{
+		names: ['verbose', 'v'],
+		type: 'bool',
+		help: 'Display verbose info about key and hash used'
+	},
+	{
+		names: ['identity', 'i'],
+		type: 'string',
+		help: 'Path to (public) key to use'
+	},
+	{
+		names: ['file', 'f'],
+		type: 'string',
+		help: 'Input filename'
+	},
+	{
+		names: ['format', 't'],
+		type: 'string',
+		help: 'Signature format (asn1, ssh, raw)'
+	},
+	{
+		names: ['signature', 's'],
+		type: 'string',
+		help: 'base64-encoded signature data'
+	},
+	{
+		names: ['help', 'h'],
+		type: 'bool',
+		help: 'Shows this help text'
+	}
+];
+
+if (require.main === module) {
+	var parser = dashdash.createParser({
+		options: options
+	});
+
+	try {
+		var opts = parser.parse(process.argv);
+	} catch (e) {
+		console.error('sshpk-verify: error: %s', e.message);
+		process.exit(3);
+	}
+
+	if (opts.help || opts._args.length > 1) {
+		var help = parser.help({}).trimRight();
+		console.error('sshpk-verify: sign data using an SSH key\n');
+		console.error(help);
+		process.exit(3);
+	}
+
+	if (!opts.identity) {
+		var help = parser.help({}).trimRight();
+		console.error('sshpk-verify: the -i or --identity option ' +
+		    'is required\n');
+		console.error(help);
+		process.exit(3);
+	}
+
+	if (!opts.signature) {
+		var help = parser.help({}).trimRight();
+		console.error('sshpk-verify: the -s or --signature option ' +
+		    'is required\n');
+		console.error(help);
+		process.exit(3);
+	}
+
+	var keyData = fs.readFileSync(opts.identity);
+
+	var key;
+	try {
+		key = sshpk.parseKey(keyData);
+	} catch (e) {
+		console.error('sshpk-verify: error loading key "' +
+		    opts.identity + '": ' + e.name + ': ' + e.message);
+		process.exit(2);
+	}
+
+	var fmt = opts.format || 'asn1';
+	var sigData = Buffer.from(opts.signature, 'base64');
+
+	var sig;
+	try {
+		sig = sshpk.parseSignature(sigData, key.type, fmt);
+	} catch (e) {
+		console.error('sshpk-verify: error parsing signature: ' +
+		    e.name + ': ' + e.message);
+		process.exit(2);
+	}
+
+	var hash = opts.hash || key.defaultHashAlgorithm();
+
+	var verifier;
+	try {
+		verifier = key.createVerify(hash);
+	} catch (e) {
+		console.error('sshpk-verify: error creating verifier: ' +
+		    e.name + ': ' + e.message);
+		process.exit(2);
+	}
+
+	if (opts.verbose) {
+		console.error('sshpk-verify: using %s-%s with a %d bit key',
+		    key.type, hash, key.size);
+	}
+
+	var inFile = process.stdin;
+	var inFileName = 'stdin';
+
+	var inFilePath;
+	if (opts.file) {
+		inFilePath = opts.file;
+	} else if (opts._args.length === 1) {
+		inFilePath = opts._args[0];
+	}
+
+	if (inFilePath)
+		inFileName = path.basename(inFilePath);
+
+	try {
+		if (inFilePath) {
+			fs.accessSync(inFilePath, fs.R_OK);
+			inFile = fs.createReadStream(inFilePath);
+		}
+	} catch (e) {
+		console.error('sshpk-verify: error opening input file' +
+		     ': ' + e.name + ': ' + e.message);
+		process.exit(2);
+	}
+
+	inFile.pipe(verifier);
+	inFile.on('end', function () {
+		var ret;
+		try {
+			ret = verifier.verify(sig);
+		} catch (e) {
+			console.error('sshpk-verify: error verifying data: ' +
+			    e.name + ': ' + e.message);
+			process.exit(1);
+		}
+
+		if (ret) {
+			console.error('OK');
+			process.exit(0);
+		}
+
+		console.error('NOT OK');
+		process.exit(1);
+	});
+}
diff --git a/node_modules/sshpk/lib/algs.js b/node_modules/sshpk/lib/algs.js
new file mode 100644
index 0000000..3b01e7d
--- /dev/null
+++ b/node_modules/sshpk/lib/algs.js
@@ -0,0 +1,168 @@
+// Copyright 2015 Joyent, Inc.
+
+var Buffer = require('safer-buffer').Buffer;
+
+var algInfo = {
+	'dsa': {
+		parts: ['p', 'q', 'g', 'y'],
+		sizePart: 'p'
+	},
+	'rsa': {
+		parts: ['e', 'n'],
+		sizePart: 'n'
+	},
+	'ecdsa': {
+		parts: ['curve', 'Q'],
+		sizePart: 'Q'
+	},
+	'ed25519': {
+		parts: ['A'],
+		sizePart: 'A'
+	}
+};
+algInfo['curve25519'] = algInfo['ed25519'];
+
+var algPrivInfo = {
+	'dsa': {
+		parts: ['p', 'q', 'g', 'y', 'x']
+	},
+	'rsa': {
+		parts: ['n', 'e', 'd', 'iqmp', 'p', 'q']
+	},
+	'ecdsa': {
+		parts: ['curve', 'Q', 'd']
+	},
+	'ed25519': {
+		parts: ['A', 'k']
+	}
+};
+algPrivInfo['curve25519'] = algPrivInfo['ed25519'];
+
+var hashAlgs = {
+	'md5': true,
+	'sha1': true,
+	'sha256': true,
+	'sha384': true,
+	'sha512': true
+};
+
+/*
+ * Taken from
+ * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf
+ */
+var curves = {
+	'nistp256': {
+		size: 256,
+		pkcs8oid: '1.2.840.10045.3.1.7',
+		p: Buffer.from(('00' +
+		    'ffffffff 00000001 00000000 00000000' +
+		    '00000000 ffffffff ffffffff ffffffff').
+		    replace(/ /g, ''), 'hex'),
+		a: Buffer.from(('00' +
+		    'FFFFFFFF 00000001 00000000 00000000' +
+		    '00000000 FFFFFFFF FFFFFFFF FFFFFFFC').
+		    replace(/ /g, ''), 'hex'),
+		b: Buffer.from((
+		    '5ac635d8 aa3a93e7 b3ebbd55 769886bc' +
+		    '651d06b0 cc53b0f6 3bce3c3e 27d2604b').
+		    replace(/ /g, ''), 'hex'),
+		s: Buffer.from(('00' +
+		    'c49d3608 86e70493 6a6678e1 139d26b7' +
+		    '819f7e90').
+		    replace(/ /g, ''), 'hex'),
+		n: Buffer.from(('00' +
+		    'ffffffff 00000000 ffffffff ffffffff' +
+		    'bce6faad a7179e84 f3b9cac2 fc632551').
+		    replace(/ /g, ''), 'hex'),
+		G: Buffer.from(('04' +
+		    '6b17d1f2 e12c4247 f8bce6e5 63a440f2' +
+		    '77037d81 2deb33a0 f4a13945 d898c296' +
+		    '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' +
+		    '2bce3357 6b315ece cbb64068 37bf51f5').
+		    replace(/ /g, ''), 'hex')
+	},
+	'nistp384': {
+		size: 384,
+		pkcs8oid: '1.3.132.0.34',
+		p: Buffer.from(('00' +
+		    'ffffffff ffffffff ffffffff ffffffff' +
+		    'ffffffff ffffffff ffffffff fffffffe' +
+		    'ffffffff 00000000 00000000 ffffffff').
+		    replace(/ /g, ''), 'hex'),
+		a: Buffer.from(('00' +
+		    'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
+		    'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' +
+		    'FFFFFFFF 00000000 00000000 FFFFFFFC').
+		    replace(/ /g, ''), 'hex'),
+		b: Buffer.from((
+		    'b3312fa7 e23ee7e4 988e056b e3f82d19' +
+		    '181d9c6e fe814112 0314088f 5013875a' +
+		    'c656398d 8a2ed19d 2a85c8ed d3ec2aef').
+		    replace(/ /g, ''), 'hex'),
+		s: Buffer.from(('00' +
+		    'a335926a a319a27a 1d00896a 6773a482' +
+		    '7acdac73').
+		    replace(/ /g, ''), 'hex'),
+		n: Buffer.from(('00' +
+		    'ffffffff ffffffff ffffffff ffffffff' +
+		    'ffffffff ffffffff c7634d81 f4372ddf' +
+		    '581a0db2 48b0a77a ecec196a ccc52973').
+		    replace(/ /g, ''), 'hex'),
+		G: Buffer.from(('04' +
+		    'aa87ca22 be8b0537 8eb1c71e f320ad74' +
+		    '6e1d3b62 8ba79b98 59f741e0 82542a38' +
+		    '5502f25d bf55296c 3a545e38 72760ab7' +
+		    '3617de4a 96262c6f 5d9e98bf 9292dc29' +
+		    'f8f41dbd 289a147c e9da3113 b5f0b8c0' +
+		    '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f').
+		    replace(/ /g, ''), 'hex')
+	},
+	'nistp521': {
+		size: 521,
+		pkcs8oid: '1.3.132.0.35',
+		p: Buffer.from((
+		    '01ffffff ffffffff ffffffff ffffffff' +
+		    'ffffffff ffffffff ffffffff ffffffff' +
+		    'ffffffff ffffffff ffffffff ffffffff' +
+		    'ffffffff ffffffff ffffffff ffffffff' +
+		    'ffff').replace(/ /g, ''), 'hex'),
+		a: Buffer.from(('01FF' +
+		    'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
+		    'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
+		    'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' +
+		    'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC').
+		    replace(/ /g, ''), 'hex'),
+		b: Buffer.from(('51' +
+		    '953eb961 8e1c9a1f 929a21a0 b68540ee' +
+		    'a2da725b 99b315f3 b8b48991 8ef109e1' +
+		    '56193951 ec7e937b 1652c0bd 3bb1bf07' +
+		    '3573df88 3d2c34f1 ef451fd4 6b503f00').
+		    replace(/ /g, ''), 'hex'),
+		s: Buffer.from(('00' +
+		    'd09e8800 291cb853 96cc6717 393284aa' +
+		    'a0da64ba').replace(/ /g, ''), 'hex'),
+		n: Buffer.from(('01ff' +
+		    'ffffffff ffffffff ffffffff ffffffff' +
+		    'ffffffff ffffffff ffffffff fffffffa' +
+		    '51868783 bf2f966b 7fcc0148 f709a5d0' +
+		    '3bb5c9b8 899c47ae bb6fb71e 91386409').
+		    replace(/ /g, ''), 'hex'),
+		G: Buffer.from(('04' +
+		    '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' +
+		         '9c648139 053fb521 f828af60 6b4d3dba' +
+		         'a14b5e77 efe75928 fe1dc127 a2ffa8de' +
+		         '3348b3c1 856a429b f97e7e31 c2e5bd66' +
+		    '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' +
+		         '98f54449 579b4468 17afbd17 273e662c' +
+		         '97ee7299 5ef42640 c550b901 3fad0761' +
+		         '353c7086 a272c240 88be9476 9fd16650').
+		    replace(/ /g, ''), 'hex')
+	}
+};
+
+module.exports = {
+	info: algInfo,
+	privInfo: algPrivInfo,
+	hashAlgs: hashAlgs,
+	curves: curves
+};
diff --git a/node_modules/sshpk/lib/certificate.js b/node_modules/sshpk/lib/certificate.js
new file mode 100644
index 0000000..6932357
--- /dev/null
+++ b/node_modules/sshpk/lib/certificate.js
@@ -0,0 +1,410 @@
+// Copyright 2016 Joyent, Inc.
+
+module.exports = Certificate;
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('./algs');
+var crypto = require('crypto');
+var Fingerprint = require('./fingerprint');
+var Signature = require('./signature');
+var errs = require('./errors');
+var util = require('util');
+var utils = require('./utils');
+var Key = require('./key');
+var PrivateKey = require('./private-key');
+var Identity = require('./identity');
+
+var formats = {};
+formats['openssh'] = require('./formats/openssh-cert');
+formats['x509'] = require('./formats/x509');
+formats['pem'] = require('./formats/x509-pem');
+
+var CertificateParseError = errs.CertificateParseError;
+var InvalidAlgorithmError = errs.InvalidAlgorithmError;
+
+function Certificate(opts) {
+	assert.object(opts, 'options');
+	assert.arrayOfObject(opts.subjects, 'options.subjects');
+	utils.assertCompatible(opts.subjects[0], Identity, [1, 0],
+	    'options.subjects');
+	utils.assertCompatible(opts.subjectKey, Key, [1, 0],
+	    'options.subjectKey');
+	utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer');
+	if (opts.issuerKey !== undefined) {
+		utils.assertCompatible(opts.issuerKey, Key, [1, 0],
+		    'options.issuerKey');
+	}
+	assert.object(opts.signatures, 'options.signatures');
+	assert.buffer(opts.serial, 'options.serial');
+	assert.date(opts.validFrom, 'options.validFrom');
+	assert.date(opts.validUntil, 'optons.validUntil');
+
+	assert.optionalArrayOfString(opts.purposes, 'options.purposes');
+
+	this._hashCache = {};
+
+	this.subjects = opts.subjects;
+	this.issuer = opts.issuer;
+	this.subjectKey = opts.subjectKey;
+	this.issuerKey = opts.issuerKey;
+	this.signatures = opts.signatures;
+	this.serial = opts.serial;
+	this.validFrom = opts.validFrom;
+	this.validUntil = opts.validUntil;
+	this.purposes = opts.purposes;
+}
+
+Certificate.formats = formats;
+
+Certificate.prototype.toBuffer = function (format, options) {
+	if (format === undefined)
+		format = 'x509';
+	assert.string(format, 'format');
+	assert.object(formats[format], 'formats[format]');
+	assert.optionalObject(options, 'options');
+
+	return (formats[format].write(this, options));
+};
+
+Certificate.prototype.toString = function (format, options) {
+	if (format === undefined)
+		format = 'pem';
+	return (this.toBuffer(format, options).toString());
+};
+
+Certificate.prototype.fingerprint = function (algo) {
+	if (algo === undefined)
+		algo = 'sha256';
+	assert.string(algo, 'algorithm');
+	var opts = {
+		type: 'certificate',
+		hash: this.hash(algo),
+		algorithm: algo
+	};
+	return (new Fingerprint(opts));
+};
+
+Certificate.prototype.hash = function (algo) {
+	assert.string(algo, 'algorithm');
+	algo = algo.toLowerCase();
+	if (algs.hashAlgs[algo] === undefined)
+		throw (new InvalidAlgorithmError(algo));
+
+	if (this._hashCache[algo])
+		return (this._hashCache[algo]);
+
+	var hash = crypto.createHash(algo).
+	    update(this.toBuffer('x509')).digest();
+	this._hashCache[algo] = hash;
+	return (hash);
+};
+
+Certificate.prototype.isExpired = function (when) {
+	if (when === undefined)
+		when = new Date();
+	return (!((when.getTime() >= this.validFrom.getTime()) &&
+		(when.getTime() < this.validUntil.getTime())));
+};
+
+Certificate.prototype.isSignedBy = function (issuerCert) {
+	utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer');
+
+	if (!this.issuer.equals(issuerCert.subjects[0]))
+		return (false);
+	if (this.issuer.purposes && this.issuer.purposes.length > 0 &&
+	    this.issuer.purposes.indexOf('ca') === -1) {
+		return (false);
+	}
+
+	return (this.isSignedByKey(issuerCert.subjectKey));
+};
+
+Certificate.prototype.getExtension = function (keyOrOid) {
+	assert.string(keyOrOid, 'keyOrOid');
+	var ext = this.getExtensions().filter(function (maybeExt) {
+		if (maybeExt.format === 'x509')
+			return (maybeExt.oid === keyOrOid);
+		if (maybeExt.format === 'openssh')
+			return (maybeExt.name === keyOrOid);
+		return (false);
+	})[0];
+	return (ext);
+};
+
+Certificate.prototype.getExtensions = function () {
+	var exts = [];
+	var x509 = this.signatures.x509;
+	if (x509 && x509.extras && x509.extras.exts) {
+		x509.extras.exts.forEach(function (ext) {
+			ext.format = 'x509';
+			exts.push(ext);
+		});
+	}
+	var openssh = this.signatures.openssh;
+	if (openssh && openssh.exts) {
+		openssh.exts.forEach(function (ext) {
+			ext.format = 'openssh';
+			exts.push(ext);
+		});
+	}
+	return (exts);
+};
+
+Certificate.prototype.isSignedByKey = function (issuerKey) {
+	utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey');
+
+	if (this.issuerKey !== undefined) {
+		return (this.issuerKey.
+		    fingerprint('sha512').matches(issuerKey));
+	}
+
+	var fmt = Object.keys(this.signatures)[0];
+	var valid = formats[fmt].verify(this, issuerKey);
+	if (valid)
+		this.issuerKey = issuerKey;
+	return (valid);
+};
+
+Certificate.prototype.signWith = function (key) {
+	utils.assertCompatible(key, PrivateKey, [1, 2], 'key');
+	var fmts = Object.keys(formats);
+	var didOne = false;
+	for (var i = 0; i < fmts.length; ++i) {
+		if (fmts[i] !== 'pem') {
+			var ret = formats[fmts[i]].sign(this, key);
+			if (ret === true)
+				didOne = true;
+		}
+	}
+	if (!didOne) {
+		throw (new Error('Failed to sign the certificate for any ' +
+		    'available certificate formats'));
+	}
+};
+
+Certificate.createSelfSigned = function (subjectOrSubjects, key, options) {
+	var subjects;
+	if (Array.isArray(subjectOrSubjects))
+		subjects = subjectOrSubjects;
+	else
+		subjects = [subjectOrSubjects];
+
+	assert.arrayOfObject(subjects);
+	subjects.forEach(function (subject) {
+		utils.assertCompatible(subject, Identity, [1, 0], 'subject');
+	});
+
+	utils.assertCompatible(key, PrivateKey, [1, 2], 'private key');
+
+	assert.optionalObject(options, 'options');
+	if (options === undefined)
+		options = {};
+	assert.optionalObject(options.validFrom, 'options.validFrom');
+	assert.optionalObject(options.validUntil, 'options.validUntil');
+	var validFrom = options.validFrom;
+	var validUntil = options.validUntil;
+	if (validFrom === undefined)
+		validFrom = new Date();
+	if (validUntil === undefined) {
+		assert.optionalNumber(options.lifetime, 'options.lifetime');
+		var lifetime = options.lifetime;
+		if (lifetime === undefined)
+			lifetime = 10*365*24*3600;
+		validUntil = new Date();
+		validUntil.setTime(validUntil.getTime() + lifetime*1000);
+	}
+	assert.optionalBuffer(options.serial, 'options.serial');
+	var serial = options.serial;
+	if (serial === undefined)
+		serial = Buffer.from('0000000000000001', 'hex');
+
+	var purposes = options.purposes;
+	if (purposes === undefined)
+		purposes = [];
+
+	if (purposes.indexOf('signature') === -1)
+		purposes.push('signature');
+
+	/* Self-signed certs are always CAs. */
+	if (purposes.indexOf('ca') === -1)
+		purposes.push('ca');
+	if (purposes.indexOf('crl') === -1)
+		purposes.push('crl');
+
+	/*
+	 * If we weren't explicitly given any other purposes, do the sensible
+	 * thing and add some basic ones depending on the subject type.
+	 */
+	if (purposes.length <= 3) {
+		var hostSubjects = subjects.filter(function (subject) {
+			return (subject.type === 'host');
+		});
+		var userSubjects = subjects.filter(function (subject) {
+			return (subject.type === 'user');
+		});
+		if (hostSubjects.length > 0) {
+			if (purposes.indexOf('serverAuth') === -1)
+				purposes.push('serverAuth');
+		}
+		if (userSubjects.length > 0) {
+			if (purposes.indexOf('clientAuth') === -1)
+				purposes.push('clientAuth');
+		}
+		if (userSubjects.length > 0 || hostSubjects.length > 0) {
+			if (purposes.indexOf('keyAgreement') === -1)
+				purposes.push('keyAgreement');
+			if (key.type === 'rsa' &&
+			    purposes.indexOf('encryption') === -1)
+				purposes.push('encryption');
+		}
+	}
+
+	var cert = new Certificate({
+		subjects: subjects,
+		issuer: subjects[0],
+		subjectKey: key.toPublic(),
+		issuerKey: key.toPublic(),
+		signatures: {},
+		serial: serial,
+		validFrom: validFrom,
+		validUntil: validUntil,
+		purposes: purposes
+	});
+	cert.signWith(key);
+
+	return (cert);
+};
+
+Certificate.create =
+    function (subjectOrSubjects, key, issuer, issuerKey, options) {
+	var subjects;
+	if (Array.isArray(subjectOrSubjects))
+		subjects = subjectOrSubjects;
+	else
+		subjects = [subjectOrSubjects];
+
+	assert.arrayOfObject(subjects);
+	subjects.forEach(function (subject) {
+		utils.assertCompatible(subject, Identity, [1, 0], 'subject');
+	});
+
+	utils.assertCompatible(key, Key, [1, 0], 'key');
+	if (PrivateKey.isPrivateKey(key))
+		key = key.toPublic();
+	utils.assertCompatible(issuer, Identity, [1, 0], 'issuer');
+	utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key');
+
+	assert.optionalObject(options, 'options');
+	if (options === undefined)
+		options = {};
+	assert.optionalObject(options.validFrom, 'options.validFrom');
+	assert.optionalObject(options.validUntil, 'options.validUntil');
+	var validFrom = options.validFrom;
+	var validUntil = options.validUntil;
+	if (validFrom === undefined)
+		validFrom = new Date();
+	if (validUntil === undefined) {
+		assert.optionalNumber(options.lifetime, 'options.lifetime');
+		var lifetime = options.lifetime;
+		if (lifetime === undefined)
+			lifetime = 10*365*24*3600;
+		validUntil = new Date();
+		validUntil.setTime(validUntil.getTime() + lifetime*1000);
+	}
+	assert.optionalBuffer(options.serial, 'options.serial');
+	var serial = options.serial;
+	if (serial === undefined)
+		serial = Buffer.from('0000000000000001', 'hex');
+
+	var purposes = options.purposes;
+	if (purposes === undefined)
+		purposes = [];
+
+	if (purposes.indexOf('signature') === -1)
+		purposes.push('signature');
+
+	if (options.ca === true) {
+		if (purposes.indexOf('ca') === -1)
+			purposes.push('ca');
+		if (purposes.indexOf('crl') === -1)
+			purposes.push('crl');
+	}
+
+	var hostSubjects = subjects.filter(function (subject) {
+		return (subject.type === 'host');
+	});
+	var userSubjects = subjects.filter(function (subject) {
+		return (subject.type === 'user');
+	});
+	if (hostSubjects.length > 0) {
+		if (purposes.indexOf('serverAuth') === -1)
+			purposes.push('serverAuth');
+	}
+	if (userSubjects.length > 0) {
+		if (purposes.indexOf('clientAuth') === -1)
+			purposes.push('clientAuth');
+	}
+	if (userSubjects.length > 0 || hostSubjects.length > 0) {
+		if (purposes.indexOf('keyAgreement') === -1)
+			purposes.push('keyAgreement');
+		if (key.type === 'rsa' &&
+		    purposes.indexOf('encryption') === -1)
+			purposes.push('encryption');
+	}
+
+	var cert = new Certificate({
+		subjects: subjects,
+		issuer: issuer,
+		subjectKey: key,
+		issuerKey: issuerKey.toPublic(),
+		signatures: {},
+		serial: serial,
+		validFrom: validFrom,
+		validUntil: validUntil,
+		purposes: purposes
+	});
+	cert.signWith(issuerKey);
+
+	return (cert);
+};
+
+Certificate.parse = function (data, format, options) {
+	if (typeof (data) !== 'string')
+		assert.buffer(data, 'data');
+	if (format === undefined)
+		format = 'auto';
+	assert.string(format, 'format');
+	if (typeof (options) === 'string')
+		options = { filename: options };
+	assert.optionalObject(options, 'options');
+	if (options === undefined)
+		options = {};
+	assert.optionalString(options.filename, 'options.filename');
+	if (options.filename === undefined)
+		options.filename = '(unnamed)';
+
+	assert.object(formats[format], 'formats[format]');
+
+	try {
+		var k = formats[format].read(data, options);
+		return (k);
+	} catch (e) {
+		throw (new CertificateParseError(options.filename, format, e));
+	}
+};
+
+Certificate.isCertificate = function (obj, ver) {
+	return (utils.isCompatible(obj, Certificate, ver));
+};
+
+/*
+ * API versions for Certificate:
+ * [1,0] -- initial ver
+ * [1,1] -- openssh format now unpacks extensions
+ */
+Certificate.prototype._sshpkApiVersion = [1, 1];
+
+Certificate._oldVersionDetect = function (obj) {
+	return ([1, 0]);
+};
diff --git a/node_modules/sshpk/lib/dhe.js b/node_modules/sshpk/lib/dhe.js
new file mode 100644
index 0000000..a3c8032
--- /dev/null
+++ b/node_modules/sshpk/lib/dhe.js
@@ -0,0 +1,397 @@
+// Copyright 2017 Joyent, Inc.
+
+module.exports = {
+	DiffieHellman: DiffieHellman,
+	generateECDSA: generateECDSA,
+	generateED25519: generateED25519
+};
+
+var assert = require('assert-plus');
+var crypto = require('crypto');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('./algs');
+var utils = require('./utils');
+var nacl = require('tweetnacl');
+
+var Key = require('./key');
+var PrivateKey = require('./private-key');
+
+var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined);
+
+var ecdh = require('ecc-jsbn');
+var ec = require('ecc-jsbn/lib/ec');
+var jsbn = require('jsbn').BigInteger;
+
+function DiffieHellman(key) {
+	utils.assertCompatible(key, Key, [1, 4], 'key');
+	this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]);
+	this._algo = key.type;
+	this._curve = key.curve;
+	this._key = key;
+	if (key.type === 'dsa') {
+		if (!CRYPTO_HAVE_ECDH) {
+			throw (new Error('Due to bugs in the node 0.10 ' +
+			    'crypto API, node 0.12.x or later is required ' +
+			    'to use DH'));
+		}
+		this._dh = crypto.createDiffieHellman(
+		    key.part.p.data, undefined,
+		    key.part.g.data, undefined);
+		this._p = key.part.p;
+		this._g = key.part.g;
+		if (this._isPriv)
+			this._dh.setPrivateKey(key.part.x.data);
+		this._dh.setPublicKey(key.part.y.data);
+
+	} else if (key.type === 'ecdsa') {
+		if (!CRYPTO_HAVE_ECDH) {
+			this._ecParams = new X9ECParameters(this._curve);
+
+			if (this._isPriv) {
+				this._priv = new ECPrivate(
+				    this._ecParams, key.part.d.data);
+			}
+			return;
+		}
+
+		var curve = {
+			'nistp256': 'prime256v1',
+			'nistp384': 'secp384r1',
+			'nistp521': 'secp521r1'
+		}[key.curve];
+		this._dh = crypto.createECDH(curve);
+		if (typeof (this._dh) !== 'object' ||
+		    typeof (this._dh.setPrivateKey) !== 'function') {
+			CRYPTO_HAVE_ECDH = false;
+			DiffieHellman.call(this, key);
+			return;
+		}
+		if (this._isPriv)
+			this._dh.setPrivateKey(key.part.d.data);
+		this._dh.setPublicKey(key.part.Q.data);
+
+	} else if (key.type === 'curve25519') {
+		if (this._isPriv) {
+			utils.assertCompatible(key, PrivateKey, [1, 5], 'key');
+			this._priv = key.part.k.data;
+		}
+
+	} else {
+		throw (new Error('DH not supported for ' + key.type + ' keys'));
+	}
+}
+
+DiffieHellman.prototype.getPublicKey = function () {
+	if (this._isPriv)
+		return (this._key.toPublic());
+	return (this._key);
+};
+
+DiffieHellman.prototype.getPrivateKey = function () {
+	if (this._isPriv)
+		return (this._key);
+	else
+		return (undefined);
+};
+DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey;
+
+DiffieHellman.prototype._keyCheck = function (pk, isPub) {
+	assert.object(pk, 'key');
+	if (!isPub)
+		utils.assertCompatible(pk, PrivateKey, [1, 3], 'key');
+	utils.assertCompatible(pk, Key, [1, 4], 'key');
+
+	if (pk.type !== this._algo) {
+		throw (new Error('A ' + pk.type + ' key cannot be used in ' +
+		    this._algo + ' Diffie-Hellman'));
+	}
+
+	if (pk.curve !== this._curve) {
+		throw (new Error('A key from the ' + pk.curve + ' curve ' +
+		    'cannot be used with a ' + this._curve +
+		    ' Diffie-Hellman'));
+	}
+
+	if (pk.type === 'dsa') {
+		assert.deepEqual(pk.part.p, this._p,
+		    'DSA key prime does not match');
+		assert.deepEqual(pk.part.g, this._g,
+		    'DSA key generator does not match');
+	}
+};
+
+DiffieHellman.prototype.setKey = function (pk) {
+	this._keyCheck(pk);
+
+	if (pk.type === 'dsa') {
+		this._dh.setPrivateKey(pk.part.x.data);
+		this._dh.setPublicKey(pk.part.y.data);
+
+	} else if (pk.type === 'ecdsa') {
+		if (CRYPTO_HAVE_ECDH) {
+			this._dh.setPrivateKey(pk.part.d.data);
+			this._dh.setPublicKey(pk.part.Q.data);
+		} else {
+			this._priv = new ECPrivate(
+			    this._ecParams, pk.part.d.data);
+		}
+
+	} else if (pk.type === 'curve25519') {
+		var k = pk.part.k;
+		if (!pk.part.k)
+			k = pk.part.r;
+		this._priv = k.data;
+		if (this._priv[0] === 0x00)
+			this._priv = this._priv.slice(1);
+		this._priv = this._priv.slice(0, 32);
+	}
+	this._key = pk;
+	this._isPriv = true;
+};
+DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey;
+
+DiffieHellman.prototype.computeSecret = function (otherpk) {
+	this._keyCheck(otherpk, true);
+	if (!this._isPriv)
+		throw (new Error('DH exchange has not been initialized with ' +
+		    'a private key yet'));
+
+	var pub;
+	if (this._algo === 'dsa') {
+		return (this._dh.computeSecret(
+		    otherpk.part.y.data));
+
+	} else if (this._algo === 'ecdsa') {
+		if (CRYPTO_HAVE_ECDH) {
+			return (this._dh.computeSecret(
+			    otherpk.part.Q.data));
+		} else {
+			pub = new ECPublic(
+			    this._ecParams, otherpk.part.Q.data);
+			return (this._priv.deriveSharedSecret(pub));
+		}
+
+	} else if (this._algo === 'curve25519') {
+		pub = otherpk.part.A.data;
+		while (pub[0] === 0x00 && pub.length > 32)
+			pub = pub.slice(1);
+		var priv = this._priv;
+		assert.strictEqual(pub.length, 32);
+		assert.strictEqual(priv.length, 32);
+
+		var secret = nacl.box.before(new Uint8Array(pub),
+		    new Uint8Array(priv));
+
+		return (Buffer.from(secret));
+	}
+
+	throw (new Error('Invalid algorithm: ' + this._algo));
+};
+
+DiffieHellman.prototype.generateKey = function () {
+	var parts = [];
+	var priv, pub;
+	if (this._algo === 'dsa') {
+		this._dh.generateKeys();
+
+		parts.push({name: 'p', data: this._p.data});
+		parts.push({name: 'q', data: this._key.part.q.data});
+		parts.push({name: 'g', data: this._g.data});
+		parts.push({name: 'y', data: this._dh.getPublicKey()});
+		parts.push({name: 'x', data: this._dh.getPrivateKey()});
+		this._key = new PrivateKey({
+			type: 'dsa',
+			parts: parts
+		});
+		this._isPriv = true;
+		return (this._key);
+
+	} else if (this._algo === 'ecdsa') {
+		if (CRYPTO_HAVE_ECDH) {
+			this._dh.generateKeys();
+
+			parts.push({name: 'curve',
+			    data: Buffer.from(this._curve)});
+			parts.push({name: 'Q', data: this._dh.getPublicKey()});
+			parts.push({name: 'd', data: this._dh.getPrivateKey()});
+			this._key = new PrivateKey({
+				type: 'ecdsa',
+				curve: this._curve,
+				parts: parts
+			});
+			this._isPriv = true;
+			return (this._key);
+
+		} else {
+			var n = this._ecParams.getN();
+			var r = new jsbn(crypto.randomBytes(n.bitLength()));
+			var n1 = n.subtract(jsbn.ONE);
+			priv = r.mod(n1).add(jsbn.ONE);
+			pub = this._ecParams.getG().multiply(priv);
+
+			priv = Buffer.from(priv.toByteArray());
+			pub = Buffer.from(this._ecParams.getCurve().
+			    encodePointHex(pub), 'hex');
+
+			this._priv = new ECPrivate(this._ecParams, priv);
+
+			parts.push({name: 'curve',
+			    data: Buffer.from(this._curve)});
+			parts.push({name: 'Q', data: pub});
+			parts.push({name: 'd', data: priv});
+
+			this._key = new PrivateKey({
+				type: 'ecdsa',
+				curve: this._curve,
+				parts: parts
+			});
+			this._isPriv = true;
+			return (this._key);
+		}
+
+	} else if (this._algo === 'curve25519') {
+		var pair = nacl.box.keyPair();
+		priv = Buffer.from(pair.secretKey);
+		pub = Buffer.from(pair.publicKey);
+		priv = Buffer.concat([priv, pub]);
+		assert.strictEqual(priv.length, 64);
+		assert.strictEqual(pub.length, 32);
+
+		parts.push({name: 'A', data: pub});
+		parts.push({name: 'k', data: priv});
+		this._key = new PrivateKey({
+			type: 'curve25519',
+			parts: parts
+		});
+		this._isPriv = true;
+		return (this._key);
+	}
+
+	throw (new Error('Invalid algorithm: ' + this._algo));
+};
+DiffieHellman.prototype.generateKeys = DiffieHellman.prototype.generateKey;
+
+/* These are helpers for using ecc-jsbn (for node 0.10 compatibility). */
+
+function X9ECParameters(name) {
+	var params = algs.curves[name];
+	assert.object(params);
+
+	var p = new jsbn(params.p);
+	var a = new jsbn(params.a);
+	var b = new jsbn(params.b);
+	var n = new jsbn(params.n);
+	var h = jsbn.ONE;
+	var curve = new ec.ECCurveFp(p, a, b);
+	var G = curve.decodePointHex(params.G.toString('hex'));
+
+	this.curve = curve;
+	this.g = G;
+	this.n = n;
+	this.h = h;
+}
+X9ECParameters.prototype.getCurve = function () { return (this.curve); };
+X9ECParameters.prototype.getG = function () { return (this.g); };
+X9ECParameters.prototype.getN = function () { return (this.n); };
+X9ECParameters.prototype.getH = function () { return (this.h); };
+
+function ECPublic(params, buffer) {
+	this._params = params;
+	if (buffer[0] === 0x00)
+		buffer = buffer.slice(1);
+	this._pub = params.getCurve().decodePointHex(buffer.toString('hex'));
+}
+
+function ECPrivate(params, buffer) {
+	this._params = params;
+	this._priv = new jsbn(utils.mpNormalize(buffer));
+}
+ECPrivate.prototype.deriveSharedSecret = function (pubKey) {
+	assert.ok(pubKey instanceof ECPublic);
+	var S = pubKey._pub.multiply(this._priv);
+	return (Buffer.from(S.getX().toBigInteger().toByteArray()));
+};
+
+function generateED25519() {
+	var pair = nacl.sign.keyPair();
+	var priv = Buffer.from(pair.secretKey);
+	var pub = Buffer.from(pair.publicKey);
+	assert.strictEqual(priv.length, 64);
+	assert.strictEqual(pub.length, 32);
+
+	var parts = [];
+	parts.push({name: 'A', data: pub});
+	parts.push({name: 'k', data: priv.slice(0, 32)});
+	var key = new PrivateKey({
+		type: 'ed25519',
+		parts: parts
+	});
+	return (key);
+}
+
+/* Generates a new ECDSA private key on a given curve. */
+function generateECDSA(curve) {
+	var parts = [];
+	var key;
+
+	if (CRYPTO_HAVE_ECDH) {
+		/*
+		 * Node crypto doesn't expose key generation directly, but the
+		 * ECDH instances can generate keys. It turns out this just
+		 * calls into the OpenSSL generic key generator, and we can
+		 * read its output happily without doing an actual DH. So we
+		 * use that here.
+		 */
+		var osCurve = {
+			'nistp256': 'prime256v1',
+			'nistp384': 'secp384r1',
+			'nistp521': 'secp521r1'
+		}[curve];
+
+		var dh = crypto.createECDH(osCurve);
+		dh.generateKeys();
+
+		parts.push({name: 'curve',
+		    data: Buffer.from(curve)});
+		parts.push({name: 'Q', data: dh.getPublicKey()});
+		parts.push({name: 'd', data: dh.getPrivateKey()});
+
+		key = new PrivateKey({
+			type: 'ecdsa',
+			curve: curve,
+			parts: parts
+		});
+		return (key);
+	} else {
+
+		var ecParams = new X9ECParameters(curve);
+
+		/* This algorithm taken from FIPS PUB 186-4 (section B.4.1) */
+		var n = ecParams.getN();
+		/*
+		 * The crypto.randomBytes() function can only give us whole
+		 * bytes, so taking a nod from X9.62, we round up.
+		 */
+		var cByteLen = Math.ceil((n.bitLength() + 64) / 8);
+		var c = new jsbn(crypto.randomBytes(cByteLen));
+
+		var n1 = n.subtract(jsbn.ONE);
+		var priv = c.mod(n1).add(jsbn.ONE);
+		var pub = ecParams.getG().multiply(priv);
+
+		priv = Buffer.from(priv.toByteArray());
+		pub = Buffer.from(ecParams.getCurve().
+		    encodePointHex(pub), 'hex');
+
+		parts.push({name: 'curve', data: Buffer.from(curve)});
+		parts.push({name: 'Q', data: pub});
+		parts.push({name: 'd', data: priv});
+
+		key = new PrivateKey({
+			type: 'ecdsa',
+			curve: curve,
+			parts: parts
+		});
+		return (key);
+	}
+}
diff --git a/node_modules/sshpk/lib/ed-compat.js b/node_modules/sshpk/lib/ed-compat.js
new file mode 100644
index 0000000..70732e1
--- /dev/null
+++ b/node_modules/sshpk/lib/ed-compat.js
@@ -0,0 +1,92 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = {
+	Verifier: Verifier,
+	Signer: Signer
+};
+
+var nacl = require('tweetnacl');
+var stream = require('stream');
+var util = require('util');
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var Signature = require('./signature');
+
+function Verifier(key, hashAlgo) {
+	if (hashAlgo.toLowerCase() !== 'sha512')
+		throw (new Error('ED25519 only supports the use of ' +
+		    'SHA-512 hashes'));
+
+	this.key = key;
+	this.chunks = [];
+
+	stream.Writable.call(this, {});
+}
+util.inherits(Verifier, stream.Writable);
+
+Verifier.prototype._write = function (chunk, enc, cb) {
+	this.chunks.push(chunk);
+	cb();
+};
+
+Verifier.prototype.update = function (chunk) {
+	if (typeof (chunk) === 'string')
+		chunk = Buffer.from(chunk, 'binary');
+	this.chunks.push(chunk);
+};
+
+Verifier.prototype.verify = function (signature, fmt) {
+	var sig;
+	if (Signature.isSignature(signature, [2, 0])) {
+		if (signature.type !== 'ed25519')
+			return (false);
+		sig = signature.toBuffer('raw');
+
+	} else if (typeof (signature) === 'string') {
+		sig = Buffer.from(signature, 'base64');
+
+	} else if (Signature.isSignature(signature, [1, 0])) {
+		throw (new Error('signature was created by too old ' +
+		    'a version of sshpk and cannot be verified'));
+	}
+
+	assert.buffer(sig);
+	return (nacl.sign.detached.verify(
+	    new Uint8Array(Buffer.concat(this.chunks)),
+	    new Uint8Array(sig),
+	    new Uint8Array(this.key.part.A.data)));
+};
+
+function Signer(key, hashAlgo) {
+	if (hashAlgo.toLowerCase() !== 'sha512')
+		throw (new Error('ED25519 only supports the use of ' +
+		    'SHA-512 hashes'));
+
+	this.key = key;
+	this.chunks = [];
+
+	stream.Writable.call(this, {});
+}
+util.inherits(Signer, stream.Writable);
+
+Signer.prototype._write = function (chunk, enc, cb) {
+	this.chunks.push(chunk);
+	cb();
+};
+
+Signer.prototype.update = function (chunk) {
+	if (typeof (chunk) === 'string')
+		chunk = Buffer.from(chunk, 'binary');
+	this.chunks.push(chunk);
+};
+
+Signer.prototype.sign = function () {
+	var sig = nacl.sign.detached(
+	    new Uint8Array(Buffer.concat(this.chunks)),
+	    new Uint8Array(Buffer.concat([
+		this.key.part.k.data, this.key.part.A.data])));
+	var sigBuf = Buffer.from(sig);
+	var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw');
+	sigObj.hashAlgorithm = 'sha512';
+	return (sigObj);
+};
diff --git a/node_modules/sshpk/lib/errors.js b/node_modules/sshpk/lib/errors.js
new file mode 100644
index 0000000..1cc09ec
--- /dev/null
+++ b/node_modules/sshpk/lib/errors.js
@@ -0,0 +1,84 @@
+// Copyright 2015 Joyent, Inc.
+
+var assert = require('assert-plus');
+var util = require('util');
+
+function FingerprintFormatError(fp, format) {
+	if (Error.captureStackTrace)
+		Error.captureStackTrace(this, FingerprintFormatError);
+	this.name = 'FingerprintFormatError';
+	this.fingerprint = fp;
+	this.format = format;
+	this.message = 'Fingerprint format is not supported, or is invalid: ';
+	if (fp !== undefined)
+		this.message += ' fingerprint = ' + fp;
+	if (format !== undefined)
+		this.message += ' format = ' + format;
+}
+util.inherits(FingerprintFormatError, Error);
+
+function InvalidAlgorithmError(alg) {
+	if (Error.captureStackTrace)
+		Error.captureStackTrace(this, InvalidAlgorithmError);
+	this.name = 'InvalidAlgorithmError';
+	this.algorithm = alg;
+	this.message = 'Algorithm "' + alg + '" is not supported';
+}
+util.inherits(InvalidAlgorithmError, Error);
+
+function KeyParseError(name, format, innerErr) {
+	if (Error.captureStackTrace)
+		Error.captureStackTrace(this, KeyParseError);
+	this.name = 'KeyParseError';
+	this.format = format;
+	this.keyName = name;
+	this.innerErr = innerErr;
+	this.message = 'Failed to parse ' + name + ' as a valid ' + format +
+	    ' format key: ' + innerErr.message;
+}
+util.inherits(KeyParseError, Error);
+
+function SignatureParseError(type, format, innerErr) {
+	if (Error.captureStackTrace)
+		Error.captureStackTrace(this, SignatureParseError);
+	this.name = 'SignatureParseError';
+	this.type = type;
+	this.format = format;
+	this.innerErr = innerErr;
+	this.message = 'Failed to parse the given data as a ' + type +
+	    ' signature in ' + format + ' format: ' + innerErr.message;
+}
+util.inherits(SignatureParseError, Error);
+
+function CertificateParseError(name, format, innerErr) {
+	if (Error.captureStackTrace)
+		Error.captureStackTrace(this, CertificateParseError);
+	this.name = 'CertificateParseError';
+	this.format = format;
+	this.certName = name;
+	this.innerErr = innerErr;
+	this.message = 'Failed to parse ' + name + ' as a valid ' + format +
+	    ' format certificate: ' + innerErr.message;
+}
+util.inherits(CertificateParseError, Error);
+
+function KeyEncryptedError(name, format) {
+	if (Error.captureStackTrace)
+		Error.captureStackTrace(this, KeyEncryptedError);
+	this.name = 'KeyEncryptedError';
+	this.format = format;
+	this.keyName = name;
+	this.message = 'The ' + format + ' format key ' + name + ' is ' +
+	    'encrypted (password-protected), and no passphrase was ' +
+	    'provided in `options`';
+}
+util.inherits(KeyEncryptedError, Error);
+
+module.exports = {
+	FingerprintFormatError: FingerprintFormatError,
+	InvalidAlgorithmError: InvalidAlgorithmError,
+	KeyParseError: KeyParseError,
+	SignatureParseError: SignatureParseError,
+	KeyEncryptedError: KeyEncryptedError,
+	CertificateParseError: CertificateParseError
+};
diff --git a/node_modules/sshpk/lib/fingerprint.js b/node_modules/sshpk/lib/fingerprint.js
new file mode 100644
index 0000000..0004b37
--- /dev/null
+++ b/node_modules/sshpk/lib/fingerprint.js
@@ -0,0 +1,220 @@
+// Copyright 2018 Joyent, Inc.
+
+module.exports = Fingerprint;
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('./algs');
+var crypto = require('crypto');
+var errs = require('./errors');
+var Key = require('./key');
+var PrivateKey = require('./private-key');
+var Certificate = require('./certificate');
+var utils = require('./utils');
+
+var FingerprintFormatError = errs.FingerprintFormatError;
+var InvalidAlgorithmError = errs.InvalidAlgorithmError;
+
+function Fingerprint(opts) {
+	assert.object(opts, 'options');
+	assert.string(opts.type, 'options.type');
+	assert.buffer(opts.hash, 'options.hash');
+	assert.string(opts.algorithm, 'options.algorithm');
+
+	this.algorithm = opts.algorithm.toLowerCase();
+	if (algs.hashAlgs[this.algorithm] !== true)
+		throw (new InvalidAlgorithmError(this.algorithm));
+
+	this.hash = opts.hash;
+	this.type = opts.type;
+	this.hashType = opts.hashType;
+}
+
+Fingerprint.prototype.toString = function (format) {
+	if (format === undefined) {
+		if (this.algorithm === 'md5' || this.hashType === 'spki')
+			format = 'hex';
+		else
+			format = 'base64';
+	}
+	assert.string(format);
+
+	switch (format) {
+	case 'hex':
+		if (this.hashType === 'spki')
+			return (this.hash.toString('hex'));
+		return (addColons(this.hash.toString('hex')));
+	case 'base64':
+		if (this.hashType === 'spki')
+			return (this.hash.toString('base64'));
+		return (sshBase64Format(this.algorithm,
+		    this.hash.toString('base64')));
+	default:
+		throw (new FingerprintFormatError(undefined, format));
+	}
+};
+
+Fingerprint.prototype.matches = function (other) {
+	assert.object(other, 'key or certificate');
+	if (this.type === 'key' && this.hashType !== 'ssh') {
+		utils.assertCompatible(other, Key, [1, 7], 'key with spki');
+		if (PrivateKey.isPrivateKey(other)) {
+			utils.assertCompatible(other, PrivateKey, [1, 6],
+			    'privatekey with spki support');
+		}
+	} else if (this.type === 'key') {
+		utils.assertCompatible(other, Key, [1, 0], 'key');
+	} else {
+		utils.assertCompatible(other, Certificate, [1, 0],
+		    'certificate');
+	}
+
+	var theirHash = other.hash(this.algorithm, this.hashType);
+	var theirHash2 = crypto.createHash(this.algorithm).
+	    update(theirHash).digest('base64');
+
+	if (this.hash2 === undefined)
+		this.hash2 = crypto.createHash(this.algorithm).
+		    update(this.hash).digest('base64');
+
+	return (this.hash2 === theirHash2);
+};
+
+/*JSSTYLED*/
+var base64RE = /^[A-Za-z0-9+\/=]+$/;
+/*JSSTYLED*/
+var hexRE = /^[a-fA-F0-9]+$/;
+
+Fingerprint.parse = function (fp, options) {
+	assert.string(fp, 'fingerprint');
+
+	var alg, hash, enAlgs;
+	if (Array.isArray(options)) {
+		enAlgs = options;
+		options = {};
+	}
+	assert.optionalObject(options, 'options');
+	if (options === undefined)
+		options = {};
+	if (options.enAlgs !== undefined)
+		enAlgs = options.enAlgs;
+	if (options.algorithms !== undefined)
+		enAlgs = options.algorithms;
+	assert.optionalArrayOfString(enAlgs, 'algorithms');
+
+	var hashType = 'ssh';
+	if (options.hashType !== undefined)
+		hashType = options.hashType;
+	assert.string(hashType, 'options.hashType');
+
+	var parts = fp.split(':');
+	if (parts.length == 2) {
+		alg = parts[0].toLowerCase();
+		if (!base64RE.test(parts[1]))
+			throw (new FingerprintFormatError(fp));
+		try {
+			hash = Buffer.from(parts[1], 'base64');
+		} catch (e) {
+			throw (new FingerprintFormatError(fp));
+		}
+	} else if (parts.length > 2) {
+		alg = 'md5';
+		if (parts[0].toLowerCase() === 'md5')
+			parts = parts.slice(1);
+		parts = parts.map(function (p) {
+			while (p.length < 2)
+				p = '0' + p;
+			if (p.length > 2)
+				throw (new FingerprintFormatError(fp));
+			return (p);
+		});
+		parts = parts.join('');
+		if (!hexRE.test(parts) || parts.length % 2 !== 0)
+			throw (new FingerprintFormatError(fp));
+		try {
+			hash = Buffer.from(parts, 'hex');
+		} catch (e) {
+			throw (new FingerprintFormatError(fp));
+		}
+	} else {
+		if (hexRE.test(fp)) {
+			hash = Buffer.from(fp, 'hex');
+		} else if (base64RE.test(fp)) {
+			hash = Buffer.from(fp, 'base64');
+		} else {
+			throw (new FingerprintFormatError(fp));
+		}
+
+		switch (hash.length) {
+		case 32:
+			alg = 'sha256';
+			break;
+		case 16:
+			alg = 'md5';
+			break;
+		case 20:
+			alg = 'sha1';
+			break;
+		case 64:
+			alg = 'sha512';
+			break;
+		default:
+			throw (new FingerprintFormatError(fp));
+		}
+
+		/* Plain hex/base64: guess it's probably SPKI unless told. */
+		if (options.hashType === undefined)
+			hashType = 'spki';
+	}
+
+	if (alg === undefined)
+		throw (new FingerprintFormatError(fp));
+
+	if (algs.hashAlgs[alg] === undefined)
+		throw (new InvalidAlgorithmError(alg));
+
+	if (enAlgs !== undefined) {
+		enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); });
+		if (enAlgs.indexOf(alg) === -1)
+			throw (new InvalidAlgorithmError(alg));
+	}
+
+	return (new Fingerprint({
+		algorithm: alg,
+		hash: hash,
+		type: options.type || 'key',
+		hashType: hashType
+	}));
+};
+
+function addColons(s) {
+	/*JSSTYLED*/
+	return (s.replace(/(.{2})(?=.)/g, '$1:'));
+}
+
+function base64Strip(s) {
+	/*JSSTYLED*/
+	return (s.replace(/=*$/, ''));
+}
+
+function sshBase64Format(alg, h) {
+	return (alg.toUpperCase() + ':' + base64Strip(h));
+}
+
+Fingerprint.isFingerprint = function (obj, ver) {
+	return (utils.isCompatible(obj, Fingerprint, ver));
+};
+
+/*
+ * API versions for Fingerprint:
+ * [1,0] -- initial ver
+ * [1,1] -- first tagged ver
+ * [1,2] -- hashType and spki support
+ */
+Fingerprint.prototype._sshpkApiVersion = [1, 2];
+
+Fingerprint._oldVersionDetect = function (obj) {
+	assert.func(obj.toString);
+	assert.func(obj.matches);
+	return ([1, 0]);
+};
diff --git a/node_modules/sshpk/lib/formats/auto.js b/node_modules/sshpk/lib/formats/auto.js
new file mode 100644
index 0000000..f32cd96
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/auto.js
@@ -0,0 +1,124 @@
+// Copyright 2018 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	write: write
+};
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var utils = require('../utils');
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+
+var pem = require('./pem');
+var ssh = require('./ssh');
+var rfc4253 = require('./rfc4253');
+var dnssec = require('./dnssec');
+var putty = require('./putty');
+
+var DNSSEC_PRIVKEY_HEADER_PREFIX = 'Private-key-format: v1';
+
+function read(buf, options) {
+	if (typeof (buf) === 'string') {
+		if (buf.trim().match(/^[-]+[ ]*BEGIN/))
+			return (pem.read(buf, options));
+		if (buf.match(/^\s*ssh-[a-z]/))
+			return (ssh.read(buf, options));
+		if (buf.match(/^\s*ecdsa-/))
+			return (ssh.read(buf, options));
+		if (buf.match(/^putty-user-key-file-2:/i))
+			return (putty.read(buf, options));
+		if (findDNSSECHeader(buf))
+			return (dnssec.read(buf, options));
+		buf = Buffer.from(buf, 'binary');
+	} else {
+		assert.buffer(buf);
+		if (findPEMHeader(buf))
+			return (pem.read(buf, options));
+		if (findSSHHeader(buf))
+			return (ssh.read(buf, options));
+		if (findPuTTYHeader(buf))
+			return (putty.read(buf, options));
+		if (findDNSSECHeader(buf))
+			return (dnssec.read(buf, options));
+	}
+	if (buf.readUInt32BE(0) < buf.length)
+		return (rfc4253.read(buf, options));
+	throw (new Error('Failed to auto-detect format of key'));
+}
+
+function findPuTTYHeader(buf) {
+	var offset = 0;
+	while (offset < buf.length &&
+	    (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9))
+		++offset;
+	if (offset + 22 <= buf.length &&
+	    buf.slice(offset, offset + 22).toString('ascii').toLowerCase() ===
+	    'putty-user-key-file-2:')
+		return (true);
+	return (false);
+}
+
+function findSSHHeader(buf) {
+	var offset = 0;
+	while (offset < buf.length &&
+	    (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9))
+		++offset;
+	if (offset + 4 <= buf.length &&
+	    buf.slice(offset, offset + 4).toString('ascii') === 'ssh-')
+		return (true);
+	if (offset + 6 <= buf.length &&
+	    buf.slice(offset, offset + 6).toString('ascii') === 'ecdsa-')
+		return (true);
+	return (false);
+}
+
+function findPEMHeader(buf) {
+	var offset = 0;
+	while (offset < buf.length &&
+	    (buf[offset] === 32 || buf[offset] === 10))
+		++offset;
+	if (buf[offset] !== 45)
+		return (false);
+	while (offset < buf.length &&
+	    (buf[offset] === 45))
+		++offset;
+	while (offset < buf.length &&
+	    (buf[offset] === 32))
+		++offset;
+	if (offset + 5 > buf.length ||
+	    buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN')
+		return (false);
+	return (true);
+}
+
+function findDNSSECHeader(buf) {
+	// private case first
+	if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length)
+		return (false);
+	var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length);
+	if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX)
+		return (true);
+
+	// public-key RFC3110 ?
+	// 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...'
+	// skip any comment-lines
+	if (typeof (buf) !== 'string') {
+		buf = buf.toString('ascii');
+	}
+	var lines = buf.split('\n');
+	var line = 0;
+	/* JSSTYLED */
+	while (lines[line].match(/^\;/))
+		line++;
+	if (lines[line].toString('ascii').match(/\. IN KEY /))
+		return (true);
+	if (lines[line].toString('ascii').match(/\. IN DNSKEY /))
+		return (true);
+	return (false);
+}
+
+function write(key, options) {
+	throw (new Error('"auto" format cannot be used for writing'));
+}
diff --git a/node_modules/sshpk/lib/formats/dnssec.js b/node_modules/sshpk/lib/formats/dnssec.js
new file mode 100644
index 0000000..a74ea9c
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/dnssec.js
@@ -0,0 +1,287 @@
+// Copyright 2017 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	write: write
+};
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+var utils = require('../utils');
+var SSHBuffer = require('../ssh-buffer');
+var Dhe = require('../dhe');
+
+var supportedAlgos = {
+	'rsa-sha1' : 5,
+	'rsa-sha256' : 8,
+	'rsa-sha512' : 10,
+	'ecdsa-p256-sha256' : 13,
+	'ecdsa-p384-sha384' : 14
+	/*
+	 * ed25519 is hypothetically supported with id 15
+	 * but the common tools available don't appear to be
+	 * capable of generating/using ed25519 keys
+	 */
+};
+
+var supportedAlgosById = {};
+Object.keys(supportedAlgos).forEach(function (k) {
+	supportedAlgosById[supportedAlgos[k]] = k.toUpperCase();
+});
+
+function read(buf, options) {
+	if (typeof (buf) !== 'string') {
+		assert.buffer(buf, 'buf');
+		buf = buf.toString('ascii');
+	}
+	var lines = buf.split('\n');
+	if (lines[0].match(/^Private-key-format\: v1/)) {
+		var algElems = lines[1].split(' ');
+		var algoNum = parseInt(algElems[1], 10);
+		var algoName = algElems[2];
+		if (!supportedAlgosById[algoNum])
+			throw (new Error('Unsupported algorithm: ' + algoName));
+		return (readDNSSECPrivateKey(algoNum, lines.slice(2)));
+	}
+
+	// skip any comment-lines
+	var line = 0;
+	/* JSSTYLED */
+	while (lines[line].match(/^\;/))
+		line++;
+	// we should now have *one single* line left with our KEY on it.
+	if ((lines[line].match(/\. IN KEY /) ||
+	    lines[line].match(/\. IN DNSKEY /)) && lines[line+1].length === 0) {
+		return (readRFC3110(lines[line]));
+	}
+	throw (new Error('Cannot parse dnssec key'));
+}
+
+function readRFC3110(keyString) {
+	var elems = keyString.split(' ');
+	//unused var flags = parseInt(elems[3], 10);
+	//unused var protocol = parseInt(elems[4], 10);
+	var algorithm = parseInt(elems[5], 10);
+	if (!supportedAlgosById[algorithm])
+		throw (new Error('Unsupported algorithm: ' + algorithm));
+	var base64key = elems.slice(6, elems.length).join();
+	var keyBuffer = Buffer.from(base64key, 'base64');
+	if (supportedAlgosById[algorithm].match(/^RSA-/)) {
+		// join the rest of the body into a single base64-blob
+		var publicExponentLen = keyBuffer.readUInt8(0);
+		if (publicExponentLen != 3 && publicExponentLen != 1)
+			throw (new Error('Cannot parse dnssec key: ' +
+			    'unsupported exponent length'));
+
+		var publicExponent = keyBuffer.slice(1, publicExponentLen+1);
+		publicExponent = utils.mpNormalize(publicExponent);
+		var modulus = keyBuffer.slice(1+publicExponentLen);
+		modulus = utils.mpNormalize(modulus);
+		// now, make the key
+		var rsaKey = {
+			type: 'rsa',
+			parts: []
+		};
+		rsaKey.parts.push({ name: 'e', data: publicExponent});
+		rsaKey.parts.push({ name: 'n', data: modulus});
+		return (new Key(rsaKey));
+	}
+	if (supportedAlgosById[algorithm] === 'ECDSA-P384-SHA384' ||
+	    supportedAlgosById[algorithm] === 'ECDSA-P256-SHA256') {
+		var curve = 'nistp384';
+		var size = 384;
+		if (supportedAlgosById[algorithm].match(/^ECDSA-P256-SHA256/)) {
+			curve = 'nistp256';
+			size = 256;
+		}
+
+		var ecdsaKey = {
+			type: 'ecdsa',
+			curve: curve,
+			size: size,
+			parts: [
+				{name: 'curve', data: Buffer.from(curve) },
+				{name: 'Q', data: utils.ecNormalize(keyBuffer) }
+			]
+		};
+		return (new Key(ecdsaKey));
+	}
+	throw (new Error('Unsupported algorithm: ' +
+	    supportedAlgosById[algorithm]));
+}
+
+function elementToBuf(e) {
+	return (Buffer.from(e.split(' ')[1], 'base64'));
+}
+
+function readDNSSECRSAPrivateKey(elements) {
+	var rsaParams = {};
+	elements.forEach(function (element) {
+		if (element.split(' ')[0] === 'Modulus:')
+			rsaParams['n'] = elementToBuf(element);
+		else if (element.split(' ')[0] === 'PublicExponent:')
+			rsaParams['e'] = elementToBuf(element);
+		else if (element.split(' ')[0] === 'PrivateExponent:')
+			rsaParams['d'] = elementToBuf(element);
+		else if (element.split(' ')[0] === 'Prime1:')
+			rsaParams['p'] = elementToBuf(element);
+		else if (element.split(' ')[0] === 'Prime2:')
+			rsaParams['q'] = elementToBuf(element);
+		else if (element.split(' ')[0] === 'Exponent1:')
+			rsaParams['dmodp'] = elementToBuf(element);
+		else if (element.split(' ')[0] === 'Exponent2:')
+			rsaParams['dmodq'] = elementToBuf(element);
+		else if (element.split(' ')[0] === 'Coefficient:')
+			rsaParams['iqmp'] = elementToBuf(element);
+	});
+	// now, make the key
+	var key = {
+		type: 'rsa',
+		parts: [
+			{ name: 'e', data: utils.mpNormalize(rsaParams['e'])},
+			{ name: 'n', data: utils.mpNormalize(rsaParams['n'])},
+			{ name: 'd', data: utils.mpNormalize(rsaParams['d'])},
+			{ name: 'p', data: utils.mpNormalize(rsaParams['p'])},
+			{ name: 'q', data: utils.mpNormalize(rsaParams['q'])},
+			{ name: 'dmodp',
+			    data: utils.mpNormalize(rsaParams['dmodp'])},
+			{ name: 'dmodq',
+			    data: utils.mpNormalize(rsaParams['dmodq'])},
+			{ name: 'iqmp',
+			    data: utils.mpNormalize(rsaParams['iqmp'])}
+		]
+	};
+	return (new PrivateKey(key));
+}
+
+function readDNSSECPrivateKey(alg, elements) {
+	if (supportedAlgosById[alg].match(/^RSA-/)) {
+		return (readDNSSECRSAPrivateKey(elements));
+	}
+	if (supportedAlgosById[alg] === 'ECDSA-P384-SHA384' ||
+	    supportedAlgosById[alg] === 'ECDSA-P256-SHA256') {
+		var d = Buffer.from(elements[0].split(' ')[1], 'base64');
+		var curve = 'nistp384';
+		var size = 384;
+		if (supportedAlgosById[alg] === 'ECDSA-P256-SHA256') {
+			curve = 'nistp256';
+			size = 256;
+		}
+		// DNSSEC generates the public-key on the fly (go calculate it)
+		var publicKey = utils.publicFromPrivateECDSA(curve, d);
+		var Q = publicKey.part['Q'].data;
+		var ecdsaKey = {
+			type: 'ecdsa',
+			curve: curve,
+			size: size,
+			parts: [
+				{name: 'curve', data: Buffer.from(curve) },
+				{name: 'd', data: d },
+				{name: 'Q', data: Q }
+			]
+		};
+		return (new PrivateKey(ecdsaKey));
+	}
+	throw (new Error('Unsupported algorithm: ' + supportedAlgosById[alg]));
+}
+
+function dnssecTimestamp(date) {
+	var year = date.getFullYear() + ''; //stringify
+	var month = (date.getMonth() + 1);
+	var timestampStr = year + month + date.getUTCDate();
+	timestampStr += '' + date.getUTCHours() + date.getUTCMinutes();
+	timestampStr += date.getUTCSeconds();
+	return (timestampStr);
+}
+
+function rsaAlgFromOptions(opts) {
+	if (!opts || !opts.hashAlgo || opts.hashAlgo === 'sha1')
+		return ('5 (RSASHA1)');
+	else if (opts.hashAlgo === 'sha256')
+		return ('8 (RSASHA256)');
+	else if (opts.hashAlgo === 'sha512')
+		return ('10 (RSASHA512)');
+	else
+		throw (new Error('Unknown or unsupported hash: ' +
+		    opts.hashAlgo));
+}
+
+function writeRSA(key, options) {
+	// if we're missing parts, add them.
+	if (!key.part.dmodp || !key.part.dmodq) {
+		utils.addRSAMissing(key);
+	}
+
+	var out = '';
+	out += 'Private-key-format: v1.3\n';
+	out += 'Algorithm: ' + rsaAlgFromOptions(options) + '\n';
+	var n = utils.mpDenormalize(key.part['n'].data);
+	out += 'Modulus: ' + n.toString('base64') + '\n';
+	var e = utils.mpDenormalize(key.part['e'].data);
+	out += 'PublicExponent: ' + e.toString('base64') + '\n';
+	var d = utils.mpDenormalize(key.part['d'].data);
+	out += 'PrivateExponent: ' + d.toString('base64') + '\n';
+	var p = utils.mpDenormalize(key.part['p'].data);
+	out += 'Prime1: ' + p.toString('base64') + '\n';
+	var q = utils.mpDenormalize(key.part['q'].data);
+	out += 'Prime2: ' + q.toString('base64') + '\n';
+	var dmodp = utils.mpDenormalize(key.part['dmodp'].data);
+	out += 'Exponent1: ' + dmodp.toString('base64') + '\n';
+	var dmodq = utils.mpDenormalize(key.part['dmodq'].data);
+	out += 'Exponent2: ' + dmodq.toString('base64') + '\n';
+	var iqmp = utils.mpDenormalize(key.part['iqmp'].data);
+	out += 'Coefficient: ' + iqmp.toString('base64') + '\n';
+	// Assume that we're valid as-of now
+	var timestamp = new Date();
+	out += 'Created: ' + dnssecTimestamp(timestamp) + '\n';
+	out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n';
+	out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n';
+	return (Buffer.from(out, 'ascii'));
+}
+
+function writeECDSA(key, options) {
+	var out = '';
+	out += 'Private-key-format: v1.3\n';
+
+	if (key.curve === 'nistp256') {
+		out += 'Algorithm: 13 (ECDSAP256SHA256)\n';
+	} else if (key.curve === 'nistp384') {
+		out += 'Algorithm: 14 (ECDSAP384SHA384)\n';
+	} else {
+		throw (new Error('Unsupported curve'));
+	}
+	var base64Key = key.part['d'].data.toString('base64');
+	out += 'PrivateKey: ' + base64Key + '\n';
+
+	// Assume that we're valid as-of now
+	var timestamp = new Date();
+	out += 'Created: ' + dnssecTimestamp(timestamp) + '\n';
+	out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n';
+	out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n';
+
+	return (Buffer.from(out, 'ascii'));
+}
+
+function write(key, options) {
+	if (PrivateKey.isPrivateKey(key)) {
+		if (key.type === 'rsa') {
+			return (writeRSA(key, options));
+		} else if (key.type === 'ecdsa') {
+			return (writeECDSA(key, options));
+		} else {
+			throw (new Error('Unsupported algorithm: ' + key.type));
+		}
+	} else if (Key.isKey(key)) {
+		/*
+		 * RFC3110 requires a keyname, and a keytype, which we
+		 * don't really have a mechanism for specifying such
+		 * additional metadata.
+		 */
+		throw (new Error('Format "dnssec" only supports ' +
+		    'writing private keys'));
+	} else {
+		throw (new Error('key is not a Key or PrivateKey'));
+	}
+}
diff --git a/node_modules/sshpk/lib/formats/openssh-cert.js b/node_modules/sshpk/lib/formats/openssh-cert.js
new file mode 100644
index 0000000..766f3d3
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/openssh-cert.js
@@ -0,0 +1,352 @@
+// Copyright 2017 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	verify: verify,
+	sign: sign,
+	signAsync: signAsync,
+	write: write,
+
+	/* Internal private API */
+	fromBuffer: fromBuffer,
+	toBuffer: toBuffer
+};
+
+var assert = require('assert-plus');
+var SSHBuffer = require('../ssh-buffer');
+var crypto = require('crypto');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('../algs');
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+var Identity = require('../identity');
+var rfc4253 = require('./rfc4253');
+var Signature = require('../signature');
+var utils = require('../utils');
+var Certificate = require('../certificate');
+
+function verify(cert, key) {
+	/*
+	 * We always give an issuerKey, so if our verify() is being called then
+	 * there was no signature. Return false.
+	 */
+	return (false);
+}
+
+var TYPES = {
+	'user': 1,
+	'host': 2
+};
+Object.keys(TYPES).forEach(function (k) { TYPES[TYPES[k]] = k; });
+
+var ECDSA_ALGO = /^ecdsa-sha2-([^@-]+)-cert-v01@openssh.com$/;
+
+function read(buf, options) {
+	if (Buffer.isBuffer(buf))
+		buf = buf.toString('ascii');
+	var parts = buf.trim().split(/[ \t\n]+/g);
+	if (parts.length < 2 || parts.length > 3)
+		throw (new Error('Not a valid SSH certificate line'));
+
+	var algo = parts[0];
+	var data = parts[1];
+
+	data = Buffer.from(data, 'base64');
+	return (fromBuffer(data, algo));
+}
+
+function fromBuffer(data, algo, partial) {
+	var sshbuf = new SSHBuffer({ buffer: data });
+	var innerAlgo = sshbuf.readString();
+	if (algo !== undefined && innerAlgo !== algo)
+		throw (new Error('SSH certificate algorithm mismatch'));
+	if (algo === undefined)
+		algo = innerAlgo;
+
+	var cert = {};
+	cert.signatures = {};
+	cert.signatures.openssh = {};
+
+	cert.signatures.openssh.nonce = sshbuf.readBuffer();
+
+	var key = {};
+	var parts = (key.parts = []);
+	key.type = getAlg(algo);
+
+	var partCount = algs.info[key.type].parts.length;
+	while (parts.length < partCount)
+		parts.push(sshbuf.readPart());
+	assert.ok(parts.length >= 1, 'key must have at least one part');
+
+	var algInfo = algs.info[key.type];
+	if (key.type === 'ecdsa') {
+		var res = ECDSA_ALGO.exec(algo);
+		assert.ok(res !== null);
+		assert.strictEqual(res[1], parts[0].data.toString());
+	}
+
+	for (var i = 0; i < algInfo.parts.length; ++i) {
+		parts[i].name = algInfo.parts[i];
+		if (parts[i].name !== 'curve' &&
+		    algInfo.normalize !== false) {
+			var p = parts[i];
+			p.data = utils.mpNormalize(p.data);
+		}
+	}
+
+	cert.subjectKey = new Key(key);
+
+	cert.serial = sshbuf.readInt64();
+
+	var type = TYPES[sshbuf.readInt()];
+	assert.string(type, 'valid cert type');
+
+	cert.signatures.openssh.keyId = sshbuf.readString();
+
+	var principals = [];
+	var pbuf = sshbuf.readBuffer();
+	var psshbuf = new SSHBuffer({ buffer: pbuf });
+	while (!psshbuf.atEnd())
+		principals.push(psshbuf.readString());
+	if (principals.length === 0)
+		principals = ['*'];
+
+	cert.subjects = principals.map(function (pr) {
+		if (type === 'user')
+			return (Identity.forUser(pr));
+		else if (type === 'host')
+			return (Identity.forHost(pr));
+		throw (new Error('Unknown identity type ' + type));
+	});
+
+	cert.validFrom = int64ToDate(sshbuf.readInt64());
+	cert.validUntil = int64ToDate(sshbuf.readInt64());
+
+	var exts = [];
+	var extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() });
+	var ext;
+	while (!extbuf.atEnd()) {
+		ext = { critical: true };
+		ext.name = extbuf.readString();
+		ext.data = extbuf.readBuffer();
+		exts.push(ext);
+	}
+	extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() });
+	while (!extbuf.atEnd()) {
+		ext = { critical: false };
+		ext.name = extbuf.readString();
+		ext.data = extbuf.readBuffer();
+		exts.push(ext);
+	}
+	cert.signatures.openssh.exts = exts;
+
+	/* reserved */
+	sshbuf.readBuffer();
+
+	var signingKeyBuf = sshbuf.readBuffer();
+	cert.issuerKey = rfc4253.read(signingKeyBuf);
+
+	/*
+	 * OpenSSH certs don't give the identity of the issuer, just their
+	 * public key. So, we use an Identity that matches anything. The
+	 * isSignedBy() function will later tell you if the key matches.
+	 */
+	cert.issuer = Identity.forHost('**');
+
+	var sigBuf = sshbuf.readBuffer();
+	cert.signatures.openssh.signature =
+	    Signature.parse(sigBuf, cert.issuerKey.type, 'ssh');
+
+	if (partial !== undefined) {
+		partial.remainder = sshbuf.remainder();
+		partial.consumed = sshbuf._offset;
+	}
+
+	return (new Certificate(cert));
+}
+
+function int64ToDate(buf) {
+	var i = buf.readUInt32BE(0) * 4294967296;
+	i += buf.readUInt32BE(4);
+	var d = new Date();
+	d.setTime(i * 1000);
+	d.sourceInt64 = buf;
+	return (d);
+}
+
+function dateToInt64(date) {
+	if (date.sourceInt64 !== undefined)
+		return (date.sourceInt64);
+	var i = Math.round(date.getTime() / 1000);
+	var upper = Math.floor(i / 4294967296);
+	var lower = Math.floor(i % 4294967296);
+	var buf = Buffer.alloc(8);
+	buf.writeUInt32BE(upper, 0);
+	buf.writeUInt32BE(lower, 4);
+	return (buf);
+}
+
+function sign(cert, key) {
+	if (cert.signatures.openssh === undefined)
+		cert.signatures.openssh = {};
+	try {
+		var blob = toBuffer(cert, true);
+	} catch (e) {
+		delete (cert.signatures.openssh);
+		return (false);
+	}
+	var sig = cert.signatures.openssh;
+	var hashAlgo = undefined;
+	if (key.type === 'rsa' || key.type === 'dsa')
+		hashAlgo = 'sha1';
+	var signer = key.createSign(hashAlgo);
+	signer.write(blob);
+	sig.signature = signer.sign();
+	return (true);
+}
+
+function signAsync(cert, signer, done) {
+	if (cert.signatures.openssh === undefined)
+		cert.signatures.openssh = {};
+	try {
+		var blob = toBuffer(cert, true);
+	} catch (e) {
+		delete (cert.signatures.openssh);
+		done(e);
+		return;
+	}
+	var sig = cert.signatures.openssh;
+
+	signer(blob, function (err, signature) {
+		if (err) {
+			done(err);
+			return;
+		}
+		try {
+			/*
+			 * This will throw if the signature isn't of a
+			 * type/algo that can be used for SSH.
+			 */
+			signature.toBuffer('ssh');
+		} catch (e) {
+			done(e);
+			return;
+		}
+		sig.signature = signature;
+		done();
+	});
+}
+
+function write(cert, options) {
+	if (options === undefined)
+		options = {};
+
+	var blob = toBuffer(cert);
+	var out = getCertType(cert.subjectKey) + ' ' + blob.toString('base64');
+	if (options.comment)
+		out = out + ' ' + options.comment;
+	return (out);
+}
+
+
+function toBuffer(cert, noSig) {
+	assert.object(cert.signatures.openssh, 'signature for openssh format');
+	var sig = cert.signatures.openssh;
+
+	if (sig.nonce === undefined)
+		sig.nonce = crypto.randomBytes(16);
+	var buf = new SSHBuffer({});
+	buf.writeString(getCertType(cert.subjectKey));
+	buf.writeBuffer(sig.nonce);
+
+	var key = cert.subjectKey;
+	var algInfo = algs.info[key.type];
+	algInfo.parts.forEach(function (part) {
+		buf.writePart(key.part[part]);
+	});
+
+	buf.writeInt64(cert.serial);
+
+	var type = cert.subjects[0].type;
+	assert.notStrictEqual(type, 'unknown');
+	cert.subjects.forEach(function (id) {
+		assert.strictEqual(id.type, type);
+	});
+	type = TYPES[type];
+	buf.writeInt(type);
+
+	if (sig.keyId === undefined) {
+		sig.keyId = cert.subjects[0].type + '_' +
+		    (cert.subjects[0].uid || cert.subjects[0].hostname);
+	}
+	buf.writeString(sig.keyId);
+
+	var sub = new SSHBuffer({});
+	cert.subjects.forEach(function (id) {
+		if (type === TYPES.host)
+			sub.writeString(id.hostname);
+		else if (type === TYPES.user)
+			sub.writeString(id.uid);
+	});
+	buf.writeBuffer(sub.toBuffer());
+
+	buf.writeInt64(dateToInt64(cert.validFrom));
+	buf.writeInt64(dateToInt64(cert.validUntil));
+
+	var exts = sig.exts;
+	if (exts === undefined)
+		exts = [];
+
+	var extbuf = new SSHBuffer({});
+	exts.forEach(function (ext) {
+		if (ext.critical !== true)
+			return;
+		extbuf.writeString(ext.name);
+		extbuf.writeBuffer(ext.data);
+	});
+	buf.writeBuffer(extbuf.toBuffer());
+
+	extbuf = new SSHBuffer({});
+	exts.forEach(function (ext) {
+		if (ext.critical === true)
+			return;
+		extbuf.writeString(ext.name);
+		extbuf.writeBuffer(ext.data);
+	});
+	buf.writeBuffer(extbuf.toBuffer());
+
+	/* reserved */
+	buf.writeBuffer(Buffer.alloc(0));
+
+	sub = rfc4253.write(cert.issuerKey);
+	buf.writeBuffer(sub);
+
+	if (!noSig)
+		buf.writeBuffer(sig.signature.toBuffer('ssh'));
+
+	return (buf.toBuffer());
+}
+
+function getAlg(certType) {
+	if (certType === 'ssh-rsa-cert-v01@openssh.com')
+		return ('rsa');
+	if (certType === 'ssh-dss-cert-v01@openssh.com')
+		return ('dsa');
+	if (certType.match(ECDSA_ALGO))
+		return ('ecdsa');
+	if (certType === 'ssh-ed25519-cert-v01@openssh.com')
+		return ('ed25519');
+	throw (new Error('Unsupported cert type ' + certType));
+}
+
+function getCertType(key) {
+	if (key.type === 'rsa')
+		return ('ssh-rsa-cert-v01@openssh.com');
+	if (key.type === 'dsa')
+		return ('ssh-dss-cert-v01@openssh.com');
+	if (key.type === 'ecdsa')
+		return ('ecdsa-sha2-' + key.curve + '-cert-v01@openssh.com');
+	if (key.type === 'ed25519')
+		return ('ssh-ed25519-cert-v01@openssh.com');
+	throw (new Error('Unsupported key type ' + key.type));
+}
diff --git a/node_modules/sshpk/lib/formats/pem.js b/node_modules/sshpk/lib/formats/pem.js
new file mode 100644
index 0000000..bbe78fc
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/pem.js
@@ -0,0 +1,290 @@
+// Copyright 2018 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	write: write
+};
+
+var assert = require('assert-plus');
+var asn1 = require('asn1');
+var crypto = require('crypto');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('../algs');
+var utils = require('../utils');
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+
+var pkcs1 = require('./pkcs1');
+var pkcs8 = require('./pkcs8');
+var sshpriv = require('./ssh-private');
+var rfc4253 = require('./rfc4253');
+
+var errors = require('../errors');
+
+var OID_PBES2 = '1.2.840.113549.1.5.13';
+var OID_PBKDF2 = '1.2.840.113549.1.5.12';
+
+var OID_TO_CIPHER = {
+	'1.2.840.113549.3.7': '3des-cbc',
+	'2.16.840.1.101.3.4.1.2': 'aes128-cbc',
+	'2.16.840.1.101.3.4.1.42': 'aes256-cbc'
+};
+var CIPHER_TO_OID = {};
+Object.keys(OID_TO_CIPHER).forEach(function (k) {
+	CIPHER_TO_OID[OID_TO_CIPHER[k]] = k;
+});
+
+var OID_TO_HASH = {
+	'1.2.840.113549.2.7': 'sha1',
+	'1.2.840.113549.2.9': 'sha256',
+	'1.2.840.113549.2.11': 'sha512'
+};
+var HASH_TO_OID = {};
+Object.keys(OID_TO_HASH).forEach(function (k) {
+	HASH_TO_OID[OID_TO_HASH[k]] = k;
+});
+
+/*
+ * For reading we support both PKCS#1 and PKCS#8. If we find a private key,
+ * we just take the public component of it and use that.
+ */
+function read(buf, options, forceType) {
+	var input = buf;
+	if (typeof (buf) !== 'string') {
+		assert.buffer(buf, 'buf');
+		buf = buf.toString('ascii');
+	}
+
+	var lines = buf.trim().split(/[\r\n]+/g);
+
+	var m;
+	var si = -1;
+	while (!m && si < lines.length) {
+		m = lines[++si].match(/*JSSTYLED*/
+		    /[-]+[ ]*BEGIN ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/);
+	}
+	assert.ok(m, 'invalid PEM header');
+
+	var m2;
+	var ei = lines.length;
+	while (!m2 && ei > 0) {
+		m2 = lines[--ei].match(/*JSSTYLED*/
+		    /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/);
+	}
+	assert.ok(m2, 'invalid PEM footer');
+
+	/* Begin and end banners must match key type */
+	assert.equal(m[2], m2[2]);
+	var type = m[2].toLowerCase();
+
+	var alg;
+	if (m[1]) {
+		/* They also must match algorithms, if given */
+		assert.equal(m[1], m2[1], 'PEM header and footer mismatch');
+		alg = m[1].trim();
+	}
+
+	lines = lines.slice(si, ei + 1);
+
+	var headers = {};
+	while (true) {
+		lines = lines.slice(1);
+		m = lines[0].match(/*JSSTYLED*/
+		    /^([A-Za-z0-9-]+): (.+)$/);
+		if (!m)
+			break;
+		headers[m[1].toLowerCase()] = m[2];
+	}
+
+	/* Chop off the first and last lines */
+	lines = lines.slice(0, -1).join('');
+	buf = Buffer.from(lines, 'base64');
+
+	var cipher, key, iv;
+	if (headers['proc-type']) {
+		var parts = headers['proc-type'].split(',');
+		if (parts[0] === '4' && parts[1] === 'ENCRYPTED') {
+			if (typeof (options.passphrase) === 'string') {
+				options.passphrase = Buffer.from(
+				    options.passphrase, 'utf-8');
+			}
+			if (!Buffer.isBuffer(options.passphrase)) {
+				throw (new errors.KeyEncryptedError(
+				    options.filename, 'PEM'));
+			} else {
+				parts = headers['dek-info'].split(',');
+				assert.ok(parts.length === 2);
+				cipher = parts[0].toLowerCase();
+				iv = Buffer.from(parts[1], 'hex');
+				key = utils.opensslKeyDeriv(cipher, iv,
+				    options.passphrase, 1).key;
+			}
+		}
+	}
+
+	if (alg && alg.toLowerCase() === 'encrypted') {
+		var eder = new asn1.BerReader(buf);
+		var pbesEnd;
+		eder.readSequence();
+
+		eder.readSequence();
+		pbesEnd = eder.offset + eder.length;
+
+		var method = eder.readOID();
+		if (method !== OID_PBES2) {
+			throw (new Error('Unsupported PEM/PKCS8 encryption ' +
+			    'scheme: ' + method));
+		}
+
+		eder.readSequence();	/* PBES2-params */
+
+		eder.readSequence();	/* keyDerivationFunc */
+		var kdfEnd = eder.offset + eder.length;
+		var kdfOid = eder.readOID();
+		if (kdfOid !== OID_PBKDF2)
+			throw (new Error('Unsupported PBES2 KDF: ' + kdfOid));
+		eder.readSequence();
+		var salt = eder.readString(asn1.Ber.OctetString, true);
+		var iterations = eder.readInt();
+		var hashAlg = 'sha1';
+		if (eder.offset < kdfEnd) {
+			eder.readSequence();
+			var hashAlgOid = eder.readOID();
+			hashAlg = OID_TO_HASH[hashAlgOid];
+			if (hashAlg === undefined) {
+				throw (new Error('Unsupported PBKDF2 hash: ' +
+				    hashAlgOid));
+			}
+		}
+		eder._offset = kdfEnd;
+
+		eder.readSequence();	/* encryptionScheme */
+		var cipherOid = eder.readOID();
+		cipher = OID_TO_CIPHER[cipherOid];
+		if (cipher === undefined) {
+			throw (new Error('Unsupported PBES2 cipher: ' +
+			    cipherOid));
+		}
+		iv = eder.readString(asn1.Ber.OctetString, true);
+
+		eder._offset = pbesEnd;
+		buf = eder.readString(asn1.Ber.OctetString, true);
+
+		if (typeof (options.passphrase) === 'string') {
+			options.passphrase = Buffer.from(
+			    options.passphrase, 'utf-8');
+		}
+		if (!Buffer.isBuffer(options.passphrase)) {
+			throw (new errors.KeyEncryptedError(
+			    options.filename, 'PEM'));
+		}
+
+		var cinfo = utils.opensshCipherInfo(cipher);
+
+		cipher = cinfo.opensslName;
+		key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize,
+		    options.passphrase);
+		alg = undefined;
+	}
+
+	if (cipher && key && iv) {
+		var cipherStream = crypto.createDecipheriv(cipher, key, iv);
+		var chunk, chunks = [];
+		cipherStream.once('error', function (e) {
+			if (e.toString().indexOf('bad decrypt') !== -1) {
+				throw (new Error('Incorrect passphrase ' +
+				    'supplied, could not decrypt key'));
+			}
+			throw (e);
+		});
+		cipherStream.write(buf);
+		cipherStream.end();
+		while ((chunk = cipherStream.read()) !== null)
+			chunks.push(chunk);
+		buf = Buffer.concat(chunks);
+	}
+
+	/* The new OpenSSH internal format abuses PEM headers */
+	if (alg && alg.toLowerCase() === 'openssh')
+		return (sshpriv.readSSHPrivate(type, buf, options));
+	if (alg && alg.toLowerCase() === 'ssh2')
+		return (rfc4253.readType(type, buf, options));
+
+	var der = new asn1.BerReader(buf);
+	der.originalInput = input;
+
+	/*
+	 * All of the PEM file types start with a sequence tag, so chop it
+	 * off here
+	 */
+	der.readSequence();
+
+	/* PKCS#1 type keys name an algorithm in the banner explicitly */
+	if (alg) {
+		if (forceType)
+			assert.strictEqual(forceType, 'pkcs1');
+		return (pkcs1.readPkcs1(alg, type, der));
+	} else {
+		if (forceType)
+			assert.strictEqual(forceType, 'pkcs8');
+		return (pkcs8.readPkcs8(alg, type, der));
+	}
+}
+
+function write(key, options, type) {
+	assert.object(key);
+
+	var alg = {
+	    'ecdsa': 'EC',
+	    'rsa': 'RSA',
+	    'dsa': 'DSA',
+	    'ed25519': 'EdDSA'
+	}[key.type];
+	var header;
+
+	var der = new asn1.BerWriter();
+
+	if (PrivateKey.isPrivateKey(key)) {
+		if (type && type === 'pkcs8') {
+			header = 'PRIVATE KEY';
+			pkcs8.writePkcs8(der, key);
+		} else {
+			if (type)
+				assert.strictEqual(type, 'pkcs1');
+			header = alg + ' PRIVATE KEY';
+			pkcs1.writePkcs1(der, key);
+		}
+
+	} else if (Key.isKey(key)) {
+		if (type && type === 'pkcs1') {
+			header = alg + ' PUBLIC KEY';
+			pkcs1.writePkcs1(der, key);
+		} else {
+			if (type)
+				assert.strictEqual(type, 'pkcs8');
+			header = 'PUBLIC KEY';
+			pkcs8.writePkcs8(der, key);
+		}
+
+	} else {
+		throw (new Error('key is not a Key or PrivateKey'));
+	}
+
+	var tmp = der.buffer.toString('base64');
+	var len = tmp.length + (tmp.length / 64) +
+	    18 + 16 + header.length*2 + 10;
+	var buf = Buffer.alloc(len);
+	var o = 0;
+	o += buf.write('-----BEGIN ' + header + '-----\n', o);
+	for (var i = 0; i < tmp.length; ) {
+		var limit = i + 64;
+		if (limit > tmp.length)
+			limit = tmp.length;
+		o += buf.write(tmp.slice(i, limit), o);
+		buf[o++] = 10;
+		i = limit;
+	}
+	o += buf.write('-----END ' + header + '-----\n', o);
+
+	return (buf.slice(0, o));
+}
diff --git a/node_modules/sshpk/lib/formats/pkcs1.js b/node_modules/sshpk/lib/formats/pkcs1.js
new file mode 100644
index 0000000..bc48550
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/pkcs1.js
@@ -0,0 +1,373 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	readPkcs1: readPkcs1,
+	write: write,
+	writePkcs1: writePkcs1
+};
+
+var assert = require('assert-plus');
+var asn1 = require('asn1');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('../algs');
+var utils = require('../utils');
+
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+var pem = require('./pem');
+
+var pkcs8 = require('./pkcs8');
+var readECDSACurve = pkcs8.readECDSACurve;
+
+function read(buf, options) {
+	return (pem.read(buf, options, 'pkcs1'));
+}
+
+function write(key, options) {
+	return (pem.write(key, options, 'pkcs1'));
+}
+
+/* Helper to read in a single mpint */
+function readMPInt(der, nm) {
+	assert.strictEqual(der.peek(), asn1.Ber.Integer,
+	    nm + ' is not an Integer');
+	return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true)));
+}
+
+function readPkcs1(alg, type, der) {
+	switch (alg) {
+	case 'RSA':
+		if (type === 'public')
+			return (readPkcs1RSAPublic(der));
+		else if (type === 'private')
+			return (readPkcs1RSAPrivate(der));
+		throw (new Error('Unknown key type: ' + type));
+	case 'DSA':
+		if (type === 'public')
+			return (readPkcs1DSAPublic(der));
+		else if (type === 'private')
+			return (readPkcs1DSAPrivate(der));
+		throw (new Error('Unknown key type: ' + type));
+	case 'EC':
+	case 'ECDSA':
+		if (type === 'private')
+			return (readPkcs1ECDSAPrivate(der));
+		else if (type === 'public')
+			return (readPkcs1ECDSAPublic(der));
+		throw (new Error('Unknown key type: ' + type));
+	case 'EDDSA':
+	case 'EdDSA':
+		if (type === 'private')
+			return (readPkcs1EdDSAPrivate(der));
+		throw (new Error(type + ' keys not supported with EdDSA'));
+	default:
+		throw (new Error('Unknown key algo: ' + alg));
+	}
+}
+
+function readPkcs1RSAPublic(der) {
+	// modulus and exponent
+	var n = readMPInt(der, 'modulus');
+	var e = readMPInt(der, 'exponent');
+
+	// now, make the key
+	var key = {
+		type: 'rsa',
+		parts: [
+			{ name: 'e', data: e },
+			{ name: 'n', data: n }
+		]
+	};
+
+	return (new Key(key));
+}
+
+function readPkcs1RSAPrivate(der) {
+	var version = readMPInt(der, 'version');
+	assert.strictEqual(version[0], 0);
+
+	// modulus then public exponent
+	var n = readMPInt(der, 'modulus');
+	var e = readMPInt(der, 'public exponent');
+	var d = readMPInt(der, 'private exponent');
+	var p = readMPInt(der, 'prime1');
+	var q = readMPInt(der, 'prime2');
+	var dmodp = readMPInt(der, 'exponent1');
+	var dmodq = readMPInt(der, 'exponent2');
+	var iqmp = readMPInt(der, 'iqmp');
+
+	// now, make the key
+	var key = {
+		type: 'rsa',
+		parts: [
+			{ name: 'n', data: n },
+			{ name: 'e', data: e },
+			{ name: 'd', data: d },
+			{ name: 'iqmp', data: iqmp },
+			{ name: 'p', data: p },
+			{ name: 'q', data: q },
+			{ name: 'dmodp', data: dmodp },
+			{ name: 'dmodq', data: dmodq }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function readPkcs1DSAPrivate(der) {
+	var version = readMPInt(der, 'version');
+	assert.strictEqual(version.readUInt8(0), 0);
+
+	var p = readMPInt(der, 'p');
+	var q = readMPInt(der, 'q');
+	var g = readMPInt(der, 'g');
+	var y = readMPInt(der, 'y');
+	var x = readMPInt(der, 'x');
+
+	// now, make the key
+	var key = {
+		type: 'dsa',
+		parts: [
+			{ name: 'p', data: p },
+			{ name: 'q', data: q },
+			{ name: 'g', data: g },
+			{ name: 'y', data: y },
+			{ name: 'x', data: x }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function readPkcs1EdDSAPrivate(der) {
+	var version = readMPInt(der, 'version');
+	assert.strictEqual(version.readUInt8(0), 1);
+
+	// private key
+	var k = der.readString(asn1.Ber.OctetString, true);
+
+	der.readSequence(0xa0);
+	var oid = der.readOID();
+	assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier');
+
+	der.readSequence(0xa1);
+	var A = utils.readBitString(der);
+
+	var key = {
+		type: 'ed25519',
+		parts: [
+			{ name: 'A', data: utils.zeroPadToLength(A, 32) },
+			{ name: 'k', data: k }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function readPkcs1DSAPublic(der) {
+	var y = readMPInt(der, 'y');
+	var p = readMPInt(der, 'p');
+	var q = readMPInt(der, 'q');
+	var g = readMPInt(der, 'g');
+
+	var key = {
+		type: 'dsa',
+		parts: [
+			{ name: 'y', data: y },
+			{ name: 'p', data: p },
+			{ name: 'q', data: q },
+			{ name: 'g', data: g }
+		]
+	};
+
+	return (new Key(key));
+}
+
+function readPkcs1ECDSAPublic(der) {
+	der.readSequence();
+
+	var oid = der.readOID();
+	assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey');
+
+	var curveOid = der.readOID();
+
+	var curve;
+	var curves = Object.keys(algs.curves);
+	for (var j = 0; j < curves.length; ++j) {
+		var c = curves[j];
+		var cd = algs.curves[c];
+		if (cd.pkcs8oid === curveOid) {
+			curve = c;
+			break;
+		}
+	}
+	assert.string(curve, 'a known ECDSA named curve');
+
+	var Q = der.readString(asn1.Ber.BitString, true);
+	Q = utils.ecNormalize(Q);
+
+	var key = {
+		type: 'ecdsa',
+		parts: [
+			{ name: 'curve', data: Buffer.from(curve) },
+			{ name: 'Q', data: Q }
+		]
+	};
+
+	return (new Key(key));
+}
+
+function readPkcs1ECDSAPrivate(der) {
+	var version = readMPInt(der, 'version');
+	assert.strictEqual(version.readUInt8(0), 1);
+
+	// private key
+	var d = der.readString(asn1.Ber.OctetString, true);
+
+	der.readSequence(0xa0);
+	var curve = readECDSACurve(der);
+	assert.string(curve, 'a known elliptic curve');
+
+	der.readSequence(0xa1);
+	var Q = der.readString(asn1.Ber.BitString, true);
+	Q = utils.ecNormalize(Q);
+
+	var key = {
+		type: 'ecdsa',
+		parts: [
+			{ name: 'curve', data: Buffer.from(curve) },
+			{ name: 'Q', data: Q },
+			{ name: 'd', data: d }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function writePkcs1(der, key) {
+	der.startSequence();
+
+	switch (key.type) {
+	case 'rsa':
+		if (PrivateKey.isPrivateKey(key))
+			writePkcs1RSAPrivate(der, key);
+		else
+			writePkcs1RSAPublic(der, key);
+		break;
+	case 'dsa':
+		if (PrivateKey.isPrivateKey(key))
+			writePkcs1DSAPrivate(der, key);
+		else
+			writePkcs1DSAPublic(der, key);
+		break;
+	case 'ecdsa':
+		if (PrivateKey.isPrivateKey(key))
+			writePkcs1ECDSAPrivate(der, key);
+		else
+			writePkcs1ECDSAPublic(der, key);
+		break;
+	case 'ed25519':
+		if (PrivateKey.isPrivateKey(key))
+			writePkcs1EdDSAPrivate(der, key);
+		else
+			writePkcs1EdDSAPublic(der, key);
+		break;
+	default:
+		throw (new Error('Unknown key algo: ' + key.type));
+	}
+
+	der.endSequence();
+}
+
+function writePkcs1RSAPublic(der, key) {
+	der.writeBuffer(key.part.n.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.e.data, asn1.Ber.Integer);
+}
+
+function writePkcs1RSAPrivate(der, key) {
+	var ver = Buffer.from([0]);
+	der.writeBuffer(ver, asn1.Ber.Integer);
+
+	der.writeBuffer(key.part.n.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.e.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.d.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.p.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.q.data, asn1.Ber.Integer);
+	if (!key.part.dmodp || !key.part.dmodq)
+		utils.addRSAMissing(key);
+	der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer);
+}
+
+function writePkcs1DSAPrivate(der, key) {
+	var ver = Buffer.from([0]);
+	der.writeBuffer(ver, asn1.Ber.Integer);
+
+	der.writeBuffer(key.part.p.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.q.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.g.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.y.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.x.data, asn1.Ber.Integer);
+}
+
+function writePkcs1DSAPublic(der, key) {
+	der.writeBuffer(key.part.y.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.p.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.q.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.g.data, asn1.Ber.Integer);
+}
+
+function writePkcs1ECDSAPublic(der, key) {
+	der.startSequence();
+
+	der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */
+	var curve = key.part.curve.data.toString();
+	var curveOid = algs.curves[curve].pkcs8oid;
+	assert.string(curveOid, 'a known ECDSA named curve');
+	der.writeOID(curveOid);
+
+	der.endSequence();
+
+	var Q = utils.ecNormalize(key.part.Q.data, true);
+	der.writeBuffer(Q, asn1.Ber.BitString);
+}
+
+function writePkcs1ECDSAPrivate(der, key) {
+	var ver = Buffer.from([1]);
+	der.writeBuffer(ver, asn1.Ber.Integer);
+
+	der.writeBuffer(key.part.d.data, asn1.Ber.OctetString);
+
+	der.startSequence(0xa0);
+	var curve = key.part.curve.data.toString();
+	var curveOid = algs.curves[curve].pkcs8oid;
+	assert.string(curveOid, 'a known ECDSA named curve');
+	der.writeOID(curveOid);
+	der.endSequence();
+
+	der.startSequence(0xa1);
+	var Q = utils.ecNormalize(key.part.Q.data, true);
+	der.writeBuffer(Q, asn1.Ber.BitString);
+	der.endSequence();
+}
+
+function writePkcs1EdDSAPrivate(der, key) {
+	var ver = Buffer.from([1]);
+	der.writeBuffer(ver, asn1.Ber.Integer);
+
+	der.writeBuffer(key.part.k.data, asn1.Ber.OctetString);
+
+	der.startSequence(0xa0);
+	der.writeOID('1.3.101.112');
+	der.endSequence();
+
+	der.startSequence(0xa1);
+	utils.writeBitString(der, key.part.A.data);
+	der.endSequence();
+}
+
+function writePkcs1EdDSAPublic(der, key) {
+	throw (new Error('Public keys are not supported for EdDSA PKCS#1'));
+}
diff --git a/node_modules/sshpk/lib/formats/pkcs8.js b/node_modules/sshpk/lib/formats/pkcs8.js
new file mode 100644
index 0000000..2ca3ca7
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/pkcs8.js
@@ -0,0 +1,631 @@
+// Copyright 2018 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	readPkcs8: readPkcs8,
+	write: write,
+	writePkcs8: writePkcs8,
+	pkcs8ToBuffer: pkcs8ToBuffer,
+
+	readECDSACurve: readECDSACurve,
+	writeECDSACurve: writeECDSACurve
+};
+
+var assert = require('assert-plus');
+var asn1 = require('asn1');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('../algs');
+var utils = require('../utils');
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+var pem = require('./pem');
+
+function read(buf, options) {
+	return (pem.read(buf, options, 'pkcs8'));
+}
+
+function write(key, options) {
+	return (pem.write(key, options, 'pkcs8'));
+}
+
+/* Helper to read in a single mpint */
+function readMPInt(der, nm) {
+	assert.strictEqual(der.peek(), asn1.Ber.Integer,
+	    nm + ' is not an Integer');
+	return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true)));
+}
+
+function readPkcs8(alg, type, der) {
+	/* Private keys in pkcs#8 format have a weird extra int */
+	if (der.peek() === asn1.Ber.Integer) {
+		assert.strictEqual(type, 'private',
+		    'unexpected Integer at start of public key');
+		der.readString(asn1.Ber.Integer, true);
+	}
+
+	der.readSequence();
+	var next = der.offset + der.length;
+
+	var oid = der.readOID();
+	switch (oid) {
+	case '1.2.840.113549.1.1.1':
+		der._offset = next;
+		if (type === 'public')
+			return (readPkcs8RSAPublic(der));
+		else
+			return (readPkcs8RSAPrivate(der));
+	case '1.2.840.10040.4.1':
+		if (type === 'public')
+			return (readPkcs8DSAPublic(der));
+		else
+			return (readPkcs8DSAPrivate(der));
+	case '1.2.840.10045.2.1':
+		if (type === 'public')
+			return (readPkcs8ECDSAPublic(der));
+		else
+			return (readPkcs8ECDSAPrivate(der));
+	case '1.3.101.112':
+		if (type === 'public') {
+			return (readPkcs8EdDSAPublic(der));
+		} else {
+			return (readPkcs8EdDSAPrivate(der));
+		}
+	case '1.3.101.110':
+		if (type === 'public') {
+			return (readPkcs8X25519Public(der));
+		} else {
+			return (readPkcs8X25519Private(der));
+		}
+	default:
+		throw (new Error('Unknown key type OID ' + oid));
+	}
+}
+
+function readPkcs8RSAPublic(der) {
+	// bit string sequence
+	der.readSequence(asn1.Ber.BitString);
+	der.readByte();
+	der.readSequence();
+
+	// modulus
+	var n = readMPInt(der, 'modulus');
+	var e = readMPInt(der, 'exponent');
+
+	// now, make the key
+	var key = {
+		type: 'rsa',
+		source: der.originalInput,
+		parts: [
+			{ name: 'e', data: e },
+			{ name: 'n', data: n }
+		]
+	};
+
+	return (new Key(key));
+}
+
+function readPkcs8RSAPrivate(der) {
+	der.readSequence(asn1.Ber.OctetString);
+	der.readSequence();
+
+	var ver = readMPInt(der, 'version');
+	assert.equal(ver[0], 0x0, 'unknown RSA private key version');
+
+	// modulus then public exponent
+	var n = readMPInt(der, 'modulus');
+	var e = readMPInt(der, 'public exponent');
+	var d = readMPInt(der, 'private exponent');
+	var p = readMPInt(der, 'prime1');
+	var q = readMPInt(der, 'prime2');
+	var dmodp = readMPInt(der, 'exponent1');
+	var dmodq = readMPInt(der, 'exponent2');
+	var iqmp = readMPInt(der, 'iqmp');
+
+	// now, make the key
+	var key = {
+		type: 'rsa',
+		parts: [
+			{ name: 'n', data: n },
+			{ name: 'e', data: e },
+			{ name: 'd', data: d },
+			{ name: 'iqmp', data: iqmp },
+			{ name: 'p', data: p },
+			{ name: 'q', data: q },
+			{ name: 'dmodp', data: dmodp },
+			{ name: 'dmodq', data: dmodq }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function readPkcs8DSAPublic(der) {
+	der.readSequence();
+
+	var p = readMPInt(der, 'p');
+	var q = readMPInt(der, 'q');
+	var g = readMPInt(der, 'g');
+
+	// bit string sequence
+	der.readSequence(asn1.Ber.BitString);
+	der.readByte();
+
+	var y = readMPInt(der, 'y');
+
+	// now, make the key
+	var key = {
+		type: 'dsa',
+		parts: [
+			{ name: 'p', data: p },
+			{ name: 'q', data: q },
+			{ name: 'g', data: g },
+			{ name: 'y', data: y }
+		]
+	};
+
+	return (new Key(key));
+}
+
+function readPkcs8DSAPrivate(der) {
+	der.readSequence();
+
+	var p = readMPInt(der, 'p');
+	var q = readMPInt(der, 'q');
+	var g = readMPInt(der, 'g');
+
+	der.readSequence(asn1.Ber.OctetString);
+	var x = readMPInt(der, 'x');
+
+	/* The pkcs#8 format does not include the public key */
+	var y = utils.calculateDSAPublic(g, p, x);
+
+	var key = {
+		type: 'dsa',
+		parts: [
+			{ name: 'p', data: p },
+			{ name: 'q', data: q },
+			{ name: 'g', data: g },
+			{ name: 'y', data: y },
+			{ name: 'x', data: x }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function readECDSACurve(der) {
+	var curveName, curveNames;
+	var j, c, cd;
+
+	if (der.peek() === asn1.Ber.OID) {
+		var oid = der.readOID();
+
+		curveNames = Object.keys(algs.curves);
+		for (j = 0; j < curveNames.length; ++j) {
+			c = curveNames[j];
+			cd = algs.curves[c];
+			if (cd.pkcs8oid === oid) {
+				curveName = c;
+				break;
+			}
+		}
+
+	} else {
+		// ECParameters sequence
+		der.readSequence();
+		var version = der.readString(asn1.Ber.Integer, true);
+		assert.strictEqual(version[0], 1, 'ECDSA key not version 1');
+
+		var curve = {};
+
+		// FieldID sequence
+		der.readSequence();
+		var fieldTypeOid = der.readOID();
+		assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1',
+		    'ECDSA key is not from a prime-field');
+		var p = curve.p = utils.mpNormalize(
+		    der.readString(asn1.Ber.Integer, true));
+		/*
+		 * p always starts with a 1 bit, so count the zeros to get its
+		 * real size.
+		 */
+		curve.size = p.length * 8 - utils.countZeros(p);
+
+		// Curve sequence
+		der.readSequence();
+		curve.a = utils.mpNormalize(
+		    der.readString(asn1.Ber.OctetString, true));
+		curve.b = utils.mpNormalize(
+		    der.readString(asn1.Ber.OctetString, true));
+		if (der.peek() === asn1.Ber.BitString)
+			curve.s = der.readString(asn1.Ber.BitString, true);
+
+		// Combined Gx and Gy
+		curve.G = der.readString(asn1.Ber.OctetString, true);
+		assert.strictEqual(curve.G[0], 0x4,
+		    'uncompressed G is required');
+
+		curve.n = utils.mpNormalize(
+		    der.readString(asn1.Ber.Integer, true));
+		curve.h = utils.mpNormalize(
+		    der.readString(asn1.Ber.Integer, true));
+		assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' +
+		    'required');
+
+		curveNames = Object.keys(algs.curves);
+		var ks = Object.keys(curve);
+		for (j = 0; j < curveNames.length; ++j) {
+			c = curveNames[j];
+			cd = algs.curves[c];
+			var equal = true;
+			for (var i = 0; i < ks.length; ++i) {
+				var k = ks[i];
+				if (cd[k] === undefined)
+					continue;
+				if (typeof (cd[k]) === 'object' &&
+				    cd[k].equals !== undefined) {
+					if (!cd[k].equals(curve[k])) {
+						equal = false;
+						break;
+					}
+				} else if (Buffer.isBuffer(cd[k])) {
+					if (cd[k].toString('binary')
+					    !== curve[k].toString('binary')) {
+						equal = false;
+						break;
+					}
+				} else {
+					if (cd[k] !== curve[k]) {
+						equal = false;
+						break;
+					}
+				}
+			}
+			if (equal) {
+				curveName = c;
+				break;
+			}
+		}
+	}
+	return (curveName);
+}
+
+function readPkcs8ECDSAPrivate(der) {
+	var curveName = readECDSACurve(der);
+	assert.string(curveName, 'a known elliptic curve');
+
+	der.readSequence(asn1.Ber.OctetString);
+	der.readSequence();
+
+	var version = readMPInt(der, 'version');
+	assert.equal(version[0], 1, 'unknown version of ECDSA key');
+
+	var d = der.readString(asn1.Ber.OctetString, true);
+	var Q;
+
+	if (der.peek() == 0xa0) {
+		der.readSequence(0xa0);
+		der._offset += der.length;
+	}
+	if (der.peek() == 0xa1) {
+		der.readSequence(0xa1);
+		Q = der.readString(asn1.Ber.BitString, true);
+		Q = utils.ecNormalize(Q);
+	}
+
+	if (Q === undefined) {
+		var pub = utils.publicFromPrivateECDSA(curveName, d);
+		Q = pub.part.Q.data;
+	}
+
+	var key = {
+		type: 'ecdsa',
+		parts: [
+			{ name: 'curve', data: Buffer.from(curveName) },
+			{ name: 'Q', data: Q },
+			{ name: 'd', data: d }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function readPkcs8ECDSAPublic(der) {
+	var curveName = readECDSACurve(der);
+	assert.string(curveName, 'a known elliptic curve');
+
+	var Q = der.readString(asn1.Ber.BitString, true);
+	Q = utils.ecNormalize(Q);
+
+	var key = {
+		type: 'ecdsa',
+		parts: [
+			{ name: 'curve', data: Buffer.from(curveName) },
+			{ name: 'Q', data: Q }
+		]
+	};
+
+	return (new Key(key));
+}
+
+function readPkcs8EdDSAPublic(der) {
+	if (der.peek() === 0x00)
+		der.readByte();
+
+	var A = utils.readBitString(der);
+
+	var key = {
+		type: 'ed25519',
+		parts: [
+			{ name: 'A', data: utils.zeroPadToLength(A, 32) }
+		]
+	};
+
+	return (new Key(key));
+}
+
+function readPkcs8X25519Public(der) {
+	var A = utils.readBitString(der);
+
+	var key = {
+		type: 'curve25519',
+		parts: [
+			{ name: 'A', data: utils.zeroPadToLength(A, 32) }
+		]
+	};
+
+	return (new Key(key));
+}
+
+function readPkcs8EdDSAPrivate(der) {
+	if (der.peek() === 0x00)
+		der.readByte();
+
+	der.readSequence(asn1.Ber.OctetString);
+	var k = der.readString(asn1.Ber.OctetString, true);
+	k = utils.zeroPadToLength(k, 32);
+
+	var A;
+	if (der.peek() === asn1.Ber.BitString) {
+		A = utils.readBitString(der);
+		A = utils.zeroPadToLength(A, 32);
+	} else {
+		A = utils.calculateED25519Public(k);
+	}
+
+	var key = {
+		type: 'ed25519',
+		parts: [
+			{ name: 'A', data: utils.zeroPadToLength(A, 32) },
+			{ name: 'k', data: utils.zeroPadToLength(k, 32) }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function readPkcs8X25519Private(der) {
+	if (der.peek() === 0x00)
+		der.readByte();
+
+	der.readSequence(asn1.Ber.OctetString);
+	var k = der.readString(asn1.Ber.OctetString, true);
+	k = utils.zeroPadToLength(k, 32);
+
+	var A = utils.calculateX25519Public(k);
+
+	var key = {
+		type: 'curve25519',
+		parts: [
+			{ name: 'A', data: utils.zeroPadToLength(A, 32) },
+			{ name: 'k', data: utils.zeroPadToLength(k, 32) }
+		]
+	};
+
+	return (new PrivateKey(key));
+}
+
+function pkcs8ToBuffer(key) {
+	var der = new asn1.BerWriter();
+	writePkcs8(der, key);
+	return (der.buffer);
+}
+
+function writePkcs8(der, key) {
+	der.startSequence();
+
+	if (PrivateKey.isPrivateKey(key)) {
+		var sillyInt = Buffer.from([0]);
+		der.writeBuffer(sillyInt, asn1.Ber.Integer);
+	}
+
+	der.startSequence();
+	switch (key.type) {
+	case 'rsa':
+		der.writeOID('1.2.840.113549.1.1.1');
+		if (PrivateKey.isPrivateKey(key))
+			writePkcs8RSAPrivate(key, der);
+		else
+			writePkcs8RSAPublic(key, der);
+		break;
+	case 'dsa':
+		der.writeOID('1.2.840.10040.4.1');
+		if (PrivateKey.isPrivateKey(key))
+			writePkcs8DSAPrivate(key, der);
+		else
+			writePkcs8DSAPublic(key, der);
+		break;
+	case 'ecdsa':
+		der.writeOID('1.2.840.10045.2.1');
+		if (PrivateKey.isPrivateKey(key))
+			writePkcs8ECDSAPrivate(key, der);
+		else
+			writePkcs8ECDSAPublic(key, der);
+		break;
+	case 'ed25519':
+		der.writeOID('1.3.101.112');
+		if (PrivateKey.isPrivateKey(key))
+			throw (new Error('Ed25519 private keys in pkcs8 ' +
+			    'format are not supported'));
+		writePkcs8EdDSAPublic(key, der);
+		break;
+	default:
+		throw (new Error('Unsupported key type: ' + key.type));
+	}
+
+	der.endSequence();
+}
+
+function writePkcs8RSAPrivate(key, der) {
+	der.writeNull();
+	der.endSequence();
+
+	der.startSequence(asn1.Ber.OctetString);
+	der.startSequence();
+
+	var version = Buffer.from([0]);
+	der.writeBuffer(version, asn1.Ber.Integer);
+
+	der.writeBuffer(key.part.n.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.e.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.d.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.p.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.q.data, asn1.Ber.Integer);
+	if (!key.part.dmodp || !key.part.dmodq)
+		utils.addRSAMissing(key);
+	der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer);
+
+	der.endSequence();
+	der.endSequence();
+}
+
+function writePkcs8RSAPublic(key, der) {
+	der.writeNull();
+	der.endSequence();
+
+	der.startSequence(asn1.Ber.BitString);
+	der.writeByte(0x00);
+
+	der.startSequence();
+	der.writeBuffer(key.part.n.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.e.data, asn1.Ber.Integer);
+	der.endSequence();
+
+	der.endSequence();
+}
+
+function writePkcs8DSAPrivate(key, der) {
+	der.startSequence();
+	der.writeBuffer(key.part.p.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.q.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.g.data, asn1.Ber.Integer);
+	der.endSequence();
+
+	der.endSequence();
+
+	der.startSequence(asn1.Ber.OctetString);
+	der.writeBuffer(key.part.x.data, asn1.Ber.Integer);
+	der.endSequence();
+}
+
+function writePkcs8DSAPublic(key, der) {
+	der.startSequence();
+	der.writeBuffer(key.part.p.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.q.data, asn1.Ber.Integer);
+	der.writeBuffer(key.part.g.data, asn1.Ber.Integer);
+	der.endSequence();
+	der.endSequence();
+
+	der.startSequence(asn1.Ber.BitString);
+	der.writeByte(0x00);
+	der.writeBuffer(key.part.y.data, asn1.Ber.Integer);
+	der.endSequence();
+}
+
+function writeECDSACurve(key, der) {
+	var curve = algs.curves[key.curve];
+	if (curve.pkcs8oid) {
+		/* This one has a name in pkcs#8, so just write the oid */
+		der.writeOID(curve.pkcs8oid);
+
+	} else {
+		// ECParameters sequence
+		der.startSequence();
+
+		var version = Buffer.from([1]);
+		der.writeBuffer(version, asn1.Ber.Integer);
+
+		// FieldID sequence
+		der.startSequence();
+		der.writeOID('1.2.840.10045.1.1'); // prime-field
+		der.writeBuffer(curve.p, asn1.Ber.Integer);
+		der.endSequence();
+
+		// Curve sequence
+		der.startSequence();
+		var a = curve.p;
+		if (a[0] === 0x0)
+			a = a.slice(1);
+		der.writeBuffer(a, asn1.Ber.OctetString);
+		der.writeBuffer(curve.b, asn1.Ber.OctetString);
+		der.writeBuffer(curve.s, asn1.Ber.BitString);
+		der.endSequence();
+
+		der.writeBuffer(curve.G, asn1.Ber.OctetString);
+		der.writeBuffer(curve.n, asn1.Ber.Integer);
+		var h = curve.h;
+		if (!h) {
+			h = Buffer.from([1]);
+		}
+		der.writeBuffer(h, asn1.Ber.Integer);
+
+		// ECParameters
+		der.endSequence();
+	}
+}
+
+function writePkcs8ECDSAPublic(key, der) {
+	writeECDSACurve(key, der);
+	der.endSequence();
+
+	var Q = utils.ecNormalize(key.part.Q.data, true);
+	der.writeBuffer(Q, asn1.Ber.BitString);
+}
+
+function writePkcs8ECDSAPrivate(key, der) {
+	writeECDSACurve(key, der);
+	der.endSequence();
+
+	der.startSequence(asn1.Ber.OctetString);
+	der.startSequence();
+
+	var version = Buffer.from([1]);
+	der.writeBuffer(version, asn1.Ber.Integer);
+
+	der.writeBuffer(key.part.d.data, asn1.Ber.OctetString);
+
+	der.startSequence(0xa1);
+	var Q = utils.ecNormalize(key.part.Q.data, true);
+	der.writeBuffer(Q, asn1.Ber.BitString);
+	der.endSequence();
+
+	der.endSequence();
+	der.endSequence();
+}
+
+function writePkcs8EdDSAPublic(key, der) {
+	der.endSequence();
+
+	utils.writeBitString(der, key.part.A.data);
+}
+
+function writePkcs8EdDSAPrivate(key, der) {
+	der.endSequence();
+
+	var k = utils.mpNormalize(key.part.k.data, true);
+	der.startSequence(asn1.Ber.OctetString);
+	der.writeBuffer(k, asn1.Ber.OctetString);
+	der.endSequence();
+}
diff --git a/node_modules/sshpk/lib/formats/putty.js b/node_modules/sshpk/lib/formats/putty.js
new file mode 100644
index 0000000..344419f
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/putty.js
@@ -0,0 +1,99 @@
+// Copyright 2018 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	write: write
+};
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var rfc4253 = require('./rfc4253');
+var Key = require('../key');
+
+var errors = require('../errors');
+
+function read(buf, options) {
+	var lines = buf.toString('ascii').split(/[\r\n]+/);
+	var found = false;
+	var parts;
+	var si = 0;
+	while (si < lines.length) {
+		parts = splitHeader(lines[si++]);
+		if (parts &&
+		    parts[0].toLowerCase() === 'putty-user-key-file-2') {
+			found = true;
+			break;
+		}
+	}
+	if (!found) {
+		throw (new Error('No PuTTY format first line found'));
+	}
+	var alg = parts[1];
+
+	parts = splitHeader(lines[si++]);
+	assert.equal(parts[0].toLowerCase(), 'encryption');
+
+	parts = splitHeader(lines[si++]);
+	assert.equal(parts[0].toLowerCase(), 'comment');
+	var comment = parts[1];
+
+	parts = splitHeader(lines[si++]);
+	assert.equal(parts[0].toLowerCase(), 'public-lines');
+	var publicLines = parseInt(parts[1], 10);
+	if (!isFinite(publicLines) || publicLines < 0 ||
+	    publicLines > lines.length) {
+		throw (new Error('Invalid public-lines count'));
+	}
+
+	var publicBuf = Buffer.from(
+	    lines.slice(si, si + publicLines).join(''), 'base64');
+	var keyType = rfc4253.algToKeyType(alg);
+	var key = rfc4253.read(publicBuf);
+	if (key.type !== keyType) {
+		throw (new Error('Outer key algorithm mismatch'));
+	}
+	key.comment = comment;
+	return (key);
+}
+
+function splitHeader(line) {
+	var idx = line.indexOf(':');
+	if (idx === -1)
+		return (null);
+	var header = line.slice(0, idx);
+	++idx;
+	while (line[idx] === ' ')
+		++idx;
+	var rest = line.slice(idx);
+	return ([header, rest]);
+}
+
+function write(key, options) {
+	assert.object(key);
+	if (!Key.isKey(key))
+		throw (new Error('Must be a public key'));
+
+	var alg = rfc4253.keyTypeToAlg(key);
+	var buf = rfc4253.write(key);
+	var comment = key.comment || '';
+
+	var b64 = buf.toString('base64');
+	var lines = wrap(b64, 64);
+
+	lines.unshift('Public-Lines: ' + lines.length);
+	lines.unshift('Comment: ' + comment);
+	lines.unshift('Encryption: none');
+	lines.unshift('PuTTY-User-Key-File-2: ' + alg);
+
+	return (Buffer.from(lines.join('\n') + '\n'));
+}
+
+function wrap(txt, len) {
+	var lines = [];
+	var pos = 0;
+	while (pos < txt.length) {
+		lines.push(txt.slice(pos, pos + 64));
+		pos += 64;
+	}
+	return (lines);
+}
diff --git a/node_modules/sshpk/lib/formats/rfc4253.js b/node_modules/sshpk/lib/formats/rfc4253.js
new file mode 100644
index 0000000..52fddcb
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/rfc4253.js
@@ -0,0 +1,166 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = {
+	read: read.bind(undefined, false, undefined),
+	readType: read.bind(undefined, false),
+	write: write,
+	/* semi-private api, used by sshpk-agent */
+	readPartial: read.bind(undefined, true),
+
+	/* shared with ssh format */
+	readInternal: read,
+	keyTypeToAlg: keyTypeToAlg,
+	algToKeyType: algToKeyType
+};
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('../algs');
+var utils = require('../utils');
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+var SSHBuffer = require('../ssh-buffer');
+
+function algToKeyType(alg) {
+	assert.string(alg);
+	if (alg === 'ssh-dss')
+		return ('dsa');
+	else if (alg === 'ssh-rsa')
+		return ('rsa');
+	else if (alg === 'ssh-ed25519')
+		return ('ed25519');
+	else if (alg === 'ssh-curve25519')
+		return ('curve25519');
+	else if (alg.match(/^ecdsa-sha2-/))
+		return ('ecdsa');
+	else
+		throw (new Error('Unknown algorithm ' + alg));
+}
+
+function keyTypeToAlg(key) {
+	assert.object(key);
+	if (key.type === 'dsa')
+		return ('ssh-dss');
+	else if (key.type === 'rsa')
+		return ('ssh-rsa');
+	else if (key.type === 'ed25519')
+		return ('ssh-ed25519');
+	else if (key.type === 'curve25519')
+		return ('ssh-curve25519');
+	else if (key.type === 'ecdsa')
+		return ('ecdsa-sha2-' + key.part.curve.data.toString());
+	else
+		throw (new Error('Unknown key type ' + key.type));
+}
+
+function read(partial, type, buf, options) {
+	if (typeof (buf) === 'string')
+		buf = Buffer.from(buf);
+	assert.buffer(buf, 'buf');
+
+	var key = {};
+
+	var parts = key.parts = [];
+	var sshbuf = new SSHBuffer({buffer: buf});
+
+	var alg = sshbuf.readString();
+	assert.ok(!sshbuf.atEnd(), 'key must have at least one part');
+
+	key.type = algToKeyType(alg);
+
+	var partCount = algs.info[key.type].parts.length;
+	if (type && type === 'private')
+		partCount = algs.privInfo[key.type].parts.length;
+
+	while (!sshbuf.atEnd() && parts.length < partCount)
+		parts.push(sshbuf.readPart());
+	while (!partial && !sshbuf.atEnd())
+		parts.push(sshbuf.readPart());
+
+	assert.ok(parts.length >= 1,
+	    'key must have at least one part');
+	assert.ok(partial || sshbuf.atEnd(),
+	    'leftover bytes at end of key');
+
+	var Constructor = Key;
+	var algInfo = algs.info[key.type];
+	if (type === 'private' || algInfo.parts.length !== parts.length) {
+		algInfo = algs.privInfo[key.type];
+		Constructor = PrivateKey;
+	}
+	assert.strictEqual(algInfo.parts.length, parts.length);
+
+	if (key.type === 'ecdsa') {
+		var res = /^ecdsa-sha2-(.+)$/.exec(alg);
+		assert.ok(res !== null);
+		assert.strictEqual(res[1], parts[0].data.toString());
+	}
+
+	var normalized = true;
+	for (var i = 0; i < algInfo.parts.length; ++i) {
+		var p = parts[i];
+		p.name = algInfo.parts[i];
+		/*
+		 * OpenSSH stores ed25519 "private" keys as seed + public key
+		 * concat'd together (k followed by A). We want to keep them
+		 * separate for other formats that don't do this.
+		 */
+		if (key.type === 'ed25519' && p.name === 'k')
+			p.data = p.data.slice(0, 32);
+
+		if (p.name !== 'curve' && algInfo.normalize !== false) {
+			var nd;
+			if (key.type === 'ed25519') {
+				nd = utils.zeroPadToLength(p.data, 32);
+			} else {
+				nd = utils.mpNormalize(p.data);
+			}
+			if (nd.toString('binary') !==
+			    p.data.toString('binary')) {
+				p.data = nd;
+				normalized = false;
+			}
+		}
+	}
+
+	if (normalized)
+		key._rfc4253Cache = sshbuf.toBuffer();
+
+	if (partial && typeof (partial) === 'object') {
+		partial.remainder = sshbuf.remainder();
+		partial.consumed = sshbuf._offset;
+	}
+
+	return (new Constructor(key));
+}
+
+function write(key, options) {
+	assert.object(key);
+
+	var alg = keyTypeToAlg(key);
+	var i;
+
+	var algInfo = algs.info[key.type];
+	if (PrivateKey.isPrivateKey(key))
+		algInfo = algs.privInfo[key.type];
+	var parts = algInfo.parts;
+
+	var buf = new SSHBuffer({});
+
+	buf.writeString(alg);
+
+	for (i = 0; i < parts.length; ++i) {
+		var data = key.part[parts[i]].data;
+		if (algInfo.normalize !== false) {
+			if (key.type === 'ed25519')
+				data = utils.zeroPadToLength(data, 32);
+			else
+				data = utils.mpNormalize(data);
+		}
+		if (key.type === 'ed25519' && parts[i] === 'k')
+			data = Buffer.concat([data, key.part.A.data]);
+		buf.writeBuffer(data);
+	}
+
+	return (buf.toBuffer());
+}
diff --git a/node_modules/sshpk/lib/formats/ssh-private.js b/node_modules/sshpk/lib/formats/ssh-private.js
new file mode 100644
index 0000000..5e7eed8
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/ssh-private.js
@@ -0,0 +1,262 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	readSSHPrivate: readSSHPrivate,
+	write: write
+};
+
+var assert = require('assert-plus');
+var asn1 = require('asn1');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('../algs');
+var utils = require('../utils');
+var crypto = require('crypto');
+
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+var pem = require('./pem');
+var rfc4253 = require('./rfc4253');
+var SSHBuffer = require('../ssh-buffer');
+var errors = require('../errors');
+
+var bcrypt;
+
+function read(buf, options) {
+	return (pem.read(buf, options));
+}
+
+var MAGIC = 'openssh-key-v1';
+
+function readSSHPrivate(type, buf, options) {
+	buf = new SSHBuffer({buffer: buf});
+
+	var magic = buf.readCString();
+	assert.strictEqual(magic, MAGIC, 'bad magic string');
+
+	var cipher = buf.readString();
+	var kdf = buf.readString();
+	var kdfOpts = buf.readBuffer();
+
+	var nkeys = buf.readInt();
+	if (nkeys !== 1) {
+		throw (new Error('OpenSSH-format key file contains ' +
+		    'multiple keys: this is unsupported.'));
+	}
+
+	var pubKey = buf.readBuffer();
+
+	if (type === 'public') {
+		assert.ok(buf.atEnd(), 'excess bytes left after key');
+		return (rfc4253.read(pubKey));
+	}
+
+	var privKeyBlob = buf.readBuffer();
+	assert.ok(buf.atEnd(), 'excess bytes left after key');
+
+	var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts });
+	switch (kdf) {
+	case 'none':
+		if (cipher !== 'none') {
+			throw (new Error('OpenSSH-format key uses KDF "none" ' +
+			     'but specifies a cipher other than "none"'));
+		}
+		break;
+	case 'bcrypt':
+		var salt = kdfOptsBuf.readBuffer();
+		var rounds = kdfOptsBuf.readInt();
+		var cinf = utils.opensshCipherInfo(cipher);
+		if (bcrypt === undefined) {
+			bcrypt = require('bcrypt-pbkdf');
+		}
+
+		if (typeof (options.passphrase) === 'string') {
+			options.passphrase = Buffer.from(options.passphrase,
+			    'utf-8');
+		}
+		if (!Buffer.isBuffer(options.passphrase)) {
+			throw (new errors.KeyEncryptedError(
+			    options.filename, 'OpenSSH'));
+		}
+
+		var pass = new Uint8Array(options.passphrase);
+		var salti = new Uint8Array(salt);
+		/* Use the pbkdf to derive both the key and the IV. */
+		var out = new Uint8Array(cinf.keySize + cinf.blockSize);
+		var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length,
+		    out, out.length, rounds);
+		if (res !== 0) {
+			throw (new Error('bcrypt_pbkdf function returned ' +
+			    'failure, parameters invalid'));
+		}
+		out = Buffer.from(out);
+		var ckey = out.slice(0, cinf.keySize);
+		var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize);
+		var cipherStream = crypto.createDecipheriv(cinf.opensslName,
+		    ckey, iv);
+		cipherStream.setAutoPadding(false);
+		var chunk, chunks = [];
+		cipherStream.once('error', function (e) {
+			if (e.toString().indexOf('bad decrypt') !== -1) {
+				throw (new Error('Incorrect passphrase ' +
+				    'supplied, could not decrypt key'));
+			}
+			throw (e);
+		});
+		cipherStream.write(privKeyBlob);
+		cipherStream.end();
+		while ((chunk = cipherStream.read()) !== null)
+			chunks.push(chunk);
+		privKeyBlob = Buffer.concat(chunks);
+		break;
+	default:
+		throw (new Error(
+		    'OpenSSH-format key uses unknown KDF "' + kdf + '"'));
+	}
+
+	buf = new SSHBuffer({buffer: privKeyBlob});
+
+	var checkInt1 = buf.readInt();
+	var checkInt2 = buf.readInt();
+	if (checkInt1 !== checkInt2) {
+		throw (new Error('Incorrect passphrase supplied, could not ' +
+		    'decrypt key'));
+	}
+
+	var ret = {};
+	var key = rfc4253.readInternal(ret, 'private', buf.remainder());
+
+	buf.skip(ret.consumed);
+
+	var comment = buf.readString();
+	key.comment = comment;
+
+	return (key);
+}
+
+function write(key, options) {
+	var pubKey;
+	if (PrivateKey.isPrivateKey(key))
+		pubKey = key.toPublic();
+	else
+		pubKey = key;
+
+	var cipher = 'none';
+	var kdf = 'none';
+	var kdfopts = Buffer.alloc(0);
+	var cinf = { blockSize: 8 };
+	var passphrase;
+	if (options !== undefined) {
+		passphrase = options.passphrase;
+		if (typeof (passphrase) === 'string')
+			passphrase = Buffer.from(passphrase, 'utf-8');
+		if (passphrase !== undefined) {
+			assert.buffer(passphrase, 'options.passphrase');
+			assert.optionalString(options.cipher, 'options.cipher');
+			cipher = options.cipher;
+			if (cipher === undefined)
+				cipher = 'aes128-ctr';
+			cinf = utils.opensshCipherInfo(cipher);
+			kdf = 'bcrypt';
+		}
+	}
+
+	var privBuf;
+	if (PrivateKey.isPrivateKey(key)) {
+		privBuf = new SSHBuffer({});
+		var checkInt = crypto.randomBytes(4).readUInt32BE(0);
+		privBuf.writeInt(checkInt);
+		privBuf.writeInt(checkInt);
+		privBuf.write(key.toBuffer('rfc4253'));
+		privBuf.writeString(key.comment || '');
+
+		var n = 1;
+		while (privBuf._offset % cinf.blockSize !== 0)
+			privBuf.writeChar(n++);
+		privBuf = privBuf.toBuffer();
+	}
+
+	switch (kdf) {
+	case 'none':
+		break;
+	case 'bcrypt':
+		var salt = crypto.randomBytes(16);
+		var rounds = 16;
+		var kdfssh = new SSHBuffer({});
+		kdfssh.writeBuffer(salt);
+		kdfssh.writeInt(rounds);
+		kdfopts = kdfssh.toBuffer();
+
+		if (bcrypt === undefined) {
+			bcrypt = require('bcrypt-pbkdf');
+		}
+		var pass = new Uint8Array(passphrase);
+		var salti = new Uint8Array(salt);
+		/* Use the pbkdf to derive both the key and the IV. */
+		var out = new Uint8Array(cinf.keySize + cinf.blockSize);
+		var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length,
+		    out, out.length, rounds);
+		if (res !== 0) {
+			throw (new Error('bcrypt_pbkdf function returned ' +
+			    'failure, parameters invalid'));
+		}
+		out = Buffer.from(out);
+		var ckey = out.slice(0, cinf.keySize);
+		var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize);
+
+		var cipherStream = crypto.createCipheriv(cinf.opensslName,
+		    ckey, iv);
+		cipherStream.setAutoPadding(false);
+		var chunk, chunks = [];
+		cipherStream.once('error', function (e) {
+			throw (e);
+		});
+		cipherStream.write(privBuf);
+		cipherStream.end();
+		while ((chunk = cipherStream.read()) !== null)
+			chunks.push(chunk);
+		privBuf = Buffer.concat(chunks);
+		break;
+	default:
+		throw (new Error('Unsupported kdf ' + kdf));
+	}
+
+	var buf = new SSHBuffer({});
+
+	buf.writeCString(MAGIC);
+	buf.writeString(cipher);	/* cipher */
+	buf.writeString(kdf);		/* kdf */
+	buf.writeBuffer(kdfopts);	/* kdfoptions */
+
+	buf.writeInt(1);		/* nkeys */
+	buf.writeBuffer(pubKey.toBuffer('rfc4253'));
+
+	if (privBuf)
+		buf.writeBuffer(privBuf);
+
+	buf = buf.toBuffer();
+
+	var header;
+	if (PrivateKey.isPrivateKey(key))
+		header = 'OPENSSH PRIVATE KEY';
+	else
+		header = 'OPENSSH PUBLIC KEY';
+
+	var tmp = buf.toString('base64');
+	var len = tmp.length + (tmp.length / 70) +
+	    18 + 16 + header.length*2 + 10;
+	buf = Buffer.alloc(len);
+	var o = 0;
+	o += buf.write('-----BEGIN ' + header + '-----\n', o);
+	for (var i = 0; i < tmp.length; ) {
+		var limit = i + 70;
+		if (limit > tmp.length)
+			limit = tmp.length;
+		o += buf.write(tmp.slice(i, limit), o);
+		buf[o++] = 10;
+		i = limit;
+	}
+	o += buf.write('-----END ' + header + '-----\n', o);
+
+	return (buf.slice(0, o));
+}
diff --git a/node_modules/sshpk/lib/formats/ssh.js b/node_modules/sshpk/lib/formats/ssh.js
new file mode 100644
index 0000000..c8e9c93
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/ssh.js
@@ -0,0 +1,115 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	write: write
+};
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var rfc4253 = require('./rfc4253');
+var utils = require('../utils');
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+
+var sshpriv = require('./ssh-private');
+
+/*JSSTYLED*/
+var SSHKEY_RE = /^([a-z0-9-]+)[ \t]+([a-zA-Z0-9+\/]+[=]*)([ \t]+([^ \t][^\n]*[\n]*)?)?$/;
+/*JSSTYLED*/
+var SSHKEY_RE2 = /^([a-z0-9-]+)[ \t\n]+([a-zA-Z0-9+\/][a-zA-Z0-9+\/ \t\n=]*)([^a-zA-Z0-9+\/ \t\n=].*)?$/;
+
+function read(buf, options) {
+	if (typeof (buf) !== 'string') {
+		assert.buffer(buf, 'buf');
+		buf = buf.toString('ascii');
+	}
+
+	var trimmed = buf.trim().replace(/[\\\r]/g, '');
+	var m = trimmed.match(SSHKEY_RE);
+	if (!m)
+		m = trimmed.match(SSHKEY_RE2);
+	assert.ok(m, 'key must match regex');
+
+	var type = rfc4253.algToKeyType(m[1]);
+	var kbuf = Buffer.from(m[2], 'base64');
+
+	/*
+	 * This is a bit tricky. If we managed to parse the key and locate the
+	 * key comment with the regex, then do a non-partial read and assert
+	 * that we have consumed all bytes. If we couldn't locate the key
+	 * comment, though, there may be whitespace shenanigans going on that
+	 * have conjoined the comment to the rest of the key. We do a partial
+	 * read in this case to try to make the best out of a sorry situation.
+	 */
+	var key;
+	var ret = {};
+	if (m[4]) {
+		try {
+			key = rfc4253.read(kbuf);
+
+		} catch (e) {
+			m = trimmed.match(SSHKEY_RE2);
+			assert.ok(m, 'key must match regex');
+			kbuf = Buffer.from(m[2], 'base64');
+			key = rfc4253.readInternal(ret, 'public', kbuf);
+		}
+	} else {
+		key = rfc4253.readInternal(ret, 'public', kbuf);
+	}
+
+	assert.strictEqual(type, key.type);
+
+	if (m[4] && m[4].length > 0) {
+		key.comment = m[4];
+
+	} else if (ret.consumed) {
+		/*
+		 * Now the magic: trying to recover the key comment when it's
+		 * gotten conjoined to the key or otherwise shenanigan'd.
+		 *
+		 * Work out how much base64 we used, then drop all non-base64
+		 * chars from the beginning up to this point in the the string.
+		 * Then offset in this and try to make up for missing = chars.
+		 */
+		var data = m[2] + (m[3] ? m[3] : '');
+		var realOffset = Math.ceil(ret.consumed / 3) * 4;
+		data = data.slice(0, realOffset - 2). /*JSSTYLED*/
+		    replace(/[^a-zA-Z0-9+\/=]/g, '') +
+		    data.slice(realOffset - 2);
+
+		var padding = ret.consumed % 3;
+		if (padding > 0 &&
+		    data.slice(realOffset - 1, realOffset) !== '=')
+			realOffset--;
+		while (data.slice(realOffset, realOffset + 1) === '=')
+			realOffset++;
+
+		/* Finally, grab what we think is the comment & clean it up. */
+		var trailer = data.slice(realOffset);
+		trailer = trailer.replace(/[\r\n]/g, ' ').
+		    replace(/^\s+/, '');
+		if (trailer.match(/^[a-zA-Z0-9]/))
+			key.comment = trailer;
+	}
+
+	return (key);
+}
+
+function write(key, options) {
+	assert.object(key);
+	if (!Key.isKey(key))
+		throw (new Error('Must be a public key'));
+
+	var parts = [];
+	var alg = rfc4253.keyTypeToAlg(key);
+	parts.push(alg);
+
+	var buf = rfc4253.write(key);
+	parts.push(buf.toString('base64'));
+
+	if (key.comment)
+		parts.push(key.comment);
+
+	return (Buffer.from(parts.join(' ')));
+}
diff --git a/node_modules/sshpk/lib/formats/x509-pem.js b/node_modules/sshpk/lib/formats/x509-pem.js
new file mode 100644
index 0000000..3155ef0
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/x509-pem.js
@@ -0,0 +1,88 @@
+// Copyright 2016 Joyent, Inc.
+
+var x509 = require('./x509');
+
+module.exports = {
+	read: read,
+	verify: x509.verify,
+	sign: x509.sign,
+	write: write
+};
+
+var assert = require('assert-plus');
+var asn1 = require('asn1');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('../algs');
+var utils = require('../utils');
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+var pem = require('./pem');
+var Identity = require('../identity');
+var Signature = require('../signature');
+var Certificate = require('../certificate');
+
+function read(buf, options) {
+	if (typeof (buf) !== 'string') {
+		assert.buffer(buf, 'buf');
+		buf = buf.toString('ascii');
+	}
+
+	var lines = buf.trim().split(/[\r\n]+/g);
+
+	var m;
+	var si = -1;
+	while (!m && si < lines.length) {
+		m = lines[++si].match(/*JSSTYLED*/
+		    /[-]+[ ]*BEGIN CERTIFICATE[ ]*[-]+/);
+	}
+	assert.ok(m, 'invalid PEM header');
+
+	var m2;
+	var ei = lines.length;
+	while (!m2 && ei > 0) {
+		m2 = lines[--ei].match(/*JSSTYLED*/
+		    /[-]+[ ]*END CERTIFICATE[ ]*[-]+/);
+	}
+	assert.ok(m2, 'invalid PEM footer');
+
+	lines = lines.slice(si, ei + 1);
+
+	var headers = {};
+	while (true) {
+		lines = lines.slice(1);
+		m = lines[0].match(/*JSSTYLED*/
+		    /^([A-Za-z0-9-]+): (.+)$/);
+		if (!m)
+			break;
+		headers[m[1].toLowerCase()] = m[2];
+	}
+
+	/* Chop off the first and last lines */
+	lines = lines.slice(0, -1).join('');
+	buf = Buffer.from(lines, 'base64');
+
+	return (x509.read(buf, options));
+}
+
+function write(cert, options) {
+	var dbuf = x509.write(cert, options);
+
+	var header = 'CERTIFICATE';
+	var tmp = dbuf.toString('base64');
+	var len = tmp.length + (tmp.length / 64) +
+	    18 + 16 + header.length*2 + 10;
+	var buf = Buffer.alloc(len);
+	var o = 0;
+	o += buf.write('-----BEGIN ' + header + '-----\n', o);
+	for (var i = 0; i < tmp.length; ) {
+		var limit = i + 64;
+		if (limit > tmp.length)
+			limit = tmp.length;
+		o += buf.write(tmp.slice(i, limit), o);
+		buf[o++] = 10;
+		i = limit;
+	}
+	o += buf.write('-----END ' + header + '-----\n', o);
+
+	return (buf.slice(0, o));
+}
diff --git a/node_modules/sshpk/lib/formats/x509.js b/node_modules/sshpk/lib/formats/x509.js
new file mode 100644
index 0000000..0144c44
--- /dev/null
+++ b/node_modules/sshpk/lib/formats/x509.js
@@ -0,0 +1,752 @@
+// Copyright 2017 Joyent, Inc.
+
+module.exports = {
+	read: read,
+	verify: verify,
+	sign: sign,
+	signAsync: signAsync,
+	write: write
+};
+
+var assert = require('assert-plus');
+var asn1 = require('asn1');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('../algs');
+var utils = require('../utils');
+var Key = require('../key');
+var PrivateKey = require('../private-key');
+var pem = require('./pem');
+var Identity = require('../identity');
+var Signature = require('../signature');
+var Certificate = require('../certificate');
+var pkcs8 = require('./pkcs8');
+
+/*
+ * This file is based on RFC5280 (X.509).
+ */
+
+/* Helper to read in a single mpint */
+function readMPInt(der, nm) {
+	assert.strictEqual(der.peek(), asn1.Ber.Integer,
+	    nm + ' is not an Integer');
+	return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true)));
+}
+
+function verify(cert, key) {
+	var sig = cert.signatures.x509;
+	assert.object(sig, 'x509 signature');
+
+	var algParts = sig.algo.split('-');
+	if (algParts[0] !== key.type)
+		return (false);
+
+	var blob = sig.cache;
+	if (blob === undefined) {
+		var der = new asn1.BerWriter();
+		writeTBSCert(cert, der);
+		blob = der.buffer;
+	}
+
+	var verifier = key.createVerify(algParts[1]);
+	verifier.write(blob);
+	return (verifier.verify(sig.signature));
+}
+
+function Local(i) {
+	return (asn1.Ber.Context | asn1.Ber.Constructor | i);
+}
+
+function Context(i) {
+	return (asn1.Ber.Context | i);
+}
+
+var SIGN_ALGS = {
+	'rsa-md5': '1.2.840.113549.1.1.4',
+	'rsa-sha1': '1.2.840.113549.1.1.5',
+	'rsa-sha256': '1.2.840.113549.1.1.11',
+	'rsa-sha384': '1.2.840.113549.1.1.12',
+	'rsa-sha512': '1.2.840.113549.1.1.13',
+	'dsa-sha1': '1.2.840.10040.4.3',
+	'dsa-sha256': '2.16.840.1.101.3.4.3.2',
+	'ecdsa-sha1': '1.2.840.10045.4.1',
+	'ecdsa-sha256': '1.2.840.10045.4.3.2',
+	'ecdsa-sha384': '1.2.840.10045.4.3.3',
+	'ecdsa-sha512': '1.2.840.10045.4.3.4',
+	'ed25519-sha512': '1.3.101.112'
+};
+Object.keys(SIGN_ALGS).forEach(function (k) {
+	SIGN_ALGS[SIGN_ALGS[k]] = k;
+});
+SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5';
+SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1';
+
+var EXTS = {
+	'issuerKeyId': '2.5.29.35',
+	'altName': '2.5.29.17',
+	'basicConstraints': '2.5.29.19',
+	'keyUsage': '2.5.29.15',
+	'extKeyUsage': '2.5.29.37'
+};
+
+function read(buf, options) {
+	if (typeof (buf) === 'string') {
+		buf = Buffer.from(buf, 'binary');
+	}
+	assert.buffer(buf, 'buf');
+
+	var der = new asn1.BerReader(buf);
+
+	der.readSequence();
+	if (Math.abs(der.length - der.remain) > 1) {
+		throw (new Error('DER sequence does not contain whole byte ' +
+		    'stream'));
+	}
+
+	var tbsStart = der.offset;
+	der.readSequence();
+	var sigOffset = der.offset + der.length;
+	var tbsEnd = sigOffset;
+
+	if (der.peek() === Local(0)) {
+		der.readSequence(Local(0));
+		var version = der.readInt();
+		assert.ok(version <= 3,
+		    'only x.509 versions up to v3 supported');
+	}
+
+	var cert = {};
+	cert.signatures = {};
+	var sig = (cert.signatures.x509 = {});
+	sig.extras = {};
+
+	cert.serial = readMPInt(der, 'serial');
+
+	der.readSequence();
+	var after = der.offset + der.length;
+	var certAlgOid = der.readOID();
+	var certAlg = SIGN_ALGS[certAlgOid];
+	if (certAlg === undefined)
+		throw (new Error('unknown signature algorithm ' + certAlgOid));
+
+	der._offset = after;
+	cert.issuer = Identity.parseAsn1(der);
+
+	der.readSequence();
+	cert.validFrom = readDate(der);
+	cert.validUntil = readDate(der);
+
+	cert.subjects = [Identity.parseAsn1(der)];
+
+	der.readSequence();
+	after = der.offset + der.length;
+	cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der);
+	der._offset = after;
+
+	/* issuerUniqueID */
+	if (der.peek() === Local(1)) {
+		der.readSequence(Local(1));
+		sig.extras.issuerUniqueID =
+		    buf.slice(der.offset, der.offset + der.length);
+		der._offset += der.length;
+	}
+
+	/* subjectUniqueID */
+	if (der.peek() === Local(2)) {
+		der.readSequence(Local(2));
+		sig.extras.subjectUniqueID =
+		    buf.slice(der.offset, der.offset + der.length);
+		der._offset += der.length;
+	}
+
+	/* extensions */
+	if (der.peek() === Local(3)) {
+		der.readSequence(Local(3));
+		var extEnd = der.offset + der.length;
+		der.readSequence();
+
+		while (der.offset < extEnd)
+			readExtension(cert, buf, der);
+
+		assert.strictEqual(der.offset, extEnd);
+	}
+
+	assert.strictEqual(der.offset, sigOffset);
+
+	der.readSequence();
+	after = der.offset + der.length;
+	var sigAlgOid = der.readOID();
+	var sigAlg = SIGN_ALGS[sigAlgOid];
+	if (sigAlg === undefined)
+		throw (new Error('unknown signature algorithm ' + sigAlgOid));
+	der._offset = after;
+
+	var sigData = der.readString(asn1.Ber.BitString, true);
+	if (sigData[0] === 0)
+		sigData = sigData.slice(1);
+	var algParts = sigAlg.split('-');
+
+	sig.signature = Signature.parse(sigData, algParts[0], 'asn1');
+	sig.signature.hashAlgorithm = algParts[1];
+	sig.algo = sigAlg;
+	sig.cache = buf.slice(tbsStart, tbsEnd);
+
+	return (new Certificate(cert));
+}
+
+function readDate(der) {
+	if (der.peek() === asn1.Ber.UTCTime) {
+		return (utcTimeToDate(der.readString(asn1.Ber.UTCTime)));
+	} else if (der.peek() === asn1.Ber.GeneralizedTime) {
+		return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime)));
+	} else {
+		throw (new Error('Unsupported date format'));
+	}
+}
+
+function writeDate(der, date) {
+	if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) {
+		der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime);
+	} else {
+		der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime);
+	}
+}
+
+/* RFC5280, section 4.2.1.6 (GeneralName type) */
+var ALTNAME = {
+	OtherName: Local(0),
+	RFC822Name: Context(1),
+	DNSName: Context(2),
+	X400Address: Local(3),
+	DirectoryName: Local(4),
+	EDIPartyName: Local(5),
+	URI: Context(6),
+	IPAddress: Context(7),
+	OID: Context(8)
+};
+
+/* RFC5280, section 4.2.1.12 (KeyPurposeId) */
+var EXTPURPOSE = {
+	'serverAuth': '1.3.6.1.5.5.7.3.1',
+	'clientAuth': '1.3.6.1.5.5.7.3.2',
+	'codeSigning': '1.3.6.1.5.5.7.3.3',
+
+	/* See https://github.com/joyent/oid-docs/blob/master/root.md */
+	'joyentDocker': '1.3.6.1.4.1.38678.1.4.1',
+	'joyentCmon': '1.3.6.1.4.1.38678.1.4.2'
+};
+var EXTPURPOSE_REV = {};
+Object.keys(EXTPURPOSE).forEach(function (k) {
+	EXTPURPOSE_REV[EXTPURPOSE[k]] = k;
+});
+
+var KEYUSEBITS = [
+	'signature', 'identity', 'keyEncryption',
+	'encryption', 'keyAgreement', 'ca', 'crl'
+];
+
+function readExtension(cert, buf, der) {
+	der.readSequence();
+	var after = der.offset + der.length;
+	var extId = der.readOID();
+	var id;
+	var sig = cert.signatures.x509;
+	if (!sig.extras.exts)
+		sig.extras.exts = [];
+
+	var critical;
+	if (der.peek() === asn1.Ber.Boolean)
+		critical = der.readBoolean();
+
+	switch (extId) {
+	case (EXTS.basicConstraints):
+		der.readSequence(asn1.Ber.OctetString);
+		der.readSequence();
+		var bcEnd = der.offset + der.length;
+		var ca = false;
+		if (der.peek() === asn1.Ber.Boolean)
+			ca = der.readBoolean();
+		if (cert.purposes === undefined)
+			cert.purposes = [];
+		if (ca === true)
+			cert.purposes.push('ca');
+		var bc = { oid: extId, critical: critical };
+		if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer)
+			bc.pathLen = der.readInt();
+		sig.extras.exts.push(bc);
+		break;
+	case (EXTS.extKeyUsage):
+		der.readSequence(asn1.Ber.OctetString);
+		der.readSequence();
+		if (cert.purposes === undefined)
+			cert.purposes = [];
+		var ekEnd = der.offset + der.length;
+		while (der.offset < ekEnd) {
+			var oid = der.readOID();
+			cert.purposes.push(EXTPURPOSE_REV[oid] || oid);
+		}
+		/*
+		 * This is a bit of a hack: in the case where we have a cert
+		 * that's only allowed to do serverAuth or clientAuth (and not
+		 * the other), we want to make sure all our Subjects are of
+		 * the right type. But we already parsed our Subjects and
+		 * decided if they were hosts or users earlier (since it appears
+		 * first in the cert).
+		 *
+		 * So we go through and mutate them into the right kind here if
+		 * it doesn't match. This might not be hugely beneficial, as it
+		 * seems that single-purpose certs are not often seen in the
+		 * wild.
+		 */
+		if (cert.purposes.indexOf('serverAuth') !== -1 &&
+		    cert.purposes.indexOf('clientAuth') === -1) {
+			cert.subjects.forEach(function (ide) {
+				if (ide.type !== 'host') {
+					ide.type = 'host';
+					ide.hostname = ide.uid ||
+					    ide.email ||
+					    ide.components[0].value;
+				}
+			});
+		} else if (cert.purposes.indexOf('clientAuth') !== -1 &&
+		    cert.purposes.indexOf('serverAuth') === -1) {
+			cert.subjects.forEach(function (ide) {
+				if (ide.type !== 'user') {
+					ide.type = 'user';
+					ide.uid = ide.hostname ||
+					    ide.email ||
+					    ide.components[0].value;
+				}
+			});
+		}
+		sig.extras.exts.push({ oid: extId, critical: critical });
+		break;
+	case (EXTS.keyUsage):
+		der.readSequence(asn1.Ber.OctetString);
+		var bits = der.readString(asn1.Ber.BitString, true);
+		var setBits = readBitField(bits, KEYUSEBITS);
+		setBits.forEach(function (bit) {
+			if (cert.purposes === undefined)
+				cert.purposes = [];
+			if (cert.purposes.indexOf(bit) === -1)
+				cert.purposes.push(bit);
+		});
+		sig.extras.exts.push({ oid: extId, critical: critical,
+		    bits: bits });
+		break;
+	case (EXTS.altName):
+		der.readSequence(asn1.Ber.OctetString);
+		der.readSequence();
+		var aeEnd = der.offset + der.length;
+		while (der.offset < aeEnd) {
+			switch (der.peek()) {
+			case ALTNAME.OtherName:
+			case ALTNAME.EDIPartyName:
+				der.readSequence();
+				der._offset += der.length;
+				break;
+			case ALTNAME.OID:
+				der.readOID(ALTNAME.OID);
+				break;
+			case ALTNAME.RFC822Name:
+				/* RFC822 specifies email addresses */
+				var email = der.readString(ALTNAME.RFC822Name);
+				id = Identity.forEmail(email);
+				if (!cert.subjects[0].equals(id))
+					cert.subjects.push(id);
+				break;
+			case ALTNAME.DirectoryName:
+				der.readSequence(ALTNAME.DirectoryName);
+				id = Identity.parseAsn1(der);
+				if (!cert.subjects[0].equals(id))
+					cert.subjects.push(id);
+				break;
+			case ALTNAME.DNSName:
+				var host = der.readString(
+				    ALTNAME.DNSName);
+				id = Identity.forHost(host);
+				if (!cert.subjects[0].equals(id))
+					cert.subjects.push(id);
+				break;
+			default:
+				der.readString(der.peek());
+				break;
+			}
+		}
+		sig.extras.exts.push({ oid: extId, critical: critical });
+		break;
+	default:
+		sig.extras.exts.push({
+			oid: extId,
+			critical: critical,
+			data: der.readString(asn1.Ber.OctetString, true)
+		});
+		break;
+	}
+
+	der._offset = after;
+}
+
+var UTCTIME_RE =
+    /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/;
+function utcTimeToDate(t) {
+	var m = t.match(UTCTIME_RE);
+	assert.ok(m, 'timestamps must be in UTC');
+	var d = new Date();
+
+	var thisYear = d.getUTCFullYear();
+	var century = Math.floor(thisYear / 100) * 100;
+
+	var year = parseInt(m[1], 10);
+	if (thisYear % 100 < 50 && year >= 60)
+		year += (century - 1);
+	else
+		year += century;
+	d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10));
+	d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10));
+	if (m[6] && m[6].length > 0)
+		d.setUTCSeconds(parseInt(m[6], 10));
+	return (d);
+}
+
+var GTIME_RE =
+    /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/;
+function gTimeToDate(t) {
+	var m = t.match(GTIME_RE);
+	assert.ok(m);
+	var d = new Date();
+
+	d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1,
+	    parseInt(m[3], 10));
+	d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10));
+	if (m[6] && m[6].length > 0)
+		d.setUTCSeconds(parseInt(m[6], 10));
+	return (d);
+}
+
+function zeroPad(n, m) {
+	if (m === undefined)
+		m = 2;
+	var s = '' + n;
+	while (s.length < m)
+		s = '0' + s;
+	return (s);
+}
+
+function dateToUTCTime(d) {
+	var s = '';
+	s += zeroPad(d.getUTCFullYear() % 100);
+	s += zeroPad(d.getUTCMonth() + 1);
+	s += zeroPad(d.getUTCDate());
+	s += zeroPad(d.getUTCHours());
+	s += zeroPad(d.getUTCMinutes());
+	s += zeroPad(d.getUTCSeconds());
+	s += 'Z';
+	return (s);
+}
+
+function dateToGTime(d) {
+	var s = '';
+	s += zeroPad(d.getUTCFullYear(), 4);
+	s += zeroPad(d.getUTCMonth() + 1);
+	s += zeroPad(d.getUTCDate());
+	s += zeroPad(d.getUTCHours());
+	s += zeroPad(d.getUTCMinutes());
+	s += zeroPad(d.getUTCSeconds());
+	s += 'Z';
+	return (s);
+}
+
+function sign(cert, key) {
+	if (cert.signatures.x509 === undefined)
+		cert.signatures.x509 = {};
+	var sig = cert.signatures.x509;
+
+	sig.algo = key.type + '-' + key.defaultHashAlgorithm();
+	if (SIGN_ALGS[sig.algo] === undefined)
+		return (false);
+
+	var der = new asn1.BerWriter();
+	writeTBSCert(cert, der);
+	var blob = der.buffer;
+	sig.cache = blob;
+
+	var signer = key.createSign();
+	signer.write(blob);
+	cert.signatures.x509.signature = signer.sign();
+
+	return (true);
+}
+
+function signAsync(cert, signer, done) {
+	if (cert.signatures.x509 === undefined)
+		cert.signatures.x509 = {};
+	var sig = cert.signatures.x509;
+
+	var der = new asn1.BerWriter();
+	writeTBSCert(cert, der);
+	var blob = der.buffer;
+	sig.cache = blob;
+
+	signer(blob, function (err, signature) {
+		if (err) {
+			done(err);
+			return;
+		}
+		sig.algo = signature.type + '-' + signature.hashAlgorithm;
+		if (SIGN_ALGS[sig.algo] === undefined) {
+			done(new Error('Invalid signing algorithm "' +
+			    sig.algo + '"'));
+			return;
+		}
+		sig.signature = signature;
+		done();
+	});
+}
+
+function write(cert, options) {
+	var sig = cert.signatures.x509;
+	assert.object(sig, 'x509 signature');
+
+	var der = new asn1.BerWriter();
+	der.startSequence();
+	if (sig.cache) {
+		der._ensure(sig.cache.length);
+		sig.cache.copy(der._buf, der._offset);
+		der._offset += sig.cache.length;
+	} else {
+		writeTBSCert(cert, der);
+	}
+
+	der.startSequence();
+	der.writeOID(SIGN_ALGS[sig.algo]);
+	if (sig.algo.match(/^rsa-/))
+		der.writeNull();
+	der.endSequence();
+
+	var sigData = sig.signature.toBuffer('asn1');
+	var data = Buffer.alloc(sigData.length + 1);
+	data[0] = 0;
+	sigData.copy(data, 1);
+	der.writeBuffer(data, asn1.Ber.BitString);
+	der.endSequence();
+
+	return (der.buffer);
+}
+
+function writeTBSCert(cert, der) {
+	var sig = cert.signatures.x509;
+	assert.object(sig, 'x509 signature');
+
+	der.startSequence();
+
+	der.startSequence(Local(0));
+	der.writeInt(2);
+	der.endSequence();
+
+	der.writeBuffer(utils.mpNormalize(cert.serial), asn1.Ber.Integer);
+
+	der.startSequence();
+	der.writeOID(SIGN_ALGS[sig.algo]);
+	if (sig.algo.match(/^rsa-/))
+		der.writeNull();
+	der.endSequence();
+
+	cert.issuer.toAsn1(der);
+
+	der.startSequence();
+	writeDate(der, cert.validFrom);
+	writeDate(der, cert.validUntil);
+	der.endSequence();
+
+	var subject = cert.subjects[0];
+	var altNames = cert.subjects.slice(1);
+	subject.toAsn1(der);
+
+	pkcs8.writePkcs8(der, cert.subjectKey);
+
+	if (sig.extras && sig.extras.issuerUniqueID) {
+		der.writeBuffer(sig.extras.issuerUniqueID, Local(1));
+	}
+
+	if (sig.extras && sig.extras.subjectUniqueID) {
+		der.writeBuffer(sig.extras.subjectUniqueID, Local(2));
+	}
+
+	if (altNames.length > 0 || subject.type === 'host' ||
+	    (cert.purposes !== undefined && cert.purposes.length > 0) ||
+	    (sig.extras && sig.extras.exts)) {
+		der.startSequence(Local(3));
+		der.startSequence();
+
+		var exts = [];
+		if (cert.purposes !== undefined && cert.purposes.length > 0) {
+			exts.push({
+				oid: EXTS.basicConstraints,
+				critical: true
+			});
+			exts.push({
+				oid: EXTS.keyUsage,
+				critical: true
+			});
+			exts.push({
+				oid: EXTS.extKeyUsage,
+				critical: true
+			});
+		}
+		exts.push({ oid: EXTS.altName });
+		if (sig.extras && sig.extras.exts)
+			exts = sig.extras.exts;
+
+		for (var i = 0; i < exts.length; ++i) {
+			der.startSequence();
+			der.writeOID(exts[i].oid);
+
+			if (exts[i].critical !== undefined)
+				der.writeBoolean(exts[i].critical);
+
+			if (exts[i].oid === EXTS.altName) {
+				der.startSequence(asn1.Ber.OctetString);
+				der.startSequence();
+				if (subject.type === 'host') {
+					der.writeString(subject.hostname,
+					    Context(2));
+				}
+				for (var j = 0; j < altNames.length; ++j) {
+					if (altNames[j].type === 'host') {
+						der.writeString(
+						    altNames[j].hostname,
+						    ALTNAME.DNSName);
+					} else if (altNames[j].type ===
+					    'email') {
+						der.writeString(
+						    altNames[j].email,
+						    ALTNAME.RFC822Name);
+					} else {
+						/*
+						 * Encode anything else as a
+						 * DN style name for now.
+						 */
+						der.startSequence(
+						    ALTNAME.DirectoryName);
+						altNames[j].toAsn1(der);
+						der.endSequence();
+					}
+				}
+				der.endSequence();
+				der.endSequence();
+			} else if (exts[i].oid === EXTS.basicConstraints) {
+				der.startSequence(asn1.Ber.OctetString);
+				der.startSequence();
+				var ca = (cert.purposes.indexOf('ca') !== -1);
+				var pathLen = exts[i].pathLen;
+				der.writeBoolean(ca);
+				if (pathLen !== undefined)
+					der.writeInt(pathLen);
+				der.endSequence();
+				der.endSequence();
+			} else if (exts[i].oid === EXTS.extKeyUsage) {
+				der.startSequence(asn1.Ber.OctetString);
+				der.startSequence();
+				cert.purposes.forEach(function (purpose) {
+					if (purpose === 'ca')
+						return;
+					if (KEYUSEBITS.indexOf(purpose) !== -1)
+						return;
+					var oid = purpose;
+					if (EXTPURPOSE[purpose] !== undefined)
+						oid = EXTPURPOSE[purpose];
+					der.writeOID(oid);
+				});
+				der.endSequence();
+				der.endSequence();
+			} else if (exts[i].oid === EXTS.keyUsage) {
+				der.startSequence(asn1.Ber.OctetString);
+				/*
+				 * If we parsed this certificate from a byte
+				 * stream (i.e. we didn't generate it in sshpk)
+				 * then we'll have a ".bits" property on the
+				 * ext with the original raw byte contents.
+				 *
+				 * If we have this, use it here instead of
+				 * regenerating it. This guarantees we output
+				 * the same data we parsed, so signatures still
+				 * validate.
+				 */
+				if (exts[i].bits !== undefined) {
+					der.writeBuffer(exts[i].bits,
+					    asn1.Ber.BitString);
+				} else {
+					var bits = writeBitField(cert.purposes,
+					    KEYUSEBITS);
+					der.writeBuffer(bits,
+					    asn1.Ber.BitString);
+				}
+				der.endSequence();
+			} else {
+				der.writeBuffer(exts[i].data,
+				    asn1.Ber.OctetString);
+			}
+
+			der.endSequence();
+		}
+
+		der.endSequence();
+		der.endSequence();
+	}
+
+	der.endSequence();
+}
+
+/*
+ * Reads an ASN.1 BER bitfield out of the Buffer produced by doing
+ * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw
+ * contents of the BitString tag, which is a count of unused bits followed by
+ * the bits as a right-padded byte string.
+ *
+ * `bits` is the Buffer, `bitIndex` should contain an array of string names
+ * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec.
+ *
+ * Returns an array of Strings, the names of the bits that were set to 1.
+ */
+function readBitField(bits, bitIndex) {
+	var bitLen = 8 * (bits.length - 1) - bits[0];
+	var setBits = {};
+	for (var i = 0; i < bitLen; ++i) {
+		var byteN = 1 + Math.floor(i / 8);
+		var bit = 7 - (i % 8);
+		var mask = 1 << bit;
+		var bitVal = ((bits[byteN] & mask) !== 0);
+		var name = bitIndex[i];
+		if (bitVal && typeof (name) === 'string') {
+			setBits[name] = true;
+		}
+	}
+	return (Object.keys(setBits));
+}
+
+/*
+ * `setBits` is an array of strings, containing the names for each bit that
+ * sould be set to 1. `bitIndex` is same as in `readBitField()`.
+ *
+ * Returns a Buffer, ready to be written out with `BerWriter#writeString()`.
+ */
+function writeBitField(setBits, bitIndex) {
+	var bitLen = bitIndex.length;
+	var blen = Math.ceil(bitLen / 8);
+	var unused = blen * 8 - bitLen;
+	var bits = Buffer.alloc(1 + blen); // zero-filled
+	bits[0] = unused;
+	for (var i = 0; i < bitLen; ++i) {
+		var byteN = 1 + Math.floor(i / 8);
+		var bit = 7 - (i % 8);
+		var mask = 1 << bit;
+		var name = bitIndex[i];
+		if (name === undefined)
+			continue;
+		var bitVal = (setBits.indexOf(name) !== -1);
+		if (bitVal) {
+			bits[byteN] |= mask;
+		}
+	}
+	return (bits);
+}
diff --git a/node_modules/sshpk/lib/identity.js b/node_modules/sshpk/lib/identity.js
new file mode 100644
index 0000000..7d75b66
--- /dev/null
+++ b/node_modules/sshpk/lib/identity.js
@@ -0,0 +1,373 @@
+// Copyright 2017 Joyent, Inc.
+
+module.exports = Identity;
+
+var assert = require('assert-plus');
+var algs = require('./algs');
+var crypto = require('crypto');
+var Fingerprint = require('./fingerprint');
+var Signature = require('./signature');
+var errs = require('./errors');
+var util = require('util');
+var utils = require('./utils');
+var asn1 = require('asn1');
+var Buffer = require('safer-buffer').Buffer;
+
+/*JSSTYLED*/
+var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i;
+
+var oids = {};
+oids.cn = '2.5.4.3';
+oids.o = '2.5.4.10';
+oids.ou = '2.5.4.11';
+oids.l = '2.5.4.7';
+oids.s = '2.5.4.8';
+oids.c = '2.5.4.6';
+oids.sn = '2.5.4.4';
+oids.postalCode = '2.5.4.17';
+oids.serialNumber = '2.5.4.5';
+oids.street = '2.5.4.9';
+oids.x500UniqueIdentifier = '2.5.4.45';
+oids.role = '2.5.4.72';
+oids.telephoneNumber = '2.5.4.20';
+oids.description = '2.5.4.13';
+oids.dc = '0.9.2342.19200300.100.1.25';
+oids.uid = '0.9.2342.19200300.100.1.1';
+oids.mail = '0.9.2342.19200300.100.1.3';
+oids.title = '2.5.4.12';
+oids.gn = '2.5.4.42';
+oids.initials = '2.5.4.43';
+oids.pseudonym = '2.5.4.65';
+oids.emailAddress = '1.2.840.113549.1.9.1';
+
+var unoids = {};
+Object.keys(oids).forEach(function (k) {
+	unoids[oids[k]] = k;
+});
+
+function Identity(opts) {
+	var self = this;
+	assert.object(opts, 'options');
+	assert.arrayOfObject(opts.components, 'options.components');
+	this.components = opts.components;
+	this.componentLookup = {};
+	this.components.forEach(function (c) {
+		if (c.name && !c.oid)
+			c.oid = oids[c.name];
+		if (c.oid && !c.name)
+			c.name = unoids[c.oid];
+		if (self.componentLookup[c.name] === undefined)
+			self.componentLookup[c.name] = [];
+		self.componentLookup[c.name].push(c);
+	});
+	if (this.componentLookup.cn && this.componentLookup.cn.length > 0) {
+		this.cn = this.componentLookup.cn[0].value;
+	}
+	assert.optionalString(opts.type, 'options.type');
+	if (opts.type === undefined) {
+		if (this.components.length === 1 &&
+		    this.componentLookup.cn &&
+		    this.componentLookup.cn.length === 1 &&
+		    this.componentLookup.cn[0].value.match(DNS_NAME_RE)) {
+			this.type = 'host';
+			this.hostname = this.componentLookup.cn[0].value;
+
+		} else if (this.componentLookup.dc &&
+		    this.components.length === this.componentLookup.dc.length) {
+			this.type = 'host';
+			this.hostname = this.componentLookup.dc.map(
+			    function (c) {
+				return (c.value);
+			}).join('.');
+
+		} else if (this.componentLookup.uid &&
+		    this.components.length ===
+		    this.componentLookup.uid.length) {
+			this.type = 'user';
+			this.uid = this.componentLookup.uid[0].value;
+
+		} else if (this.componentLookup.cn &&
+		    this.componentLookup.cn.length === 1 &&
+		    this.componentLookup.cn[0].value.match(DNS_NAME_RE)) {
+			this.type = 'host';
+			this.hostname = this.componentLookup.cn[0].value;
+
+		} else if (this.componentLookup.uid &&
+		    this.componentLookup.uid.length === 1) {
+			this.type = 'user';
+			this.uid = this.componentLookup.uid[0].value;
+
+		} else if (this.componentLookup.mail &&
+		    this.componentLookup.mail.length === 1) {
+			this.type = 'email';
+			this.email = this.componentLookup.mail[0].value;
+
+		} else if (this.componentLookup.cn &&
+		    this.componentLookup.cn.length === 1) {
+			this.type = 'user';
+			this.uid = this.componentLookup.cn[0].value;
+
+		} else {
+			this.type = 'unknown';
+		}
+	} else {
+		this.type = opts.type;
+		if (this.type === 'host')
+			this.hostname = opts.hostname;
+		else if (this.type === 'user')
+			this.uid = opts.uid;
+		else if (this.type === 'email')
+			this.email = opts.email;
+		else
+			throw (new Error('Unknown type ' + this.type));
+	}
+}
+
+Identity.prototype.toString = function () {
+	return (this.components.map(function (c) {
+		var n = c.name.toUpperCase();
+		/*JSSTYLED*/
+		n = n.replace(/=/g, '\\=');
+		var v = c.value;
+		/*JSSTYLED*/
+		v = v.replace(/,/g, '\\,');
+		return (n + '=' + v);
+	}).join(', '));
+};
+
+Identity.prototype.get = function (name, asArray) {
+	assert.string(name, 'name');
+	var arr = this.componentLookup[name];
+	if (arr === undefined || arr.length === 0)
+		return (undefined);
+	if (!asArray && arr.length > 1)
+		throw (new Error('Multiple values for attribute ' + name));
+	if (!asArray)
+		return (arr[0].value);
+	return (arr.map(function (c) {
+		return (c.value);
+	}));
+};
+
+Identity.prototype.toArray = function (idx) {
+	return (this.components.map(function (c) {
+		return ({
+			name: c.name,
+			value: c.value
+		});
+	}));
+};
+
+/*
+ * These are from X.680 -- PrintableString allowed chars are in section 37.4
+ * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to
+ * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006
+ * (the basic ASCII character set).
+ */
+/* JSSTYLED */
+var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/;
+/* JSSTYLED */
+var NOT_IA5 = /[^\x00-\x7f]/;
+
+Identity.prototype.toAsn1 = function (der, tag) {
+	der.startSequence(tag);
+	this.components.forEach(function (c) {
+		der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set);
+		der.startSequence();
+		der.writeOID(c.oid);
+		/*
+		 * If we fit in a PrintableString, use that. Otherwise use an
+		 * IA5String or UTF8String.
+		 *
+		 * If this identity was parsed from a DN, use the ASN.1 types
+		 * from the original representation (otherwise this might not
+		 * be a full match for the original in some validators).
+		 */
+		if (c.asn1type === asn1.Ber.Utf8String ||
+		    c.value.match(NOT_IA5)) {
+			var v = Buffer.from(c.value, 'utf8');
+			der.writeBuffer(v, asn1.Ber.Utf8String);
+
+		} else if (c.asn1type === asn1.Ber.IA5String ||
+		    c.value.match(NOT_PRINTABLE)) {
+			der.writeString(c.value, asn1.Ber.IA5String);
+
+		} else {
+			var type = asn1.Ber.PrintableString;
+			if (c.asn1type !== undefined)
+				type = c.asn1type;
+			der.writeString(c.value, type);
+		}
+		der.endSequence();
+		der.endSequence();
+	});
+	der.endSequence();
+};
+
+function globMatch(a, b) {
+	if (a === '**' || b === '**')
+		return (true);
+	var aParts = a.split('.');
+	var bParts = b.split('.');
+	if (aParts.length !== bParts.length)
+		return (false);
+	for (var i = 0; i < aParts.length; ++i) {
+		if (aParts[i] === '*' || bParts[i] === '*')
+			continue;
+		if (aParts[i] !== bParts[i])
+			return (false);
+	}
+	return (true);
+}
+
+Identity.prototype.equals = function (other) {
+	if (!Identity.isIdentity(other, [1, 0]))
+		return (false);
+	if (other.components.length !== this.components.length)
+		return (false);
+	for (var i = 0; i < this.components.length; ++i) {
+		if (this.components[i].oid !== other.components[i].oid)
+			return (false);
+		if (!globMatch(this.components[i].value,
+		    other.components[i].value)) {
+			return (false);
+		}
+	}
+	return (true);
+};
+
+Identity.forHost = function (hostname) {
+	assert.string(hostname, 'hostname');
+	return (new Identity({
+		type: 'host',
+		hostname: hostname,
+		components: [ { name: 'cn', value: hostname } ]
+	}));
+};
+
+Identity.forUser = function (uid) {
+	assert.string(uid, 'uid');
+	return (new Identity({
+		type: 'user',
+		uid: uid,
+		components: [ { name: 'uid', value: uid } ]
+	}));
+};
+
+Identity.forEmail = function (email) {
+	assert.string(email, 'email');
+	return (new Identity({
+		type: 'email',
+		email: email,
+		components: [ { name: 'mail', value: email } ]
+	}));
+};
+
+Identity.parseDN = function (dn) {
+	assert.string(dn, 'dn');
+	var parts = [''];
+	var idx = 0;
+	var rem = dn;
+	while (rem.length > 0) {
+		var m;
+		/*JSSTYLED*/
+		if ((m = /^,/.exec(rem)) !== null) {
+			parts[++idx] = '';
+			rem = rem.slice(m[0].length);
+		/*JSSTYLED*/
+		} else if ((m = /^\\,/.exec(rem)) !== null) {
+			parts[idx] += ',';
+			rem = rem.slice(m[0].length);
+		/*JSSTYLED*/
+		} else if ((m = /^\\./.exec(rem)) !== null) {
+			parts[idx] += m[0];
+			rem = rem.slice(m[0].length);
+		/*JSSTYLED*/
+		} else if ((m = /^[^\\,]+/.exec(rem)) !== null) {
+			parts[idx] += m[0];
+			rem = rem.slice(m[0].length);
+		} else {
+			throw (new Error('Failed to parse DN'));
+		}
+	}
+	var cmps = parts.map(function (c) {
+		c = c.trim();
+		var eqPos = c.indexOf('=');
+		while (eqPos > 0 && c.charAt(eqPos - 1) === '\\')
+			eqPos = c.indexOf('=', eqPos + 1);
+		if (eqPos === -1) {
+			throw (new Error('Failed to parse DN'));
+		}
+		/*JSSTYLED*/
+		var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '=');
+		var value = c.slice(eqPos + 1);
+		return ({ name: name, value: value });
+	});
+	return (new Identity({ components: cmps }));
+};
+
+Identity.fromArray = function (components) {
+	assert.arrayOfObject(components, 'components');
+	components.forEach(function (cmp) {
+		assert.object(cmp, 'component');
+		assert.string(cmp.name, 'component.name');
+		if (!Buffer.isBuffer(cmp.value) &&
+		    !(typeof (cmp.value) === 'string')) {
+			throw (new Error('Invalid component value'));
+		}
+	});
+	return (new Identity({ components: components }));
+};
+
+Identity.parseAsn1 = function (der, top) {
+	var components = [];
+	der.readSequence(top);
+	var end = der.offset + der.length;
+	while (der.offset < end) {
+		der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set);
+		var after = der.offset + der.length;
+		der.readSequence();
+		var oid = der.readOID();
+		var type = der.peek();
+		var value;
+		switch (type) {
+		case asn1.Ber.PrintableString:
+		case asn1.Ber.IA5String:
+		case asn1.Ber.OctetString:
+		case asn1.Ber.T61String:
+			value = der.readString(type);
+			break;
+		case asn1.Ber.Utf8String:
+			value = der.readString(type, true);
+			value = value.toString('utf8');
+			break;
+		case asn1.Ber.CharacterString:
+		case asn1.Ber.BMPString:
+			value = der.readString(type, true);
+			value = value.toString('utf16le');
+			break;
+		default:
+			throw (new Error('Unknown asn1 type ' + type));
+		}
+		components.push({ oid: oid, asn1type: type, value: value });
+		der._offset = after;
+	}
+	der._offset = end;
+	return (new Identity({
+		components: components
+	}));
+};
+
+Identity.isIdentity = function (obj, ver) {
+	return (utils.isCompatible(obj, Identity, ver));
+};
+
+/*
+ * API versions for Identity:
+ * [1,0] -- initial ver
+ */
+Identity.prototype._sshpkApiVersion = [1, 0];
+
+Identity._oldVersionDetect = function (obj) {
+	return ([1, 0]);
+};
diff --git a/node_modules/sshpk/lib/index.js b/node_modules/sshpk/lib/index.js
new file mode 100644
index 0000000..f76db79
--- /dev/null
+++ b/node_modules/sshpk/lib/index.js
@@ -0,0 +1,40 @@
+// Copyright 2015 Joyent, Inc.
+
+var Key = require('./key');
+var Fingerprint = require('./fingerprint');
+var Signature = require('./signature');
+var PrivateKey = require('./private-key');
+var Certificate = require('./certificate');
+var Identity = require('./identity');
+var errs = require('./errors');
+
+module.exports = {
+	/* top-level classes */
+	Key: Key,
+	parseKey: Key.parse,
+	Fingerprint: Fingerprint,
+	parseFingerprint: Fingerprint.parse,
+	Signature: Signature,
+	parseSignature: Signature.parse,
+	PrivateKey: PrivateKey,
+	parsePrivateKey: PrivateKey.parse,
+	generatePrivateKey: PrivateKey.generate,
+	Certificate: Certificate,
+	parseCertificate: Certificate.parse,
+	createSelfSignedCertificate: Certificate.createSelfSigned,
+	createCertificate: Certificate.create,
+	Identity: Identity,
+	identityFromDN: Identity.parseDN,
+	identityForHost: Identity.forHost,
+	identityForUser: Identity.forUser,
+	identityForEmail: Identity.forEmail,
+	identityFromArray: Identity.fromArray,
+
+	/* errors */
+	FingerprintFormatError: errs.FingerprintFormatError,
+	InvalidAlgorithmError: errs.InvalidAlgorithmError,
+	KeyParseError: errs.KeyParseError,
+	SignatureParseError: errs.SignatureParseError,
+	KeyEncryptedError: errs.KeyEncryptedError,
+	CertificateParseError: errs.CertificateParseError
+};
diff --git a/node_modules/sshpk/lib/key.js b/node_modules/sshpk/lib/key.js
new file mode 100644
index 0000000..706f834
--- /dev/null
+++ b/node_modules/sshpk/lib/key.js
@@ -0,0 +1,294 @@
+// Copyright 2018 Joyent, Inc.
+
+module.exports = Key;
+
+var assert = require('assert-plus');
+var algs = require('./algs');
+var crypto = require('crypto');
+var Fingerprint = require('./fingerprint');
+var Signature = require('./signature');
+var DiffieHellman = require('./dhe').DiffieHellman;
+var errs = require('./errors');
+var utils = require('./utils');
+var PrivateKey = require('./private-key');
+var edCompat;
+
+try {
+	edCompat = require('./ed-compat');
+} catch (e) {
+	/* Just continue through, and bail out if we try to use it. */
+}
+
+var InvalidAlgorithmError = errs.InvalidAlgorithmError;
+var KeyParseError = errs.KeyParseError;
+
+var formats = {};
+formats['auto'] = require('./formats/auto');
+formats['pem'] = require('./formats/pem');
+formats['pkcs1'] = require('./formats/pkcs1');
+formats['pkcs8'] = require('./formats/pkcs8');
+formats['rfc4253'] = require('./formats/rfc4253');
+formats['ssh'] = require('./formats/ssh');
+formats['ssh-private'] = require('./formats/ssh-private');
+formats['openssh'] = formats['ssh-private'];
+formats['dnssec'] = require('./formats/dnssec');
+formats['putty'] = require('./formats/putty');
+formats['ppk'] = formats['putty'];
+
+function Key(opts) {
+	assert.object(opts, 'options');
+	assert.arrayOfObject(opts.parts, 'options.parts');
+	assert.string(opts.type, 'options.type');
+	assert.optionalString(opts.comment, 'options.comment');
+
+	var algInfo = algs.info[opts.type];
+	if (typeof (algInfo) !== 'object')
+		throw (new InvalidAlgorithmError(opts.type));
+
+	var partLookup = {};
+	for (var i = 0; i < opts.parts.length; ++i) {
+		var part = opts.parts[i];
+		partLookup[part.name] = part;
+	}
+
+	this.type = opts.type;
+	this.parts = opts.parts;
+	this.part = partLookup;
+	this.comment = undefined;
+	this.source = opts.source;
+
+	/* for speeding up hashing/fingerprint operations */
+	this._rfc4253Cache = opts._rfc4253Cache;
+	this._hashCache = {};
+
+	var sz;
+	this.curve = undefined;
+	if (this.type === 'ecdsa') {
+		var curve = this.part.curve.data.toString();
+		this.curve = curve;
+		sz = algs.curves[curve].size;
+	} else if (this.type === 'ed25519' || this.type === 'curve25519') {
+		sz = 256;
+		this.curve = 'curve25519';
+	} else {
+		var szPart = this.part[algInfo.sizePart];
+		sz = szPart.data.length;
+		sz = sz * 8 - utils.countZeros(szPart.data);
+	}
+	this.size = sz;
+}
+
+Key.formats = formats;
+
+Key.prototype.toBuffer = function (format, options) {
+	if (format === undefined)
+		format = 'ssh';
+	assert.string(format, 'format');
+	assert.object(formats[format], 'formats[format]');
+	assert.optionalObject(options, 'options');
+
+	if (format === 'rfc4253') {
+		if (this._rfc4253Cache === undefined)
+			this._rfc4253Cache = formats['rfc4253'].write(this);
+		return (this._rfc4253Cache);
+	}
+
+	return (formats[format].write(this, options));
+};
+
+Key.prototype.toString = function (format, options) {
+	return (this.toBuffer(format, options).toString());
+};
+
+Key.prototype.hash = function (algo, type) {
+	assert.string(algo, 'algorithm');
+	assert.optionalString(type, 'type');
+	if (type === undefined)
+		type = 'ssh';
+	algo = algo.toLowerCase();
+	if (algs.hashAlgs[algo] === undefined)
+		throw (new InvalidAlgorithmError(algo));
+
+	var cacheKey = algo + '||' + type;
+	if (this._hashCache[cacheKey])
+		return (this._hashCache[cacheKey]);
+
+	var buf;
+	if (type === 'ssh') {
+		buf = this.toBuffer('rfc4253');
+	} else if (type === 'spki') {
+		buf = formats.pkcs8.pkcs8ToBuffer(this);
+	} else {
+		throw (new Error('Hash type ' + type + ' not supported'));
+	}
+	var hash = crypto.createHash(algo).update(buf).digest();
+	this._hashCache[cacheKey] = hash;
+	return (hash);
+};
+
+Key.prototype.fingerprint = function (algo, type) {
+	if (algo === undefined)
+		algo = 'sha256';
+	if (type === undefined)
+		type = 'ssh';
+	assert.string(algo, 'algorithm');
+	assert.string(type, 'type');
+	var opts = {
+		type: 'key',
+		hash: this.hash(algo, type),
+		algorithm: algo,
+		hashType: type
+	};
+	return (new Fingerprint(opts));
+};
+
+Key.prototype.defaultHashAlgorithm = function () {
+	var hashAlgo = 'sha1';
+	if (this.type === 'rsa')
+		hashAlgo = 'sha256';
+	if (this.type === 'dsa' && this.size > 1024)
+		hashAlgo = 'sha256';
+	if (this.type === 'ed25519')
+		hashAlgo = 'sha512';
+	if (this.type === 'ecdsa') {
+		if (this.size <= 256)
+			hashAlgo = 'sha256';
+		else if (this.size <= 384)
+			hashAlgo = 'sha384';
+		else
+			hashAlgo = 'sha512';
+	}
+	return (hashAlgo);
+};
+
+Key.prototype.createVerify = function (hashAlgo) {
+	if (hashAlgo === undefined)
+		hashAlgo = this.defaultHashAlgorithm();
+	assert.string(hashAlgo, 'hash algorithm');
+
+	/* ED25519 is not supported by OpenSSL, use a javascript impl. */
+	if (this.type === 'ed25519' && edCompat !== undefined)
+		return (new edCompat.Verifier(this, hashAlgo));
+	if (this.type === 'curve25519')
+		throw (new Error('Curve25519 keys are not suitable for ' +
+		    'signing or verification'));
+
+	var v, nm, err;
+	try {
+		nm = hashAlgo.toUpperCase();
+		v = crypto.createVerify(nm);
+	} catch (e) {
+		err = e;
+	}
+	if (v === undefined || (err instanceof Error &&
+	    err.message.match(/Unknown message digest/))) {
+		nm = 'RSA-';
+		nm += hashAlgo.toUpperCase();
+		v = crypto.createVerify(nm);
+	}
+	assert.ok(v, 'failed to create verifier');
+	var oldVerify = v.verify.bind(v);
+	var key = this.toBuffer('pkcs8');
+	var curve = this.curve;
+	var self = this;
+	v.verify = function (signature, fmt) {
+		if (Signature.isSignature(signature, [2, 0])) {
+			if (signature.type !== self.type)
+				return (false);
+			if (signature.hashAlgorithm &&
+			    signature.hashAlgorithm !== hashAlgo)
+				return (false);
+			if (signature.curve && self.type === 'ecdsa' &&
+			    signature.curve !== curve)
+				return (false);
+			return (oldVerify(key, signature.toBuffer('asn1')));
+
+		} else if (typeof (signature) === 'string' ||
+		    Buffer.isBuffer(signature)) {
+			return (oldVerify(key, signature, fmt));
+
+		/*
+		 * Avoid doing this on valid arguments, walking the prototype
+		 * chain can be quite slow.
+		 */
+		} else if (Signature.isSignature(signature, [1, 0])) {
+			throw (new Error('signature was created by too old ' +
+			    'a version of sshpk and cannot be verified'));
+
+		} else {
+			throw (new TypeError('signature must be a string, ' +
+			    'Buffer, or Signature object'));
+		}
+	};
+	return (v);
+};
+
+Key.prototype.createDiffieHellman = function () {
+	if (this.type === 'rsa')
+		throw (new Error('RSA keys do not support Diffie-Hellman'));
+
+	return (new DiffieHellman(this));
+};
+Key.prototype.createDH = Key.prototype.createDiffieHellman;
+
+Key.parse = function (data, format, options) {
+	if (typeof (data) !== 'string')
+		assert.buffer(data, 'data');
+	if (format === undefined)
+		format = 'auto';
+	assert.string(format, 'format');
+	if (typeof (options) === 'string')
+		options = { filename: options };
+	assert.optionalObject(options, 'options');
+	if (options === undefined)
+		options = {};
+	assert.optionalString(options.filename, 'options.filename');
+	if (options.filename === undefined)
+		options.filename = '(unnamed)';
+
+	assert.object(formats[format], 'formats[format]');
+
+	try {
+		var k = formats[format].read(data, options);
+		if (k instanceof PrivateKey)
+			k = k.toPublic();
+		if (!k.comment)
+			k.comment = options.filename;
+		return (k);
+	} catch (e) {
+		if (e.name === 'KeyEncryptedError')
+			throw (e);
+		throw (new KeyParseError(options.filename, format, e));
+	}
+};
+
+Key.isKey = function (obj, ver) {
+	return (utils.isCompatible(obj, Key, ver));
+};
+
+/*
+ * API versions for Key:
+ * [1,0] -- initial ver, may take Signature for createVerify or may not
+ * [1,1] -- added pkcs1, pkcs8 formats
+ * [1,2] -- added auto, ssh-private, openssh formats
+ * [1,3] -- added defaultHashAlgorithm
+ * [1,4] -- added ed support, createDH
+ * [1,5] -- first explicitly tagged version
+ * [1,6] -- changed ed25519 part names
+ * [1,7] -- spki hash types
+ */
+Key.prototype._sshpkApiVersion = [1, 7];
+
+Key._oldVersionDetect = function (obj) {
+	assert.func(obj.toBuffer);
+	assert.func(obj.fingerprint);
+	if (obj.createDH)
+		return ([1, 4]);
+	if (obj.defaultHashAlgorithm)
+		return ([1, 3]);
+	if (obj.formats['auto'])
+		return ([1, 2]);
+	if (obj.formats['pkcs1'])
+		return ([1, 1]);
+	return ([1, 0]);
+};
diff --git a/node_modules/sshpk/lib/private-key.js b/node_modules/sshpk/lib/private-key.js
new file mode 100644
index 0000000..5600838
--- /dev/null
+++ b/node_modules/sshpk/lib/private-key.js
@@ -0,0 +1,246 @@
+// Copyright 2017 Joyent, Inc.
+
+module.exports = PrivateKey;
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('./algs');
+var crypto = require('crypto');
+var Fingerprint = require('./fingerprint');
+var Signature = require('./signature');
+var errs = require('./errors');
+var util = require('util');
+var utils = require('./utils');
+var dhe = require('./dhe');
+var generateECDSA = dhe.generateECDSA;
+var generateED25519 = dhe.generateED25519;
+var edCompat = require('./ed-compat');
+var nacl = require('tweetnacl');
+
+var Key = require('./key');
+
+var InvalidAlgorithmError = errs.InvalidAlgorithmError;
+var KeyParseError = errs.KeyParseError;
+var KeyEncryptedError = errs.KeyEncryptedError;
+
+var formats = {};
+formats['auto'] = require('./formats/auto');
+formats['pem'] = require('./formats/pem');
+formats['pkcs1'] = require('./formats/pkcs1');
+formats['pkcs8'] = require('./formats/pkcs8');
+formats['rfc4253'] = require('./formats/rfc4253');
+formats['ssh-private'] = require('./formats/ssh-private');
+formats['openssh'] = formats['ssh-private'];
+formats['ssh'] = formats['ssh-private'];
+formats['dnssec'] = require('./formats/dnssec');
+
+function PrivateKey(opts) {
+	assert.object(opts, 'options');
+	Key.call(this, opts);
+
+	this._pubCache = undefined;
+}
+util.inherits(PrivateKey, Key);
+
+PrivateKey.formats = formats;
+
+PrivateKey.prototype.toBuffer = function (format, options) {
+	if (format === undefined)
+		format = 'pkcs1';
+	assert.string(format, 'format');
+	assert.object(formats[format], 'formats[format]');
+	assert.optionalObject(options, 'options');
+
+	return (formats[format].write(this, options));
+};
+
+PrivateKey.prototype.hash = function (algo, type) {
+	return (this.toPublic().hash(algo, type));
+};
+
+PrivateKey.prototype.fingerprint = function (algo, type) {
+	return (this.toPublic().fingerprint(algo, type));
+};
+
+PrivateKey.prototype.toPublic = function () {
+	if (this._pubCache)
+		return (this._pubCache);
+
+	var algInfo = algs.info[this.type];
+	var pubParts = [];
+	for (var i = 0; i < algInfo.parts.length; ++i) {
+		var p = algInfo.parts[i];
+		pubParts.push(this.part[p]);
+	}
+
+	this._pubCache = new Key({
+		type: this.type,
+		source: this,
+		parts: pubParts
+	});
+	if (this.comment)
+		this._pubCache.comment = this.comment;
+	return (this._pubCache);
+};
+
+PrivateKey.prototype.derive = function (newType) {
+	assert.string(newType, 'type');
+	var priv, pub, pair;
+
+	if (this.type === 'ed25519' && newType === 'curve25519') {
+		priv = this.part.k.data;
+		if (priv[0] === 0x00)
+			priv = priv.slice(1);
+
+		pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv));
+		pub = Buffer.from(pair.publicKey);
+
+		return (new PrivateKey({
+			type: 'curve25519',
+			parts: [
+				{ name: 'A', data: utils.mpNormalize(pub) },
+				{ name: 'k', data: utils.mpNormalize(priv) }
+			]
+		}));
+	} else if (this.type === 'curve25519' && newType === 'ed25519') {
+		priv = this.part.k.data;
+		if (priv[0] === 0x00)
+			priv = priv.slice(1);
+
+		pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv));
+		pub = Buffer.from(pair.publicKey);
+
+		return (new PrivateKey({
+			type: 'ed25519',
+			parts: [
+				{ name: 'A', data: utils.mpNormalize(pub) },
+				{ name: 'k', data: utils.mpNormalize(priv) }
+			]
+		}));
+	}
+	throw (new Error('Key derivation not supported from ' + this.type +
+	    ' to ' + newType));
+};
+
+PrivateKey.prototype.createVerify = function (hashAlgo) {
+	return (this.toPublic().createVerify(hashAlgo));
+};
+
+PrivateKey.prototype.createSign = function (hashAlgo) {
+	if (hashAlgo === undefined)
+		hashAlgo = this.defaultHashAlgorithm();
+	assert.string(hashAlgo, 'hash algorithm');
+
+	/* ED25519 is not supported by OpenSSL, use a javascript impl. */
+	if (this.type === 'ed25519' && edCompat !== undefined)
+		return (new edCompat.Signer(this, hashAlgo));
+	if (this.type === 'curve25519')
+		throw (new Error('Curve25519 keys are not suitable for ' +
+		    'signing or verification'));
+
+	var v, nm, err;
+	try {
+		nm = hashAlgo.toUpperCase();
+		v = crypto.createSign(nm);
+	} catch (e) {
+		err = e;
+	}
+	if (v === undefined || (err instanceof Error &&
+	    err.message.match(/Unknown message digest/))) {
+		nm = 'RSA-';
+		nm += hashAlgo.toUpperCase();
+		v = crypto.createSign(nm);
+	}
+	assert.ok(v, 'failed to create verifier');
+	var oldSign = v.sign.bind(v);
+	var key = this.toBuffer('pkcs1');
+	var type = this.type;
+	var curve = this.curve;
+	v.sign = function () {
+		var sig = oldSign(key);
+		if (typeof (sig) === 'string')
+			sig = Buffer.from(sig, 'binary');
+		sig = Signature.parse(sig, type, 'asn1');
+		sig.hashAlgorithm = hashAlgo;
+		sig.curve = curve;
+		return (sig);
+	};
+	return (v);
+};
+
+PrivateKey.parse = function (data, format, options) {
+	if (typeof (data) !== 'string')
+		assert.buffer(data, 'data');
+	if (format === undefined)
+		format = 'auto';
+	assert.string(format, 'format');
+	if (typeof (options) === 'string')
+		options = { filename: options };
+	assert.optionalObject(options, 'options');
+	if (options === undefined)
+		options = {};
+	assert.optionalString(options.filename, 'options.filename');
+	if (options.filename === undefined)
+		options.filename = '(unnamed)';
+
+	assert.object(formats[format], 'formats[format]');
+
+	try {
+		var k = formats[format].read(data, options);
+		assert.ok(k instanceof PrivateKey, 'key is not a private key');
+		if (!k.comment)
+			k.comment = options.filename;
+		return (k);
+	} catch (e) {
+		if (e.name === 'KeyEncryptedError')
+			throw (e);
+		throw (new KeyParseError(options.filename, format, e));
+	}
+};
+
+PrivateKey.isPrivateKey = function (obj, ver) {
+	return (utils.isCompatible(obj, PrivateKey, ver));
+};
+
+PrivateKey.generate = function (type, options) {
+	if (options === undefined)
+		options = {};
+	assert.object(options, 'options');
+
+	switch (type) {
+	case 'ecdsa':
+		if (options.curve === undefined)
+			options.curve = 'nistp256';
+		assert.string(options.curve, 'options.curve');
+		return (generateECDSA(options.curve));
+	case 'ed25519':
+		return (generateED25519());
+	default:
+		throw (new Error('Key generation not supported with key ' +
+		    'type "' + type + '"'));
+	}
+};
+
+/*
+ * API versions for PrivateKey:
+ * [1,0] -- initial ver
+ * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats
+ * [1,2] -- added defaultHashAlgorithm
+ * [1,3] -- added derive, ed, createDH
+ * [1,4] -- first tagged version
+ * [1,5] -- changed ed25519 part names and format
+ * [1,6] -- type arguments for hash() and fingerprint()
+ */
+PrivateKey.prototype._sshpkApiVersion = [1, 6];
+
+PrivateKey._oldVersionDetect = function (obj) {
+	assert.func(obj.toPublic);
+	assert.func(obj.createSign);
+	if (obj.derive)
+		return ([1, 3]);
+	if (obj.defaultHashAlgorithm)
+		return ([1, 2]);
+	if (obj.formats['auto'])
+		return ([1, 1]);
+	return ([1, 0]);
+};
diff --git a/node_modules/sshpk/lib/signature.js b/node_modules/sshpk/lib/signature.js
new file mode 100644
index 0000000..aa8fdbb
--- /dev/null
+++ b/node_modules/sshpk/lib/signature.js
@@ -0,0 +1,314 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = Signature;
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var algs = require('./algs');
+var crypto = require('crypto');
+var errs = require('./errors');
+var utils = require('./utils');
+var asn1 = require('asn1');
+var SSHBuffer = require('./ssh-buffer');
+
+var InvalidAlgorithmError = errs.InvalidAlgorithmError;
+var SignatureParseError = errs.SignatureParseError;
+
+function Signature(opts) {
+	assert.object(opts, 'options');
+	assert.arrayOfObject(opts.parts, 'options.parts');
+	assert.string(opts.type, 'options.type');
+
+	var partLookup = {};
+	for (var i = 0; i < opts.parts.length; ++i) {
+		var part = opts.parts[i];
+		partLookup[part.name] = part;
+	}
+
+	this.type = opts.type;
+	this.hashAlgorithm = opts.hashAlgo;
+	this.curve = opts.curve;
+	this.parts = opts.parts;
+	this.part = partLookup;
+}
+
+Signature.prototype.toBuffer = function (format) {
+	if (format === undefined)
+		format = 'asn1';
+	assert.string(format, 'format');
+
+	var buf;
+	var stype = 'ssh-' + this.type;
+
+	switch (this.type) {
+	case 'rsa':
+		switch (this.hashAlgorithm) {
+		case 'sha256':
+			stype = 'rsa-sha2-256';
+			break;
+		case 'sha512':
+			stype = 'rsa-sha2-512';
+			break;
+		case 'sha1':
+		case undefined:
+			break;
+		default:
+			throw (new Error('SSH signature ' +
+			    'format does not support hash ' +
+			    'algorithm ' + this.hashAlgorithm));
+		}
+		if (format === 'ssh') {
+			buf = new SSHBuffer({});
+			buf.writeString(stype);
+			buf.writePart(this.part.sig);
+			return (buf.toBuffer());
+		} else {
+			return (this.part.sig.data);
+		}
+		break;
+
+	case 'ed25519':
+		if (format === 'ssh') {
+			buf = new SSHBuffer({});
+			buf.writeString(stype);
+			buf.writePart(this.part.sig);
+			return (buf.toBuffer());
+		} else {
+			return (this.part.sig.data);
+		}
+		break;
+
+	case 'dsa':
+	case 'ecdsa':
+		var r, s;
+		if (format === 'asn1') {
+			var der = new asn1.BerWriter();
+			der.startSequence();
+			r = utils.mpNormalize(this.part.r.data);
+			s = utils.mpNormalize(this.part.s.data);
+			der.writeBuffer(r, asn1.Ber.Integer);
+			der.writeBuffer(s, asn1.Ber.Integer);
+			der.endSequence();
+			return (der.buffer);
+		} else if (format === 'ssh' && this.type === 'dsa') {
+			buf = new SSHBuffer({});
+			buf.writeString('ssh-dss');
+			r = this.part.r.data;
+			if (r.length > 20 && r[0] === 0x00)
+				r = r.slice(1);
+			s = this.part.s.data;
+			if (s.length > 20 && s[0] === 0x00)
+				s = s.slice(1);
+			if ((this.hashAlgorithm &&
+			    this.hashAlgorithm !== 'sha1') ||
+			    r.length + s.length !== 40) {
+				throw (new Error('OpenSSH only supports ' +
+				    'DSA signatures with SHA1 hash'));
+			}
+			buf.writeBuffer(Buffer.concat([r, s]));
+			return (buf.toBuffer());
+		} else if (format === 'ssh' && this.type === 'ecdsa') {
+			var inner = new SSHBuffer({});
+			r = this.part.r.data;
+			inner.writeBuffer(r);
+			inner.writePart(this.part.s);
+
+			buf = new SSHBuffer({});
+			/* XXX: find a more proper way to do this? */
+			var curve;
+			if (r[0] === 0x00)
+				r = r.slice(1);
+			var sz = r.length * 8;
+			if (sz === 256)
+				curve = 'nistp256';
+			else if (sz === 384)
+				curve = 'nistp384';
+			else if (sz === 528)
+				curve = 'nistp521';
+			buf.writeString('ecdsa-sha2-' + curve);
+			buf.writeBuffer(inner.toBuffer());
+			return (buf.toBuffer());
+		}
+		throw (new Error('Invalid signature format'));
+	default:
+		throw (new Error('Invalid signature data'));
+	}
+};
+
+Signature.prototype.toString = function (format) {
+	assert.optionalString(format, 'format');
+	return (this.toBuffer(format).toString('base64'));
+};
+
+Signature.parse = function (data, type, format) {
+	if (typeof (data) === 'string')
+		data = Buffer.from(data, 'base64');
+	assert.buffer(data, 'data');
+	assert.string(format, 'format');
+	assert.string(type, 'type');
+
+	var opts = {};
+	opts.type = type.toLowerCase();
+	opts.parts = [];
+
+	try {
+		assert.ok(data.length > 0, 'signature must not be empty');
+		switch (opts.type) {
+		case 'rsa':
+			return (parseOneNum(data, type, format, opts));
+		case 'ed25519':
+			return (parseOneNum(data, type, format, opts));
+
+		case 'dsa':
+		case 'ecdsa':
+			if (format === 'asn1')
+				return (parseDSAasn1(data, type, format, opts));
+			else if (opts.type === 'dsa')
+				return (parseDSA(data, type, format, opts));
+			else
+				return (parseECDSA(data, type, format, opts));
+
+		default:
+			throw (new InvalidAlgorithmError(type));
+		}
+
+	} catch (e) {
+		if (e instanceof InvalidAlgorithmError)
+			throw (e);
+		throw (new SignatureParseError(type, format, e));
+	}
+};
+
+function parseOneNum(data, type, format, opts) {
+	if (format === 'ssh') {
+		try {
+			var buf = new SSHBuffer({buffer: data});
+			var head = buf.readString();
+		} catch (e) {
+			/* fall through */
+		}
+		if (buf !== undefined) {
+			var msg = 'SSH signature does not match expected ' +
+			    'type (expected ' + type + ', got ' + head + ')';
+			switch (head) {
+			case 'ssh-rsa':
+				assert.strictEqual(type, 'rsa', msg);
+				opts.hashAlgo = 'sha1';
+				break;
+			case 'rsa-sha2-256':
+				assert.strictEqual(type, 'rsa', msg);
+				opts.hashAlgo = 'sha256';
+				break;
+			case 'rsa-sha2-512':
+				assert.strictEqual(type, 'rsa', msg);
+				opts.hashAlgo = 'sha512';
+				break;
+			case 'ssh-ed25519':
+				assert.strictEqual(type, 'ed25519', msg);
+				opts.hashAlgo = 'sha512';
+				break;
+			default:
+				throw (new Error('Unknown SSH signature ' +
+				    'type: ' + head));
+			}
+			var sig = buf.readPart();
+			assert.ok(buf.atEnd(), 'extra trailing bytes');
+			sig.name = 'sig';
+			opts.parts.push(sig);
+			return (new Signature(opts));
+		}
+	}
+	opts.parts.push({name: 'sig', data: data});
+	return (new Signature(opts));
+}
+
+function parseDSAasn1(data, type, format, opts) {
+	var der = new asn1.BerReader(data);
+	der.readSequence();
+	var r = der.readString(asn1.Ber.Integer, true);
+	var s = der.readString(asn1.Ber.Integer, true);
+
+	opts.parts.push({name: 'r', data: utils.mpNormalize(r)});
+	opts.parts.push({name: 's', data: utils.mpNormalize(s)});
+
+	return (new Signature(opts));
+}
+
+function parseDSA(data, type, format, opts) {
+	if (data.length != 40) {
+		var buf = new SSHBuffer({buffer: data});
+		var d = buf.readBuffer();
+		if (d.toString('ascii') === 'ssh-dss')
+			d = buf.readBuffer();
+		assert.ok(buf.atEnd(), 'extra trailing bytes');
+		assert.strictEqual(d.length, 40, 'invalid inner length');
+		data = d;
+	}
+	opts.parts.push({name: 'r', data: data.slice(0, 20)});
+	opts.parts.push({name: 's', data: data.slice(20, 40)});
+	return (new Signature(opts));
+}
+
+function parseECDSA(data, type, format, opts) {
+	var buf = new SSHBuffer({buffer: data});
+
+	var r, s;
+	var inner = buf.readBuffer();
+	var stype = inner.toString('ascii');
+	if (stype.slice(0, 6) === 'ecdsa-') {
+		var parts = stype.split('-');
+		assert.strictEqual(parts[0], 'ecdsa');
+		assert.strictEqual(parts[1], 'sha2');
+		opts.curve = parts[2];
+		switch (opts.curve) {
+		case 'nistp256':
+			opts.hashAlgo = 'sha256';
+			break;
+		case 'nistp384':
+			opts.hashAlgo = 'sha384';
+			break;
+		case 'nistp521':
+			opts.hashAlgo = 'sha512';
+			break;
+		default:
+			throw (new Error('Unsupported ECDSA curve: ' +
+			    opts.curve));
+		}
+		inner = buf.readBuffer();
+		assert.ok(buf.atEnd(), 'extra trailing bytes on outer');
+		buf = new SSHBuffer({buffer: inner});
+		r = buf.readPart();
+	} else {
+		r = {data: inner};
+	}
+
+	s = buf.readPart();
+	assert.ok(buf.atEnd(), 'extra trailing bytes');
+
+	r.name = 'r';
+	s.name = 's';
+
+	opts.parts.push(r);
+	opts.parts.push(s);
+	return (new Signature(opts));
+}
+
+Signature.isSignature = function (obj, ver) {
+	return (utils.isCompatible(obj, Signature, ver));
+};
+
+/*
+ * API versions for Signature:
+ * [1,0] -- initial ver
+ * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent
+ *          hashAlgorithm property
+ * [2,1] -- first tagged version
+ */
+Signature.prototype._sshpkApiVersion = [2, 1];
+
+Signature._oldVersionDetect = function (obj) {
+	assert.func(obj.toBuffer);
+	if (obj.hasOwnProperty('hashAlgorithm'))
+		return ([2, 0]);
+	return ([1, 0]);
+};
diff --git a/node_modules/sshpk/lib/ssh-buffer.js b/node_modules/sshpk/lib/ssh-buffer.js
new file mode 100644
index 0000000..1dd286c
--- /dev/null
+++ b/node_modules/sshpk/lib/ssh-buffer.js
@@ -0,0 +1,149 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = SSHBuffer;
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+
+function SSHBuffer(opts) {
+	assert.object(opts, 'options');
+	if (opts.buffer !== undefined)
+		assert.buffer(opts.buffer, 'options.buffer');
+
+	this._size = opts.buffer ? opts.buffer.length : 1024;
+	this._buffer = opts.buffer || Buffer.alloc(this._size);
+	this._offset = 0;
+}
+
+SSHBuffer.prototype.toBuffer = function () {
+	return (this._buffer.slice(0, this._offset));
+};
+
+SSHBuffer.prototype.atEnd = function () {
+	return (this._offset >= this._buffer.length);
+};
+
+SSHBuffer.prototype.remainder = function () {
+	return (this._buffer.slice(this._offset));
+};
+
+SSHBuffer.prototype.skip = function (n) {
+	this._offset += n;
+};
+
+SSHBuffer.prototype.expand = function () {
+	this._size *= 2;
+	var buf = Buffer.alloc(this._size);
+	this._buffer.copy(buf, 0);
+	this._buffer = buf;
+};
+
+SSHBuffer.prototype.readPart = function () {
+	return ({data: this.readBuffer()});
+};
+
+SSHBuffer.prototype.readBuffer = function () {
+	var len = this._buffer.readUInt32BE(this._offset);
+	this._offset += 4;
+	assert.ok(this._offset + len <= this._buffer.length,
+	    'length out of bounds at +0x' + this._offset.toString(16) +
+	    ' (data truncated?)');
+	var buf = this._buffer.slice(this._offset, this._offset + len);
+	this._offset += len;
+	return (buf);
+};
+
+SSHBuffer.prototype.readString = function () {
+	return (this.readBuffer().toString());
+};
+
+SSHBuffer.prototype.readCString = function () {
+	var offset = this._offset;
+	while (offset < this._buffer.length &&
+	    this._buffer[offset] !== 0x00)
+		offset++;
+	assert.ok(offset < this._buffer.length, 'c string does not terminate');
+	var str = this._buffer.slice(this._offset, offset).toString();
+	this._offset = offset + 1;
+	return (str);
+};
+
+SSHBuffer.prototype.readInt = function () {
+	var v = this._buffer.readUInt32BE(this._offset);
+	this._offset += 4;
+	return (v);
+};
+
+SSHBuffer.prototype.readInt64 = function () {
+	assert.ok(this._offset + 8 < this._buffer.length,
+	    'buffer not long enough to read Int64');
+	var v = this._buffer.slice(this._offset, this._offset + 8);
+	this._offset += 8;
+	return (v);
+};
+
+SSHBuffer.prototype.readChar = function () {
+	var v = this._buffer[this._offset++];
+	return (v);
+};
+
+SSHBuffer.prototype.writeBuffer = function (buf) {
+	while (this._offset + 4 + buf.length > this._size)
+		this.expand();
+	this._buffer.writeUInt32BE(buf.length, this._offset);
+	this._offset += 4;
+	buf.copy(this._buffer, this._offset);
+	this._offset += buf.length;
+};
+
+SSHBuffer.prototype.writeString = function (str) {
+	this.writeBuffer(Buffer.from(str, 'utf8'));
+};
+
+SSHBuffer.prototype.writeCString = function (str) {
+	while (this._offset + 1 + str.length > this._size)
+		this.expand();
+	this._buffer.write(str, this._offset);
+	this._offset += str.length;
+	this._buffer[this._offset++] = 0;
+};
+
+SSHBuffer.prototype.writeInt = function (v) {
+	while (this._offset + 4 > this._size)
+		this.expand();
+	this._buffer.writeUInt32BE(v, this._offset);
+	this._offset += 4;
+};
+
+SSHBuffer.prototype.writeInt64 = function (v) {
+	assert.buffer(v, 'value');
+	if (v.length > 8) {
+		var lead = v.slice(0, v.length - 8);
+		for (var i = 0; i < lead.length; ++i) {
+			assert.strictEqual(lead[i], 0,
+			    'must fit in 64 bits of precision');
+		}
+		v = v.slice(v.length - 8, v.length);
+	}
+	while (this._offset + 8 > this._size)
+		this.expand();
+	v.copy(this._buffer, this._offset);
+	this._offset += 8;
+};
+
+SSHBuffer.prototype.writeChar = function (v) {
+	while (this._offset + 1 > this._size)
+		this.expand();
+	this._buffer[this._offset++] = v;
+};
+
+SSHBuffer.prototype.writePart = function (p) {
+	this.writeBuffer(p.data);
+};
+
+SSHBuffer.prototype.write = function (buf) {
+	while (this._offset + buf.length > this._size)
+		this.expand();
+	buf.copy(this._buffer, this._offset);
+	this._offset += buf.length;
+};
diff --git a/node_modules/sshpk/lib/utils.js b/node_modules/sshpk/lib/utils.js
new file mode 100644
index 0000000..6b83a32
--- /dev/null
+++ b/node_modules/sshpk/lib/utils.js
@@ -0,0 +1,404 @@
+// Copyright 2015 Joyent, Inc.
+
+module.exports = {
+	bufferSplit: bufferSplit,
+	addRSAMissing: addRSAMissing,
+	calculateDSAPublic: calculateDSAPublic,
+	calculateED25519Public: calculateED25519Public,
+	calculateX25519Public: calculateX25519Public,
+	mpNormalize: mpNormalize,
+	mpDenormalize: mpDenormalize,
+	ecNormalize: ecNormalize,
+	countZeros: countZeros,
+	assertCompatible: assertCompatible,
+	isCompatible: isCompatible,
+	opensslKeyDeriv: opensslKeyDeriv,
+	opensshCipherInfo: opensshCipherInfo,
+	publicFromPrivateECDSA: publicFromPrivateECDSA,
+	zeroPadToLength: zeroPadToLength,
+	writeBitString: writeBitString,
+	readBitString: readBitString,
+	pbkdf2: pbkdf2
+};
+
+var assert = require('assert-plus');
+var Buffer = require('safer-buffer').Buffer;
+var PrivateKey = require('./private-key');
+var Key = require('./key');
+var crypto = require('crypto');
+var algs = require('./algs');
+var asn1 = require('asn1');
+
+var ec = require('ecc-jsbn/lib/ec');
+var jsbn = require('jsbn').BigInteger;
+var nacl = require('tweetnacl');
+
+var MAX_CLASS_DEPTH = 3;
+
+function isCompatible(obj, klass, needVer) {
+	if (obj === null || typeof (obj) !== 'object')
+		return (false);
+	if (needVer === undefined)
+		needVer = klass.prototype._sshpkApiVersion;
+	if (obj instanceof klass &&
+	    klass.prototype._sshpkApiVersion[0] == needVer[0])
+		return (true);
+	var proto = Object.getPrototypeOf(obj);
+	var depth = 0;
+	while (proto.constructor.name !== klass.name) {
+		proto = Object.getPrototypeOf(proto);
+		if (!proto || ++depth > MAX_CLASS_DEPTH)
+			return (false);
+	}
+	if (proto.constructor.name !== klass.name)
+		return (false);
+	var ver = proto._sshpkApiVersion;
+	if (ver === undefined)
+		ver = klass._oldVersionDetect(obj);
+	if (ver[0] != needVer[0] || ver[1] < needVer[1])
+		return (false);
+	return (true);
+}
+
+function assertCompatible(obj, klass, needVer, name) {
+	if (name === undefined)
+		name = 'object';
+	assert.ok(obj, name + ' must not be null');
+	assert.object(obj, name + ' must be an object');
+	if (needVer === undefined)
+		needVer = klass.prototype._sshpkApiVersion;
+	if (obj instanceof klass &&
+	    klass.prototype._sshpkApiVersion[0] == needVer[0])
+		return;
+	var proto = Object.getPrototypeOf(obj);
+	var depth = 0;
+	while (proto.constructor.name !== klass.name) {
+		proto = Object.getPrototypeOf(proto);
+		assert.ok(proto && ++depth <= MAX_CLASS_DEPTH,
+		    name + ' must be a ' + klass.name + ' instance');
+	}
+	assert.strictEqual(proto.constructor.name, klass.name,
+	    name + ' must be a ' + klass.name + ' instance');
+	var ver = proto._sshpkApiVersion;
+	if (ver === undefined)
+		ver = klass._oldVersionDetect(obj);
+	assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1],
+	    name + ' must be compatible with ' + klass.name + ' klass ' +
+	    'version ' + needVer[0] + '.' + needVer[1]);
+}
+
+var CIPHER_LEN = {
+	'des-ede3-cbc': { key: 24, iv: 8 },
+	'aes-128-cbc': { key: 16, iv: 16 },
+	'aes-256-cbc': { key: 32, iv: 16 }
+};
+var PKCS5_SALT_LEN = 8;
+
+function opensslKeyDeriv(cipher, salt, passphrase, count) {
+	assert.buffer(salt, 'salt');
+	assert.buffer(passphrase, 'passphrase');
+	assert.number(count, 'iteration count');
+
+	var clen = CIPHER_LEN[cipher];
+	assert.object(clen, 'supported cipher');
+
+	salt = salt.slice(0, PKCS5_SALT_LEN);
+
+	var D, D_prev, bufs;
+	var material = Buffer.alloc(0);
+	while (material.length < clen.key + clen.iv) {
+		bufs = [];
+		if (D_prev)
+			bufs.push(D_prev);
+		bufs.push(passphrase);
+		bufs.push(salt);
+		D = Buffer.concat(bufs);
+		for (var j = 0; j < count; ++j)
+			D = crypto.createHash('md5').update(D).digest();
+		material = Buffer.concat([material, D]);
+		D_prev = D;
+	}
+
+	return ({
+	    key: material.slice(0, clen.key),
+	    iv: material.slice(clen.key, clen.key + clen.iv)
+	});
+}
+
+/* See: RFC2898 */
+function pbkdf2(hashAlg, salt, iterations, size, passphrase) {
+	var hkey = Buffer.alloc(salt.length + 4);
+	salt.copy(hkey);
+
+	var gen = 0, ts = [];
+	var i = 1;
+	while (gen < size) {
+		var t = T(i++);
+		gen += t.length;
+		ts.push(t);
+	}
+	return (Buffer.concat(ts).slice(0, size));
+
+	function T(I) {
+		hkey.writeUInt32BE(I, hkey.length - 4);
+
+		var hmac = crypto.createHmac(hashAlg, passphrase);
+		hmac.update(hkey);
+
+		var Ti = hmac.digest();
+		var Uc = Ti;
+		var c = 1;
+		while (c++ < iterations) {
+			hmac = crypto.createHmac(hashAlg, passphrase);
+			hmac.update(Uc);
+			Uc = hmac.digest();
+			for (var x = 0; x < Ti.length; ++x)
+				Ti[x] ^= Uc[x];
+		}
+		return (Ti);
+	}
+}
+
+/* Count leading zero bits on a buffer */
+function countZeros(buf) {
+	var o = 0, obit = 8;
+	while (o < buf.length) {
+		var mask = (1 << obit);
+		if ((buf[o] & mask) === mask)
+			break;
+		obit--;
+		if (obit < 0) {
+			o++;
+			obit = 8;
+		}
+	}
+	return (o*8 + (8 - obit) - 1);
+}
+
+function bufferSplit(buf, chr) {
+	assert.buffer(buf);
+	assert.string(chr);
+
+	var parts = [];
+	var lastPart = 0;
+	var matches = 0;
+	for (var i = 0; i < buf.length; ++i) {
+		if (buf[i] === chr.charCodeAt(matches))
+			++matches;
+		else if (buf[i] === chr.charCodeAt(0))
+			matches = 1;
+		else
+			matches = 0;
+
+		if (matches >= chr.length) {
+			var newPart = i + 1;
+			parts.push(buf.slice(lastPart, newPart - matches));
+			lastPart = newPart;
+			matches = 0;
+		}
+	}
+	if (lastPart <= buf.length)
+		parts.push(buf.slice(lastPart, buf.length));
+
+	return (parts);
+}
+
+function ecNormalize(buf, addZero) {
+	assert.buffer(buf);
+	if (buf[0] === 0x00 && buf[1] === 0x04) {
+		if (addZero)
+			return (buf);
+		return (buf.slice(1));
+	} else if (buf[0] === 0x04) {
+		if (!addZero)
+			return (buf);
+	} else {
+		while (buf[0] === 0x00)
+			buf = buf.slice(1);
+		if (buf[0] === 0x02 || buf[0] === 0x03)
+			throw (new Error('Compressed elliptic curve points ' +
+			    'are not supported'));
+		if (buf[0] !== 0x04)
+			throw (new Error('Not a valid elliptic curve point'));
+		if (!addZero)
+			return (buf);
+	}
+	var b = Buffer.alloc(buf.length + 1);
+	b[0] = 0x0;
+	buf.copy(b, 1);
+	return (b);
+}
+
+function readBitString(der, tag) {
+	if (tag === undefined)
+		tag = asn1.Ber.BitString;
+	var buf = der.readString(tag, true);
+	assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' +
+	    'not supported (0x' + buf[0].toString(16) + ')');
+	return (buf.slice(1));
+}
+
+function writeBitString(der, buf, tag) {
+	if (tag === undefined)
+		tag = asn1.Ber.BitString;
+	var b = Buffer.alloc(buf.length + 1);
+	b[0] = 0x00;
+	buf.copy(b, 1);
+	der.writeBuffer(b, tag);
+}
+
+function mpNormalize(buf) {
+	assert.buffer(buf);
+	while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00)
+		buf = buf.slice(1);
+	if ((buf[0] & 0x80) === 0x80) {
+		var b = Buffer.alloc(buf.length + 1);
+		b[0] = 0x00;
+		buf.copy(b, 1);
+		buf = b;
+	}
+	return (buf);
+}
+
+function mpDenormalize(buf) {
+	assert.buffer(buf);
+	while (buf.length > 1 && buf[0] === 0x00)
+		buf = buf.slice(1);
+	return (buf);
+}
+
+function zeroPadToLength(buf, len) {
+	assert.buffer(buf);
+	assert.number(len);
+	while (buf.length > len) {
+		assert.equal(buf[0], 0x00);
+		buf = buf.slice(1);
+	}
+	while (buf.length < len) {
+		var b = Buffer.alloc(buf.length + 1);
+		b[0] = 0x00;
+		buf.copy(b, 1);
+		buf = b;
+	}
+	return (buf);
+}
+
+function bigintToMpBuf(bigint) {
+	var buf = Buffer.from(bigint.toByteArray());
+	buf = mpNormalize(buf);
+	return (buf);
+}
+
+function calculateDSAPublic(g, p, x) {
+	assert.buffer(g);
+	assert.buffer(p);
+	assert.buffer(x);
+	g = new jsbn(g);
+	p = new jsbn(p);
+	x = new jsbn(x);
+	var y = g.modPow(x, p);
+	var ybuf = bigintToMpBuf(y);
+	return (ybuf);
+}
+
+function calculateED25519Public(k) {
+	assert.buffer(k);
+
+	var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k));
+	return (Buffer.from(kp.publicKey));
+}
+
+function calculateX25519Public(k) {
+	assert.buffer(k);
+
+	var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k));
+	return (Buffer.from(kp.publicKey));
+}
+
+function addRSAMissing(key) {
+	assert.object(key);
+	assertCompatible(key, PrivateKey, [1, 1]);
+
+	var d = new jsbn(key.part.d.data);
+	var buf;
+
+	if (!key.part.dmodp) {
+		var p = new jsbn(key.part.p.data);
+		var dmodp = d.mod(p.subtract(1));
+
+		buf = bigintToMpBuf(dmodp);
+		key.part.dmodp = {name: 'dmodp', data: buf};
+		key.parts.push(key.part.dmodp);
+	}
+	if (!key.part.dmodq) {
+		var q = new jsbn(key.part.q.data);
+		var dmodq = d.mod(q.subtract(1));
+
+		buf = bigintToMpBuf(dmodq);
+		key.part.dmodq = {name: 'dmodq', data: buf};
+		key.parts.push(key.part.dmodq);
+	}
+}
+
+function publicFromPrivateECDSA(curveName, priv) {
+	assert.string(curveName, 'curveName');
+	assert.buffer(priv);
+	var params = algs.curves[curveName];
+	var p = new jsbn(params.p);
+	var a = new jsbn(params.a);
+	var b = new jsbn(params.b);
+	var curve = new ec.ECCurveFp(p, a, b);
+	var G = curve.decodePointHex(params.G.toString('hex'));
+
+	var d = new jsbn(mpNormalize(priv));
+	var pub = G.multiply(d);
+	pub = Buffer.from(curve.encodePointHex(pub), 'hex');
+
+	var parts = [];
+	parts.push({name: 'curve', data: Buffer.from(curveName)});
+	parts.push({name: 'Q', data: pub});
+
+	var key = new Key({type: 'ecdsa', curve: curve, parts: parts});
+	return (key);
+}
+
+function opensshCipherInfo(cipher) {
+	var inf = {};
+	switch (cipher) {
+	case '3des-cbc':
+		inf.keySize = 24;
+		inf.blockSize = 8;
+		inf.opensslName = 'des-ede3-cbc';
+		break;
+	case 'blowfish-cbc':
+		inf.keySize = 16;
+		inf.blockSize = 8;
+		inf.opensslName = 'bf-cbc';
+		break;
+	case 'aes128-cbc':
+	case 'aes128-ctr':
+	case 'aes128-gcm@openssh.com':
+		inf.keySize = 16;
+		inf.blockSize = 16;
+		inf.opensslName = 'aes-128-' + cipher.slice(7, 10);
+		break;
+	case 'aes192-cbc':
+	case 'aes192-ctr':
+	case 'aes192-gcm@openssh.com':
+		inf.keySize = 24;
+		inf.blockSize = 16;
+		inf.opensslName = 'aes-192-' + cipher.slice(7, 10);
+		break;
+	case 'aes256-cbc':
+	case 'aes256-ctr':
+	case 'aes256-gcm@openssh.com':
+		inf.keySize = 32;
+		inf.blockSize = 16;
+		inf.opensslName = 'aes-256-' + cipher.slice(7, 10);
+		break;
+	default:
+		throw (new Error(
+		    'Unsupported openssl cipher "' + cipher + '"'));
+	}
+	return (inf);
+}
diff --git a/node_modules/sshpk/man/man1/sshpk-conv.1 b/node_modules/sshpk/man/man1/sshpk-conv.1
new file mode 100644
index 0000000..0887dce
--- /dev/null
+++ b/node_modules/sshpk/man/man1/sshpk-conv.1
@@ -0,0 +1,135 @@
+.TH sshpk\-conv 1 "Jan 2016" sshpk "sshpk Commands"
+.SH NAME
+.PP
+sshpk\-conv \- convert between key formats
+.SH SYNOPSYS
+.PP
+\fB\fCsshpk\-conv\fR \-t FORMAT [FILENAME] [OPTIONS...]
+.PP
+\fB\fCsshpk\-conv\fR \-i [FILENAME] [OPTIONS...]
+.SH DESCRIPTION
+.PP
+Reads in a public or private key and converts it between different formats,
+particularly formats used in the SSH protocol and the well\-known PEM PKCS#1/7
+formats.
+.PP
+In the second form, with the \fB\fC\-i\fR option given, identifies a key and prints to 
+stderr information about its nature, size and fingerprint.
+.SH EXAMPLES
+.PP
+Assume the following SSH\-format public key in \fB\fCid_ecdsa.pub\fR:
+.PP
+.RS
+.nf
+ecdsa\-sha2\-nistp256 AAAAE2VjZHNhLXNoYTI...9M/4c4= user@host
+.fi
+.RE
+.PP
+Identify it with \fB\fC\-i\fR:
+.PP
+.RS
+.nf
+$ sshpk\-conv \-i id_ecdsa.pub
+id_ecdsa: a 256 bit ECDSA public key
+ECDSA curve: nistp256
+Comment: user@host
+Fingerprint:
+  SHA256:vCNX7eUkdvqqW0m4PoxQAZRv+CM4P4fS8+CbliAvS4k
+  81:ad:d5:57:e5:6f:7d:a2:93:79:56:af:d7:c0:38:51
+.fi
+.RE
+.PP
+Convert it to \fB\fCpkcs8\fR format, for use with e.g. OpenSSL:
+.PP
+.RS
+.nf
+$ sshpk\-conv \-t pkcs8 id_ecdsa
+\-\-\-\-\-BEGIN PUBLIC KEY\-\-\-\-\-
+MFkwEwYHKoZIzj0CAQYIKoZIzj0DAQcDQgAEAsA4R6N6AS3gzaPBeLjG2ObSgUsR
+zOt+kWJoijLnw3ZMYUKmAx+lD0I5XUxdrPcs1vH5f3cn9TvRvO9L0z/hzg==
+\-\-\-\-\-END PUBLIC KEY\-\-\-\-\-
+.fi
+.RE
+.PP
+Retrieve the public half of a private key:
+.PP
+.RS
+.nf
+$ openssl genrsa 2048 | sshpk\-conv \-t ssh \-c foo@bar
+ssh\-rsa AAAAB3NzaC1yc2EAAA...koK7 foo@bar
+.fi
+.RE
+.PP
+Convert a private key to PKCS#1 (OpenSSL) format from a new\-style OpenSSH key
+format (the \fB\fCssh\-keygen \-o\fR format):
+.PP
+.RS
+.nf
+$ ssh\-keygen \-o \-f foobar
+\&...
+$ sshpk\-conv \-p \-t pkcs1 foobar
+\-\-\-\-\-BEGIN RSA PRIVATE KEY\-\-\-\-\-
+MIIDpAIBAAKCAQEA6T/GYJndb1TRH3+NL....
+\-\-\-\-\-END RSA PRIVATE KEY\-\-\-\-\-
+.fi
+.RE
+.SH OPTIONS
+.TP
+\fB\fC\-i, \-\-identify\fR
+Instead of converting the key, output identifying information about it to 
+stderr, including its type, size and fingerprints.
+.TP
+\fB\fC\-p, \-\-private\fR
+Treat the key as a private key instead of a public key (the default). If you
+supply \fB\fCsshpk\-conv\fR with a private key and do not give this option, it will
+extract only the public half of the key from it and work with that.
+.TP
+\fB\fC\-f PATH, \-\-file=PATH\fR
+Input file to take the key from instead of stdin. If a filename is supplied
+as a positional argument, it is equivalent to using this option.
+.TP
+\fB\fC\-o PATH, \-\-out=PATH\fR
+Output file name to use instead of stdout.
+.PP
+\fB\fC\-T FORMAT, \-\-informat=FORMAT\fR
+.TP
+\fB\fC\-t FORMAT, \-\-outformat=FORMAT\fR
+Selects the input and output formats to be used (see FORMATS, below).
+.TP
+\fB\fC\-c TEXT, \-\-comment=TEXT\fR
+Sets the key comment for the output file, if supported.
+.SH FORMATS
+.PP
+Currently supported formats:
+.TP
+\fB\fCpem, pkcs1\fR
+The standard PEM format used by older OpenSSH and most TLS libraries such as
+OpenSSL. The classic \fB\fCid_rsa\fR file is usually in this format. It is an ASN.1
+encoded structure, base64\-encoded and placed between PEM headers.
+.TP
+\fB\fCssh\fR
+The SSH public key text format (the format of an \fB\fCid_rsa.pub\fR file). A single
+line, containing 3 space separated parts: the key type, key body and optional
+key comment.
+.TP
+\fB\fCpkcs8\fR
+A newer PEM format, usually used only for public keys by TLS libraries such
+as OpenSSL. The ASN.1 structure is more generic than that of \fB\fCpkcs1\fR\&.
+.TP
+\fB\fCopenssh\fR
+The new \fB\fCssh\-keygen \-o\fR format from OpenSSH. This can be mistaken for a PEM
+encoding but is actually an OpenSSH internal format.
+.TP
+\fB\fCrfc4253\fR
+The internal binary format of keys when sent over the wire in the SSH
+protocol. This is also the format that the \fB\fCssh\-agent\fR uses in its protocol.
+.SH SEE ALSO
+.PP
+.BR ssh-keygen (1), 
+.BR openssl (1)
+.SH BUGS
+.PP
+Encrypted (password\-protected) keys are not supported.
+.PP
+Report bugs at Github
+\[la]https://github.com/arekinath/node-sshpk/issues\[ra]
diff --git a/node_modules/sshpk/man/man1/sshpk-sign.1 b/node_modules/sshpk/man/man1/sshpk-sign.1
new file mode 100644
index 0000000..749916b
--- /dev/null
+++ b/node_modules/sshpk/man/man1/sshpk-sign.1
@@ -0,0 +1,81 @@
+.TH sshpk\-sign 1 "Jan 2016" sshpk "sshpk Commands"
+.SH NAME
+.PP
+sshpk\-sign \- sign data using an SSH key
+.SH SYNOPSYS
+.PP
+\fB\fCsshpk\-sign\fR \-i KEYPATH [OPTION...]
+.SH DESCRIPTION
+.PP
+Takes in arbitrary bytes, and signs them using an SSH private key. The key can
+be of any type or format supported by the \fB\fCsshpk\fR library, including the
+standard OpenSSH formats, as well as PEM PKCS#1 and PKCS#8.
+.PP
+The signature is printed out in Base64 encoding, unless the \fB\fC\-\-binary\fR or \fB\fC\-b\fR
+option is given.
+.SH EXAMPLES
+.PP
+Signing with default settings:
+.PP
+.RS
+.nf
+$ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa
+MEUCIAMdLS/vXrrtWFepwe...
+.fi
+.RE
+.PP
+Signing in SSH (RFC 4253) format (rather than the default ASN.1):
+.PP
+.RS
+.nf
+$ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa \-t ssh
+AAAAFGVjZHNhLXNoYTIt...
+.fi
+.RE
+.PP
+Saving the binary signature to a file:
+.PP
+.RS
+.nf
+$ printf 'foo' | sshpk\-sign \-i ~/.ssh/id_ecdsa \\
+                            \-o signature.bin \-b
+$ cat signature.bin | base64
+MEUCIAMdLS/vXrrtWFepwe...
+.fi
+.RE
+.SH OPTIONS
+.TP
+\fB\fC\-v, \-\-verbose\fR
+Print extra information about the key and signature to stderr when signing.
+.TP
+\fB\fC\-b, \-\-binary\fR
+Don't base64\-encode the signature before outputting it.
+.TP
+\fB\fC\-i KEY, \-\-identity=KEY\fR
+Select the key to be used for signing. \fB\fCKEY\fR must be a relative or absolute
+filesystem path to the key file. Any format supported by the \fB\fCsshpk\fR library
+is supported, including OpenSSH formats and standard PEM PKCS.
+.TP
+\fB\fC\-f PATH, \-\-file=PATH\fR
+Input file to sign instead of stdin.
+.TP
+\fB\fC\-o PATH, \-\-out=PATH\fR
+Output file to save signature in instead of stdout.
+.TP
+\fB\fC\-H HASH, \-\-hash=HASH\fR
+Set the hash algorithm to be used for signing. This should be one of \fB\fCsha1\fR,
+\fB\fCsha256\fR or \fB\fCsha512\fR\&. Some key types may place restrictions on which hash
+algorithms may be used (e.g. ED25519 keys can only use SHA\-512).
+.TP
+\fB\fC\-t FORMAT, \-\-format=FORMAT\fR
+Choose the signature format to use, from \fB\fCasn1\fR, \fB\fCssh\fR or \fB\fCraw\fR (only for
+ED25519 signatures). The \fB\fCasn1\fR format is the default, as it is the format
+used with TLS and typically the standard in most non\-SSH libraries (e.g.
+OpenSSL). The \fB\fCssh\fR format is used in the SSH protocol and by the ssh\-agent.
+.SH SEE ALSO
+.PP
+.BR sshpk-verify (1)
+.SH BUGS
+.PP
+Report bugs at Github
+\[la]https://github.com/arekinath/node-sshpk/issues\[ra]
diff --git a/node_modules/sshpk/man/man1/sshpk-verify.1 b/node_modules/sshpk/man/man1/sshpk-verify.1
new file mode 100644
index 0000000..f79169d
--- /dev/null
+++ b/node_modules/sshpk/man/man1/sshpk-verify.1
@@ -0,0 +1,68 @@
+.TH sshpk\-verify 1 "Jan 2016" sshpk "sshpk Commands"
+.SH NAME
+.PP
+sshpk\-verify \- verify a signature on data using an SSH key
+.SH SYNOPSYS
+.PP
+\fB\fCsshpk\-verify\fR \-i KEYPATH \-s SIGNATURE [OPTION...]
+.SH DESCRIPTION
+.PP
+Takes in arbitrary bytes and a Base64\-encoded signature, and verifies that the
+signature was produced by the private half of the given SSH public key.
+.SH EXAMPLES
+.PP
+.RS
+.nf
+$ printf 'foo' | sshpk\-verify \-i ~/.ssh/id_ecdsa \-s MEUCIQCYp...
+OK
+$ printf 'foo' | sshpk\-verify \-i ~/.ssh/id_ecdsa \-s GARBAGE...
+NOT OK
+.fi
+.RE
+.SH EXIT STATUS
+.TP
+\fB\fC0\fR
+Signature validates and matches the key.
+.TP
+\fB\fC1\fR
+Signature is parseable and the correct length but does not match the key or
+otherwise is invalid.
+.TP
+\fB\fC2\fR
+The signature or key could not be parsed.
+.TP
+\fB\fC3\fR
+Invalid commandline options were supplied.
+.SH OPTIONS
+.TP
+\fB\fC\-v, \-\-verbose\fR
+Print extra information about the key and signature to stderr when verifying.
+.TP
+\fB\fC\-i KEY, \-\-identity=KEY\fR
+Select the key to be used for verification. \fB\fCKEY\fR must be a relative or
+absolute filesystem path to the key file. Any format supported by the \fB\fCsshpk\fR
+library is supported, including OpenSSH formats and standard PEM PKCS.
+.TP
+\fB\fC\-s BASE64, \-\-signature=BASE64\fR
+Supplies the base64\-encoded signature to be verified.
+.TP
+\fB\fC\-f PATH, \-\-file=PATH\fR
+Input file to verify instead of stdin.
+.TP
+\fB\fC\-H HASH, \-\-hash=HASH\fR
+Set the hash algorithm to be used for signing. This should be one of \fB\fCsha1\fR,
+\fB\fCsha256\fR or \fB\fCsha512\fR\&. Some key types may place restrictions on which hash
+algorithms may be used (e.g. ED25519 keys can only use SHA\-512).
+.TP
+\fB\fC\-t FORMAT, \-\-format=FORMAT\fR
+Choose the signature format to use, from \fB\fCasn1\fR, \fB\fCssh\fR or \fB\fCraw\fR (only for
+ED25519 signatures). The \fB\fCasn1\fR format is the default, as it is the format
+used with TLS and typically the standard in most non\-SSH libraries (e.g.
+OpenSSL). The \fB\fCssh\fR format is used in the SSH protocol and by the ssh\-agent.
+.SH SEE ALSO
+.PP
+.BR sshpk-sign (1)
+.SH BUGS
+.PP
+Report bugs at Github
+\[la]https://github.com/arekinath/node-sshpk/issues\[ra]
diff --git a/node_modules/sshpk/package.json b/node_modules/sshpk/package.json
new file mode 100644
index 0000000..cc78787
--- /dev/null
+++ b/node_modules/sshpk/package.json
@@ -0,0 +1,60 @@
+{
+  "name": "sshpk",
+  "version": "1.16.1",
+  "description": "A library for finding and using SSH public keys",
+  "main": "lib/index.js",
+  "scripts": {
+    "test": "tape test/*.js"
+  },
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/joyent/node-sshpk.git"
+  },
+  "author": "Joyent, Inc",
+  "contributors": [
+    {
+      "name": "Dave Eddy",
+      "email": "dave@daveeddy.com"
+    },
+    {
+      "name": "Mark Cavage",
+      "email": "mcavage@gmail.com"
+    },
+    {
+      "name": "Alex Wilson",
+      "email": "alex@cooperi.net"
+    }
+  ],
+  "license": "MIT",
+  "bugs": {
+    "url": "https://github.com/arekinath/node-sshpk/issues"
+  },
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "directories": {
+    "bin": "./bin",
+    "lib": "./lib",
+    "man": "./man/man1"
+  },
+  "homepage": "https://github.com/arekinath/node-sshpk#readme",
+  "dependencies": {
+    "asn1": "~0.2.3",
+    "assert-plus": "^1.0.0",
+    "dashdash": "^1.12.0",
+    "getpass": "^0.1.1",
+    "safer-buffer": "^2.0.2",
+    "jsbn": "~0.1.0",
+    "tweetnacl": "~0.14.0",
+    "ecc-jsbn": "~0.1.1",
+    "bcrypt-pbkdf": "^1.0.0"
+  },
+  "optionalDependencies": {
+  },
+  "devDependencies": {
+    "tape": "^3.5.0",
+    "benchmark": "^1.0.0",
+    "sinon": "^1.17.2",
+    "temp": "^0.8.2"
+  }
+}